| Nornicotine |

Last updated: 09/11/2025
|
 |
(Also known as: dimethylnicotine) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
|
|
|
Plant alkaloid related to nicotine (metabolite) that can be used to control various soft-bodied insect pests |
|
|
Aphids including Green peach aphid; Thrips; Mealy bugs |
|
|
Beans; Spinach; Turnips; Top fruit; Vegetables; Grapes; Protected ornamentals |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Nornicotine exhibits both structural and stereoisomerism, with its most notable feature being chirality: it exists as two enantiomers: (S)-nornicotine and (R)-nornicotine. In nature, (S)-nornicotine is more prevalent, especially in tobacco plants, but synthetic processes often yield racemic mixtures. Beyond chirality, nornicotine also displays conformational isomerism, meaning it can adopt multiple spatial arrangements due to rotation around single bonds. |
|
|
C₉H₁₂N₂ |
|
|
C1CC(NC1)C2=CN=CC=C2 |
|
|
C1C[C@H](NC1)C2=CN=CC=C2 |
|
|
MYKUKUCHPMASKF-VIFPVBQESA-N |
|
|
InChI=1S/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/t9-/m0/s1 |
|
|
Yes |
|
|
Insecticide; Metabolite |
|
|
Soil |
|
|
Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Broad-spectrum and fast acting. Mainly respiratory action but some contact and stomach activity |
|
|
- |
|
|
Isolated from tobacco plants (Nicotiana tabacum) and from other plants including those belonging to the Lycopodiaceae, Grassulaceae & Leguminosae families |
|
|
Crop protection |
|
|
- |
|
|
494-97-3 |
|
|
621-530-4 |
|
|
None allocated |
|
|
- |
|
|
412 |
|
|
No data found |
|
|
148.20 |
|
|
3-[(2S)-pyrrolidin-2-yl]pyridine |
|
|
3-[(2S)-pyrrolidin-2-yl]pyridine |
|
|
3-(2S)-2-pyrrolidinylpyridine |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
Yes [ C1 Criterion 1: Pesticide active ingredients that meet the criteria of classes Ia or Ib of the WHO Recommended Classification of Pesticides by Hazard ] |
|
|
Yes [ R01 Rule 1: Pesticide active ingredients that meet the criteria of classes Ia or Ib of the WHO Recommended Classification of Pesticides by Hazard (or those with a CLP classification of H330) ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
4B |
|
|
Not applicable |
|
|
- |
|
|
Yellow coloured viscous liquid with amine type odour |
|
|
|
|
|
Current |
|
|
Early 20th century, first isolated & characterised; Circa 1910, first uses in crop protection; 2009, phased out EU |
|
|
|
|
|
- |
|
|
- |
|
|
Commercial production of nornicotine, particularly the high-purity (S)-enantiomer, has evolved from traditional tobacco extraction to sophisticated synthetic and chemoenzymatic methods. One advanced approach begins with myosmine, a compound derived from nicotinic acid, which is then converted into (S)-nornicotine using highly selective biocatalysts such as imine reductases. Enzyme-driven processes that enable efficient, scalable production while minimizing impurities like tobacco-specific nitrosamines have been developed. Another method involves converting racemic (R,S)-nornicotine into high-purity (S)-nornicotine through a combination of immobilized enzymes and reducing agents |
|
|
- |
|
|
|
|
|
|
|
|
|
|
50 |
|
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
270 |
|
- |
|
|
- |
- |
- |
|
|
213.8 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
|
1.48 X 1000 |
Calculated |
- |
|
|
0.17 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.074 |
|
- |
|
|
5.25 |
|
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Does not absort at wavelengths >290nm |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
4.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Mustard leaves, n=1 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately mobile |
|
|
250 |
|
|
Literature estimates of Koc range 14-500 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 21.7 |
Mouse |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 10 |
Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
2.17 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
1 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 21.7 |
Mouse |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Intravenous LD₅₀ = 3.41 mg kg⁻¹ |
Mouse |
- |
| Intraperitoneal LD₅₀ = 14.66 mg kg⁻¹ |
Mouse |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Very toxic by inhalation and ingestion - may be fatal Nicotinic exposure may cause various adverse health effects A precursor to the carcinogen N -nitrosonornicotine |
|
|
|
|
|
Hygroscopic |
|
|
Health: H302, H312, H315, H319, H332, H335 |
|
|
Not listed - determined as Ia (Extremely hazardous / Not listed) |
|
|
- |
|
|
Packaging Group III (minor danger) |
|
|
Chemically stable under standard ambient conditions in the absence of moisture |
|
|
|
|
|
nornicotine |
|
|
nornicotine |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
09/11/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.