Trimethylamine hydrochloride |
Last updated: 15/06/2024
|
|
(Also known as: TMA HCl; trimethylamine monohydrochloride; trimethylammonium chloride; methanamine) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
Use for the control of Mediterranean fruit fly on fruit crops |
|
Medierranean fruit fly |
|
Citrus groves; Orchard fruits |
|
- |
|
- |
|
Current |
|
- |
|
- |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Bulgaria/Spain |
|
Not applicable |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
  |
✓ |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
- |
|
C₃H₉HCl |
|
CN(C)C.Cl |
|
No data |
|
SZYJELPVAFJOGJ-UHFFFAOYSA-N |
|
InChI=1S/C3H9N.ClH/c1-4(2)3;/h1-3H3;1H |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
trimethylamine hydrochloride |
- |
|
|
Semiochemical |
|
Animal-derived substance; Plant-derived substance |
|
- |
|
- |
|
Natural |
|
- |
|
Naturally occuring substance that is produced during the decay of organic matter including plants, animals and animal waste |
|
Manufactured for commercial use via the alkylation of anhydrous ammonia with methanol |
|
Crop protection |
|
Medierranean fruit fly |
|
Citrus groves; Orchard fruits |
|
- |
|
593-81-7 |
|
209-810-0 |
|
- |
|
- |
|
- |
|
95.57 |
|
- |
|
trimethylamine hydrochloride |
|
N,N-dimethylamethanamine hydrochloride |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
White crystalline powder |
|
|
|
|
BioLure Med Fly |
BioLure |
Trimethylamine hydrochloride 98% |
Acros Organics BVBA |
Cera Free |
Russell IPM Ltd |
|
Usually formulated as a vapour releasing product placed in traps |
|
|
|
|
|
1000000 |
|
High |
|
Insoluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ether |
- |
|
279 |
|
- |
|
- |
- |
- |
|
283 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
|
1.86 X 10-03 |
Calculated |
- |
|
-2.73 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
Known soil and groundwater metabolites |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 500 |
Leuciscus idus |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
259 |
Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
90 |
Scenedesmus subspicatus |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Intravenous LD₅₀ = 325 mg kg⁻¹ |
Mouse |
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
May cause serious damage to eyes May cause irritation of the digestive tract |
|
|
|
No information available |
|
- |
|
Not listed (Not listed) |
|
Not regulated |
|
- |
|
- |
|
|
|
trimethylamine hydrochloride |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
15/06/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |