| Sodium tetraborate pentahydrate |

Last updated: 31/10/2025
|
 |
(Also known as: sodium borate; sodium tetraborate; disodium tetraborate; borax decahydrate ; borax) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
|
|
|
A naturally occuring mineral salt that has insecticidal, fungicidal and herbicidal activity |
|
|
Ants; Termites; Cockroaches; Silverfish; Waterbugs |
|
|
Mainly non-cropped situations |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
B₄H₁₀Na₂O₁₂ |
|
|
B(O)(O)O.O.O.O.O.O.[Na+] |
|
|
- |
|
|
OPBPQNWVXFJUKS-UHFFFAOYSA-N |
|
|
InChI=1S/BH3O3.Na.5H2O/c2-1(3)4;;;;;;/h2-4H;;5*1H2/q;+1;;;;; |
|
|
Yes |
|
|
Insecticide; Fungicide |
|
|
Inorganic compound |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Stomach poison for insects. Multi-site activity. |
|
|
Naturally occurring mineral that exist in trace amounts in rock, soil & water |
|
|
Non-crop applications |
|
|
- |
|
|
11130-12-4 |
|
|
12179-04-3 |
|
|
601-071-6 |
|
|
- |
|
|
011111 |
|
|
No data |
|
|
No data found |
|
|
291.29 |
|
|
- |
|
|
- |
|
|
sodium tetraborate pentahydrate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
Yes [ C4 Criterion 4: Pesticide active ingredients that meet the criteria of reproductive toxicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H360) ] |
|
|
Yes [ R04 Rule 4: Pesticide active ingredients that meet the criteria of reproductive toxicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H360) ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
8D |
|
|
NC |
|
|
- |
|
|
White, odourless powder |
|
|
|
|
|
Current |
|
|
1946, first registered as insecticide in USA |
|
|
- U.S. Borax Inc.
- Pacific Coast Borax Company
|
|
|
- Borateem
- Gerstely
- Polubor
- Solubor
- 20 Mule Team Borax
|
|
|
Formulated as a white crystalline substance |
|
|
Sodium tetraborate pentahydrate is commercially produced through a multi-step chemical process that typically begins with the reaction of colemanite, a naturally occurring borate mineral, with sodium carbonate in water. This reaction yields an aqueous solution containing sodium tetraborate and sodium hydroxide, while precipitating calcium carbonate as a byproduct. After removing the solid calcium carbonate, the solution is treated with boric acid to neutralize the sodium hydroxide and increase the yield of sodium tetraborate. The final step involves crystallising sodium tetraborate pentahydrate from the solution by controlled cooling, resulting in high-purity white crystals. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
36000 |
|
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1575 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.50 X 1000 |
Calculated |
- |
|
|
0.175 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.82 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
2660 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2510 |
Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 187 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Eisenia foetida as boric acid |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 362 |
|
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 65 |
Oncorhynchus mykiss as boron |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 133 |
Daphnia magna as boron |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1.2 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Chlorella vulgaris as boron |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
266 |
Worst case of acute and chronic mammals |
|
|
251 |
Worst case of acute and chronic birds |
|
|
18.7 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
7.24 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.65 |
Worst case of temperate acute and chronic fish |
|
|
1.33 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.12 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
2660 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Ingestion may cause gastrointestinal problems Possible testes toxicant |
|
|
|
|
|
Non-flammable, flame retardent |
|
|
Health: H360FD |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
sodium tetraborate pentahydrate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
31/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.