| Vinegar |

Last updated: 04/03/2026
|
 |
(Also known as: Acetic acid) |
| Vinegar is a dilute form of ethanoic acid (acetic acid). It is used in food for flavoring but also has multiple applications as a pesticide. |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
Vinegar contains up to 10% acetic acid in water and has multiple pesticide applications |
|
|
Pathogen transference via tools & equipment; General weeds in non-agricultural areas; Fungal infections including Commo bunt, Barley leaf stripe, Alternaria, Fire blight, canker |
|
|
Cereal seeds; Market vegetable; Ornamentals; Non-cropped areas such as paths, terraces, borders |
|
|
- |
|
|
- |
|
|
- |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
- |
|
|
Open ended |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₂H₄O₂ |
|
|
CC(=O)O |
|
|
- |
|
|
QTBSBXVTEAMEQO-UHFFFAOYSA-N |
|
|
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
|
|
Yes |
|
|
Fungicide; Herbicide; Other substance |
|
|
Disinfectant; Bactericide |
|
|
Unclassified pesticide |
|
|
Food grade containing <=10% acetic acid |
|
|
- |
|
|
Synthetic |
|
|
When applied to weeds, vinegar (acetic acid) disrupts cell membranes, causing rapid desiccation and death of plant tissue. Contact action. |
|
|
The natural source of acetic acid is primarily vinegar, which is produced through the fermentation of sugars and starches by yeast and acetic acid bacteria. |
|
|
Non-food applications incuding cleaning tools and equipment Utility weed management |
|
|
Weeds; Bacteria |
|
|
Cereal seeds; Market vegetable; Ornamentals; Non-cropped areas such as paths, terraces, borders |
|
|
- |
|
|
90132-02-8 |
|
|
64-19-7 |
|
|
290-419-7 |
|
|
- |
|
|
044001 |
|
|
176 |
|
|
No data found |
|
|
60.05 |
|
|
ethanoic acid |
|
|
ethanoic acid |
|
|
ethanoic acid |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
EU dossier none declared- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
EU Basic substance under Article 28 of Regulation (EC) No 1107/2009); UK Basic commodity substance implemented under the UK's Plant Protection Products Regulations 2011 |
|
|
None allocated |
|
|
None allocated |
|
|
Not applicable |
|
|
Not applicable |
|
|
None |
|
|
Colourless lqiuid with sharp odour |
|
|
|
|
|
|
|
|
Current |
|
|
1990s, informal use recorded |
|
|
- Bayer CropScience
- Nature’s Avenger Organics
- Green Gobbler
|
|
|
- 20% Vinegar Weed & Grass Killer
- Avenger Weed Killer
|
|
|
Available in a variety of formulations including ready-to-use products and liquid concentrates |
|
|
Acetic acid is produced commercially through several methods. The most common method for the production of vinegar involves the oxidation of ethanol using bacteria such as Acetobacter or Gluconobacter . |
|
|
GHG emissions for the production of food-grade, flavoured vinegar are high at 4.44 kg CO₂e per kg vinegar produced. However, vinegar used as a pesticide is likely to be much lower. Nicholson et al. (2023) report that the manufacturing and transport of 1 kg of acetic acid produces 1.1 kg of CO₂e. |
|
|
|
|
|
|
|
|
|
|
100000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
>200000 |
Toluene |
- |
| >200000 |
Isopropanol |
- |
| >200000 |
Ethyl acetate |
- |
| >200000 |
Acetone |
- |
|
|
16.7 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
118.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.70 X 1001 |
Calculated |
- |
|
|
1.23 X 1000 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.96 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1.2 |
as acetic acid |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
3350 |
Rat as acetic acid |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
45.0 |
Oncorhynchus mykiss as acetic acid |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
31.5 |
Daphnia magna as acetic acid |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
20.0 |
Lemna gibba as acetic acid |
Low |
|
|
- |
- |
- |
|
|
8.1 |
Raphidocelis subcapitata as acetic acid |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
335 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.45 |
Worst case of temperate acute and chronic fish |
|
|
0.315 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.81 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
3350 |
Rat as acetic acid |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1060 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Rabbit as acetic acid |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Minimal risks |
|
|
Minimal risks |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
XNo, known not to cause a problem |
  |
|
|
|
Vinegar contains acetic acid and so has a corrosive nature |
|
|
|
|
|
Corrosive Emits irritating fumes when heated to decompositio Flammable IMDGTransport Hazard Class 8 |
|
|
Not classified as hazardous |
|
|
Not listed (Not listed) |
|
|
UN2790 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
vinegar |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
04/03/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.