| S-abscisic acid |

Last updated: 28/02/2026
|
 |
(Also known as: VBC-30151; abscisin II; ABA; (+)-abscisic acid; S-ABA) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
A substance used as a growth promoter to, for example, control greenhouse tomato seedlings and improve the colour development of grape. |
|
|
Growth |
|
|
Various fruits; Greenhouse tomatoes; Grapes |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Withdrawn |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Netherlands |
|
|
15/09/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
  |
  |
  |
  |
  |
✓ |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
  |
  |
  |
  |
  |
✓ |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
✓ |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Abscisic acid is isomeric, existing as the cis- and trans forms. The cis-isomer (S-abscisic) demonstrates a greater biologically activity. |
|
|
C₁₅H₂₀O₄ |
|
|
CC1=CC(=O)CC(C1(C=CC(=CC(=O)O)C)O)(C)C |
|
|
CC1=CC(=O)CC([C@]1(/C=C/C(=C\C(=O)O)/C)O)(C)C |
|
|
JLIDBLDQVAYHNE-YKALOCIXSA-N |
|
|
InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m1/s1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| S-abscisic acid |
Isomer |
 |
|
|
Plant Growth Regulator |
|
|
Plant hormone; Plant-derived substance |
|
|
960 g kg⁻¹ |
|
|
EU dossier - none declared |
|
|
Natural |
|
|
Thought to inhibit the guard cells uptake of potassium ions and has the ability to close down certain parts of plant metobolism. |
|
|
Natural compound found in plants with biosynthesis occurring mainly within leaves and produced in response to environmental stress |
|
|
Used as a plant growth regulator |
|
|
- |
|
|
Various fruits; Greenhouse tomatoes; Grapes |
|
|
- |
|
|
21293-29-8 |
|
|
- |
|
|
- |
|
|
272000 |
|
|
- |
|
|
264.3 |
|
|
- |
|
|
(2Z,4E)-5-((1S)-hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-2,4-pentadienoic acid |
|
|
(S)-5-(1-hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohene-1-yl)-3-methyl-(2Z,4E)=pentadienoic acid |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White to yellow powdery solid |
|
|
|
|
|
Current |
|
|
1963, first discovered; 2010, first registered USA |
|
|
- Valent Biosciences
- Sumitomo Chemical Co.
- BOC Sciences
|
|
|
|
|
|
Usually provided as a soluble liquid concentrate formulation. |
|
|
S-abscisic acid is produced commercially through biotechnological processes. The primary method involves using microorganisms, such as certain fungi, that naturally produce the acid. These microorganisms are cultured in bioreactors under controlled conditions to maximise production. After fermentation, S-abscisic acid is extracted from the culture medium. This involves separating the microbial biomass from the liquid medium and purifying the S-abscisic acid using techniques like solvent extraction and chromatography. The purified acid is then formulated into commercial products. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
3192 |
|
High |
|
|
506800 |
Methanol |
- |
| 290200 |
Acetone |
- |
| 92200 |
Ethyl acetate |
- |
| 265 |
Xylene |
- |
|
|
154.5 |
|
- |
|
|
Decomposes before boiling |
|
- |
|
|
154.5 |
|
- |
|
|
- |
- |
- |
|
|
|
6.31 X 1001 |
Calculated |
- |
|
|
1.8 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
4.61 |
|
- |
| - |
|
|
0.002 |
at 25 °C |
Low volatility |
|
|
1.7 X 10-07 |
|
Non-volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Max @ 253nm = 20800 |
|
- |
|
|
57.5 |
|
- |
|
|
|
|
|
|
|
- |
|
|
|
1.1 |
|
Non-persistent |
|
|
1.1 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
3.7 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
EU dossier lab studies DT₅₀ range 0.66-2.1 days, DT₉₀ range 1.5-7.4 days, soils =4 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
|
Stable |
|
|
EU dossier DT₅₀ = pH4=792 days at 25 °C |
|
|
- |
- |
- |
|
|
3.3 |
|
Moderately fast |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
0.884 |
|
Mobile |
|
|
27.6 |
|
|
1.04 |
|
|
EU dossier Kf range 0.04-3.31 mL g⁻¹, Kfoc range 2.69-77.0 mL g⁻¹, 1/n range 0.56-1.38, soils=5 |
|
|
No |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2250 |
Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 800 |
10 plant species tested |
- |
|
|
6174 |
10 plant species tested |
- |
|
|
|
> 100 |
Apis mellifera |
Low |
|
|
> 108.28 |
Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Aphidius rhopalosphi |
Low |
|
|
> 1000 |
Typhlodromus pyri |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 121 |
Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 116 |
Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.20 |
Lemna gibba |
Moderate |
|
|
- |
- |
- |
|
|
> 95.3 |
Raphidocelis subcapitata |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
500 |
Worst case of acute and chronic mammals |
|
|
225 |
Worst case of acute and chronic birds |
|
|
200 |
Worst case of acute and chronic earthworms |
|
|
160 |
Worst case of non-target plants vegetative vigour and seedling emergence |
|
|
2 |
Worst case of contact and oral honeybees |
|
|
500 |
Worst case of parasitic wasps and predatory mites |
|
|
1.21 |
Worst case of temperate acute and chronic fish |
|
|
1.16 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.02 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 500 |
Rat |
- |
|
|
> 5.13 |
Rat 4 hr (nose only) |
- |
|
|
- |
- |
- |
|
|
13.6 |
Rat SF=100 |
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
6.8 |
Rat SF=100 |
- |
|
|
25-50 |
Concentration dependent |
- |
|
|
- |
- |
- |
|
|
|
Negligible risk considering proposed use |
|
|
Negligible risk considering proposed use |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
May be harmful by ingestion, inhalation or via skin absorption |
|
|
|
|
|
Not explosive; May emit toxic fumes on combustion Not compatible with strong oxiding agents Not expected to auto-ignite; Not highly flammable |
|
|
Health: H315, H319, H335 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
Limited shelf-life. |
|
|
|
|
|
S-abscisic acid |
|
|
Acide abscisique |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
S-abscisinsyre |
| Record last updated: |
28/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.