| Methyleugenol (Ref: Ent 21040) |

Last updated: 28/02/2026
|
 |
(Also known as: methyl eugenol; Eugenol methyl ether; a-allylveratrole; 4-allylveratrole ; NSC 209528; O-methyleugenol) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
|
|
|
Chemical transformation product also used as an insect parapheromone used in traps to attract certain species such as the oriental fruit fly |
|
|
Oriental fruit fly (Bactrocera dorsali) |
|
|
Fruit |
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not approved |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Methyleugenol primarily exhibits geometrical (cis-trans) isomerism due to the presence of a double bond in its allyl side chain. This unsaturation allows for two spatial arrangements: the cis (Z) and trans (E) forms, which differ in the relative positioning of substituents around the double bond. |
|
|
C₁₁H₁₄O₂ |
|
|
COC1=C(C=C(C=C1)CC=C)OC |
|
|
- |
|
|
ZYEMGPIYFIJGTP-UHFFFAOYSA-N |
|
|
InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4,6-8H,1,5H2,2-3H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| Eugenol |
Parent |
 |
|
|
Metabolite; Insecticide |
|
|
Soil |
|
|
Plant-derived substance |
|
|
>98% |
|
|
<1% Eugenol |
|
|
Natural |
|
|
Not applicable |
|
|
- |
|
|
Methyleugenol is a natural plant constituent and a component of several essential oils |
|
|
Crop protection |
|
|
- |
|
|
93-15-2 |
|
|
202-223-0 |
|
|
- |
|
|
- |
|
|
- |
|
|
178.23 |
|
|
- |
|
|
1,2-dimethoxy-4-prop-2-en-1-ylbenzene |
|
|
1,2-dimethoxy-4-(2-propenyl)benzene |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
Yes [ R02 Rule 2: Pesticide active ingredients that meet the criteria of carcinogenicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H350) ] |
|
|
FLAVIS=02.091; CoE 185 |
|
|
Not applicable |
|
|
Not applicable |
|
|
UNE |
|
|
Not applicable |
|
|
- |
|
|
Colourless to pale yellow liquid |
|
|
|
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
Methyleugenol is commercially produced through the chemical methylation of eugenol, a naturally occurring phenolic compound found in essential oils like clove, nutmeg, and basil. The process typically involves reacting eugenol with a methylating agent such as dimethyl sulphate or methyl iodide in the presence of a base, often under controlled temperature and pressure to ensure selectivity and yield. This transformation converts the hydroxyl group of eugenol into a methoxy group, resulting in methyleugenol. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
500 |
D4 D = Agricultural Research Information System (ARIS) Database. Dataset is no longer available. 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
-2 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
- |
|
|
146 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.82 X 1003 |
Calculated |
- |
|
|
3.45 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.0396 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
0.25 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
0.25 |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Shown to rapidly dissipate in soil, 98% lost within 96hrs |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 1179 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
242.25 |
D4 D = Agricultural Research Information System (ARIS) Database. Dataset is no longer available. 4 = Verified data Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 100 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
8.5 |
D4 D = Agricultural Research Information System (ARIS) Database. Dataset is no longer available. 4 = Verified data Lepomis macrochirus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
38 |
D4 D = Agricultural Research Information System (ARIS) Database. Dataset is no longer available. 4 = Verified data Daphnia magna |
Moderate |
|
|
1.1 |
D4 D = Agricultural Research Information System (ARIS) Database. Dataset is no longer available. 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
22.0 |
D4 D = Agricultural Research Information System (ARIS) Database. Dataset is no longer available. 4 = Verified data Raphidocelis subcapitata |
Low |
|
|
4.6 |
D4 D = Agricultural Research Information System (ARIS) Database. Dataset is no longer available. 4 = Verified data Raphidocelis subcapitata |
Low |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
117.9 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
48.45 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
2 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.085 |
Worst case of temperate acute and chronic fish |
|
|
0.11 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.46 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 1179 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
Possible liver toxicant IARC Group 2A - anticipated to be a human carcinogen; US NTP - listed as carcinogen; CLP data - suspected of causing cancer; OSHA - Anticipated human carcinogen |
|
|
|
|
|
No information available |
|
|
Health: H302, H351 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
methyleugenol |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
28/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.