| Dibutyl phthalate |

Last updated: 14/01/2026
|
 |
(Also known as: DMP) |
| Dibutyl phthalate is an obsolete insect repellent. Very little information is available regarding its environmental fate. It is moderately toxic to fish, algae and aquatic invertebrates. Dibutyl phthalate has a low mammalian oral toxicity but may impact on reproduction/fertility. |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
|
|
|
An obsolete unclassified insect repellent with additional industrial applications |
|
|
Mosquitoes; Leeches; Gnats; General control of flies |
|
|
Livestock; Farm buildings |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₁₆H₂₂O₄ |
|
|
CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC |
|
|
- |
|
|
DOIRQSBPFJWKBE-UHFFFAOYSA-N |
|
|
InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
|
|
Yes |
|
|
Insecticide; Repellent; Other substance |
|
|
Plasticiser |
|
|
Unclassified pesticide; Phthalate ester compound |
|
|
- |
|
|
- |
|
|
Semi-synthetic |
|
|
Repellent action, not toxic |
|
|
Found to be naturally produced as a secondary metabolite by certain microorganisms, such as the soil bacteria Streptomyces albidoflavus 321.2 and various filamentous fungi. |
|
|
Animal health |
|
|
Mosquitoes; Leeches; Gnats; General control of flies |
|
|
Livestock; Farm buildings |
|
|
- |
|
|
84-74-2 |
|
|
201-557-4 |
|
|
None allocated |
|
|
028001 |
|
|
3026 |
|
|
607-318-00-4 |
|
|
278.34 |
|
|
dibutyl benzene-1,2-dicarboxylate |
|
|
dibutyl phthalate |
|
|
1,2-dibutyl 1,2-benzenedicarboxylate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
UK Environment Agency non-statutory standard for the protection of freshwater and saltwater aquatic life: 8 µg l⁻¹ as annual average; 40 µg l⁻¹ as max acceptable conc. |
|
|
- |
|
|
|
Yes [ C4 Criterion 4: Pesticide active ingredients that meet the criteria of reproductive toxicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H360) ] |
|
|
Yes [ R04 Rule 4: Pesticide active ingredients that meet the criteria of reproductive toxicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H360) ; R05 Rule 5: Pesticide active ingredients that are confirmed endocrine disruptors according to the World Health Organization (WHO) definition of an endocrine disruptor ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
- |
|
|
Liquid |
|
|
|
|
|
Considered obsolete but may be available in some countries |
|
|
Circa 1930, first synthesised |
|
|
|
|
|
- Celluflex DPB
- Ergoplast FDB
- Genoplast B
- Kodaflex DBP
- Hatcol DBP
|
|
|
Often formulated as ready-to-use sprays |
|
|
Commercial production of dibutyl phthalate is a straightforward esterification process in which phthalic acid or phthalic anhydride reacts with n butanol in the presence of an acid catalyst. Industry descriptions note that the reaction is typically carried out under heated, water removing conditions to drive ester formation, after which the mixture is neutralised, washed, and vacuum distilled to obtain high purity of dibutyl phthalate. |
|
|
- |
|
|
|
|
|
|
|
11.2 |
|
Moderate |
|
|
- |
- |
- |
|
|
-35 |
|
- |
|
|
340 |
|
- |
|
|
- |
- |
- |
|
|
157 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source (closed cup) |
- |
|
|
|
3.16 X 1004 |
Calculated |
- |
|
|
4.5 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
7499 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
0.6 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Cyprinodon variegatus marine species |
Moderate |
|
|
- |
- |
- |
|
|
2.2 |
Danio rerio |
Moderate |
|
|
17.0 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.75 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Raphidocelis subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
7499 |
Rat |
Low |
|
|
6000 |
Rat |
- |
|
|
4.25 |
Rat |
- |
|
|
Intraperitoneal LD₅₀ = 3.05 mL kg⁻¹ |
Rabbit |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
If inhaled may irritate & cause headache, dizziness, & nausea |
|
|
|
|
|
Not compabible with strong oxidising agents, acids or alkalies May explode in contact with chlorine / bleach |
|
|
Health: H360 Environment: H400 |
|
|
Not classified: Obsolete (Not classified: Obsolete) |
|
|
Not regulated |
|
|
- |
|
|
- |
|
|
|
|
|
dibutyl phthalate |
|
|
phtalate de dibutyle |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
14/01/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |