| Potassium gibberellate |

Last updated: 08/02/2026
|
 |
(Also known as: gibberellic acid; monopotassium salt) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
  |
|
  |
|
|
|
|
|
A natural plant growth regulator with a variety of uses including improving fruit set, increasing berry size and controlling fruit maturity |
|
|
Growth; Stress |
|
|
Seedless grapes Vegetables; Cereals |
|
|
As gibberellic acid, it has been proven as a biostimulant by both extensive lab and field studies over the last century. In a study with rice, gibberellic acid treatment was shown to significantly increased plant height, earlier flowering, and higher seed yield. Application to grapevines has been found to enhance berry size and improve cluster compactness. This leads to higher market value and better quality produce. Gibberellic acid treatment to wheat has been shown to increase stem elongation, leading to taller plants with more biomass. With tomatoes, gibberellic acid has been shown to promote early flowering and fruit set, leading to an extended harvest period and increased total yield. |
|
|
- |
|
|
- |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Slovenia/Slovakia |
|
|
31/10/2026 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
  |
✓ |
✓ |
✓ |
✓ |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
  |
✓ |
  |
✓ |
  |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
✓ |
✓ |
✓ |
✓ |
  |
✓ |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
The parent acid is a complex molecule with 8 chiral centres |
|
|
C₁₉H₂₁KO₆ |
|
|
CC12C(C=CC3(C1C(C45C3CCC(C4)(C(=C)C5)O)C(=O)[O-])OC2=O)O.[K+] |
|
|
C[C@@]12[C@H](C=C[C@@]3([C@@H]1[C@@H]([C@]45[C@H]3CC[C@](C4)(C(=C)C5)O)C(=O)[O-])OC2=O)O.[K+] |
|
|
BGJIAUDTIACQSC-GLDAWBHVSA-M |
|
|
InChI=1S/C19H22O6.K/c1-9-7-17-8-18(9,24)5-3-10(17)19-6-4-11(20)16(2,15(23)25-19)13(19)12(17)14(21)22;/h4,6,10-13,20,24H,1,3,5,7-8H2,2H3,(H,21,22);/q;+1/p-1/t10-,11+,12-,13-,16-,17+,18+,19-;/m1./s1 |
|
|
Yes |
|
|
Plant Growth Regulator; Other substance |
|
|
Biostimulant - growth enhancement |
|
|
Micro-organism derived substance; Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
The substance has various physiological and morphological effects on plants. It promotes stem elongation by stimulating both cell division and elongation. It activates genes that produce enzymes responsible for cell wall loosening, allowing cells to expand. It also helps plants cope with various abiotic stresses, such as salinity and drought, by modulating physiological and biochemical processes |
|
|
Gibberellic acid is naturally found in various sources including fungi, many plants (e.g. cereal grains like rice, corn, wheat, and barley) amd some bacteria. It is also found in the developing seeds of peaches, onion bulbs, spinach, and ferns. The primary commercial source of gibberellic acid is the fungus Gibberella fujikuroi |
|
|
Growth; Stress |
|
|
- |
|
|
125-67-7 |
|
|
204-749-6 |
|
|
- |
|
|
- |
|
|
71299661 |
|
|
384.50 |
|
|
potassium;(1R,2R,5S,8S,9S,10R,11S,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate |
|
|
potassium;(1R,2R,5S,8S,9S,10R,11S,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylate |
|
|
potassium (1S,2S,4aR,4bR,7S,9aS,10S,10aR)-1,2,4b,5,6,7,8,9,10,10a-decahydro-2,7-dihydroxy-1-methyl-8-methylene-13-oxo-4a,1-(epoxymethano)-7,9a-methanobenz[a]azulene-10-carboxylate (1:1) |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White crystalline solid |
|
|
|
|
|
|
|
|
Current |
|
|
1962, parent acid was discovered in Japan; Circa 1935 parent acid introduced |
|
|
- ICI Plant Protection
- Abbott
- Nihon Nohyaku
- Valent BioSciences
|
|
|
- |
|
|
- |
|
|
Often formulated as a liquid for hand-held spray equipment, as a seed treatment and as a hydroponic nutrient enhancer |
|
|
The most common method of commercial production is using a process called Submerged Fermentation. The fungus is cultivated in a liquid nutrient medium where it produces gibberellic acid. Key factors like pH, temperature, and nutrient concentration are carefully controlled to optimize production. Solid-State Fermentation is an alternative method where the fungus is grown on solid materials like agricultural residues. After fermentation, the gibberellic acid is extracted and purified. The purified gibberellic acid is converted into its potassium salt form, resulting in potassium gibberellate. |
|
|
As microbial-based products tend to use fermentation-based production processes rather than chemical synthesis, they typically have a lower fossil fuel input in formulation and active ingredient creation, and also have reduced downstream emissions due to biodegradability and minimal soil disruption, their life-cycle GHG emissions are expected to be low. Whilst hard and precise data is not available, broad estimates suggest that typically emissions are likely to be below 5 kg CO₂e/kg. |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
Not readily biodegradable |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 6300 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
630 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 6300 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
May cause severe injury or burns following skin contact |
|
|
|
|
|
Corrosive Not expected to auto-ignite; Not highly flammable IMDG Transport Hazard Class 5.2 |
|
|
Health: H319 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
potassium gibberellate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
08/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Tzilivakis, J., Lewis, K.A., Green, A. and Warner, D.J. (2026) A decade of growth and impact of the Pesticide Properties Database (PPDB). Human and Ecological Risk Assessment: An International Journal, 1–26. DOI: 10.1080/10807039.2026.2702066
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242
|
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database Conditions of use.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.