| 8-methyl-2-decanol propionate |

Last updated: 04/02/2026
|
 |
(Also known as: Western corn rootworm sex pheromone; WCR sex pheromone; 8-methyldecan-2-yl propanoate; 8-M-2-DP) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
|
|
|
A semio-chemical emitted by females of several Diabrotica species, particularly Diabrotica virgifera virgifera which can be used to distrupt mating |
|
|
Western corn rootworm |
|
|
Maize; Sweetcorn |
|
|
Efficiacy trials demonstrated product use leads to reduced Diabrotica pressure and so corn damage |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
None |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Pending |
|
|
Austria |
|
|
Not applicable |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
✓ |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Technical material is a racemic mixture. Substance has two chiral centres |
|
|
C₁₄H₂₈O₂ |
|
|
CCC(C)CCCCCC(C)O.CCC(=O)O |
|
|
- |
|
|
QSDDGUCZFFODTR-UHFFFAOYSA-N |
|
|
InChI=1S/C11H24O.C3H6O2/c1-4-10(2)8-6-5-7-9-11(3)12;1-2-3(4)5/h10-12H,4-9H2,1-3H3;2H2,1H3,(H,4,5) |
|
|
Yes |
|
|
Insecticide; Semiochemical |
|
|
Pheromone |
|
|
938 g kg⁻¹ |
|
|
EFSA 2023 dossier: None declared |
|
|
Natural |
|
|
Functions as an insect attractant - mating disrupter |
|
|
Isolated and identified from virgin females of the western corn rootworm (WCR), Diabrotica virgifera virgifera LeConte |
|
|
Crop protection |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
81931-28-4 |
|
|
- |
|
|
- |
|
|
- |
|
|
71407379 |
|
|
228.3 |
|
|
- |
|
|
8-methyldecan-2-ol; propanoic acid |
|
|
8-methyl-2-decanol propionate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
Yes [ R09 Rule 9: Pesticide active ingredients that have demonstrated a high aquatic toxicity (where acute ecotoxicity for fish, invertebrates or algae =< 0.1 mg l⁻¹) ; R12 Rule 12: Pesticide active ingredients that are bioaccumulative (where bio-concentration factor (BCF) > 2000 l kg⁻¹ (if BCF is not available, where Log P >=5)) ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless to light yellow liquid |
|
|
|
|
|
Current |
|
|
- |
|
|
- Lithos Crop Protect GmbH
- Austria
|
|
|
- Pherolit-d
- Lithos Corn Protect
|
|
|
Usually supplied in slow release formulations and dispensers |
|
|
The commercial production of pheromone attractants and lures involves a sophisticated blend of synthetic chemistry, entomology, and precision engineering. Manufacturers begin by identifying the specific pheromone compounds emitted by target pests, such as sex, aggregation, or alarm pheromones, and then replicate these molecules using chemical synthesis. |
|
|
While exact CO₂e values are not published for specific pheromones, some general information is available. The PHERA reported that biotechnological production (e.g. yeast fermentation) of pheromones can reduce GHG emissions by up to 90% compared to traditional chemical synthesis and GHG emissions are typically in the 5 to 10 kg CO₂e per kg of pheromone produced. Other sources suggest that small scale pheromone synthesis typically has emissions in the range 1 – 3 kg CO₂e per kg of pheromone produced. |
|
|
|
|
|
|
|
|
|
|
0.290 |
|
Low |
|
|
250000 |
Hexane |
- |
| 250000 |
Toluene |
- |
| 25000 |
Methanol |
- |
| 25000 |
Ethyl acetate |
- |
|
|
- |
- |
- |
|
|
240 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
4.68 X 1007 |
Calculated |
- |
|
|
7.67 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.865 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
5300 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
214nm = 74.5, 275nm = 5.44 |
|
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1.6 |
|
Non-persistent |
|
|
1.64 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
21.4 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
EFSA 2024 dossier: Lab studies DT₅₀ (normalised) range 1.06-2.3 days, Dt90 (measured) range 4.63-49.5 days, Soil=4 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Coturnix coturnix japonica |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.037 |
Eisenia foetida |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 100 |
Apis mellifera |
Low |
|
|
> 109.4 |
Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.858 |
Aphidius rhopalosiphi |
Moderate |
|
|
> 0.858 |
Typhlodromus pyri |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 0.292 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.192 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.0155 |
Raphidocelis subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
200 |
Worst case of acute and chronic mammals |
|
|
200 |
Worst case of acute and chronic birds |
|
|
0.0074 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
2 |
Worst case of contact and oral honeybees |
|
|
0.429 |
Worst case of parasitic wasps and predatory mites |
|
|
0.00292 |
Worst case of temperate acute and chronic fish |
|
|
0.00192 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.00155 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
> 5.45 |
Rat 4 hr (nose only) |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.0 |
Rat SF=100 |
- |
|
|
10-50 |
concentration dependent |
- |
|
|
- |
- |
- |
|
|
|
Negligible risk for proposed uses |
|
|
Negligible risk for proposed uses |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
XNo, known not to cause a problem |
No data found |
  |
|
|
|
Harmful if inhaled |
|
|
|
|
|
Not explosive or oxidising |
|
|
Environment: H400, H410 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
8-methyl-2-decanol propionate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
04/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.