| Sanguinarine |

Last updated: 16/09/2025
|
 |
(Also known as: Macleaya extract) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
  |
|
  |
|
|
A naturally occuring escharotic quarternary ammonium substance with acaricidal, fungicidal and insecticidal activity, usually used as the chloride salt |
|
|
Powdery mildew; Texas root rot (Phymatotrichopsis omnivora); Blight; Honey fungus; Enteric infections such as E. coli and Clostridium perfringens |
|
|
Ornamentals including roses; Cotton; Swine; Poultry; Ruminants |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₂₀H₁₄NO₄ |
|
|
C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
|
|
No data |
|
|
INVGWHRKADIJHF-UHFFFAOYSA-N |
|
|
InChI=1S/C20H14NO4/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21/h2-8H,9-10H2,1H3/q+1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| sanguinarine |
- |
 |
|
|
Insecticide; Acaricide; Fungicide; Other substance; Veterinary substance |
|
|
Antimicrobial |
|
|
Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Induces the release of membrane-bound cell wall autolytic enzymes, which eventually result in lysis of the cell |
|
|
A substance extracted from a range of plants including bloodroot (Sanguinaria canadensis), pink plume poppy (Macleaya cordata,/i>) and the Mexican prickly poppy (Argemone mexicana) |
|
|
Crop protection |
|
|
Powdery mildew; Texas root rot (Phymatotrichopsis omnivora); Blight; Honey fungus |
|
|
Ornamentals including roses; Cotton |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
2447-54-3 |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
332.36 |
|
|
13-methyl(1,3)benzodioxolo(5,6-c)-1,3-dioxolo(4,5-i)phenanthridin-13-ium |
|
|
13-methyl(1,3)benzodioxolo(5,6-c)-1,3-dioxolo(4,5-i)phenanthridin-13-ium |
|
|
13-methyl(1,3)benzodioxolo(5,6-c)-1,3-dioxolo(4,5-i)phenanthridinium |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not known |
|
|
None identified |
|
|
Orange-red coloured crystalline solid |
|
|
|
|
|
Current |
|
|
Ancient use in vet medicine of plant extract; Early 1990s, first isolated; 2013, not approved UK |
|
|
- Indena S.p.A., Italy
- Hunan Meida Biological Resources Co. Ltd., China
- Fuso Chemical Co. Ltd., Japan
|
|
|
|
|
|
Formulations are typically offered as water-soluble powders, premixes or granules |
|
|
The commercial production of sanguinarine typically begins with the extraction from plants such as Macleaya cordata, Sanguinaria canadensis or Chelidonium majus. These plants are cultivated under controlled agricultural conditions, and their aerial parts, especially the roots and stems, are harvested and dried. The dried biomass undergoes solvent extraction, often using ethanol or methanol, followed by purification steps like liquid-liquid partitioning and column chromatography to isolate sanguinarine. Advanced producers may use supercritical fluid extraction or membrane filtration to enhance yield and purity. |
|
|
Data for specific plant extracts is scarce. However, from publicly available data the carbon footprint of these types of products has been estimated at between 1.0 and 4.0 kg CO₂e per kg of product. This depends on the plant oil content, agricultural practices and processing methods used. |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
266 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1660 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1660 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
- |
- |
- |
|
|
2.2 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
|
Subcutaneous LD₅₀ = 125 mg kg⁻¹ |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rabbit |
- |
| Intraperitoneal LD₅₀ = 18 mg kg⁻¹ |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Mainly excreted through hepatic metabolism, followed by renal elimination of its metabolites |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
  |
| No data found |
No data found |
  |
|
|
|
Anti-inflammatory Some evidence to suggest it has anti-cancer properties Toxic if ingested |
|
|
|
|
|
Corrosive |
|
|
- |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
sanguinarine |
|
|
chlorure de sanguinarine |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
16/09/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |