| 1-methylnaphthalene |

Last updated: 17/08/2026
|
 |
(Also known as: moth balls; methylnaphthalene; alpha methylnaphthalene) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
  |
|
|
|
|
A largely obsolete insecticide once used as a moth repellant for the protection of textiles and as an animal repellant against nuisance vertebrate pests. It is also a constituent of some inert product additives. |
|
|
Moths |
|
|
Non-cropped situations; Wool clothing and textiles |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
1-methylnaphthalene exhibits positional isomerism within the naphthalene framework. Naphthalene consists of two fused benzene rings, and when a methyl group is substituted onto this structure, it can occupy different positions, giving rise to isomers. In the case of 1-methylnaphthalene, the methyl group is attached to the first carbon atom of the naphthalene ring system. Its positional isomer is 2-methylnaphthalene, where the methyl group is bonded to the second carbon atom. |
|
|
C₁₁H₁₀ |
|
|
CC1=CC=CC2=CC=CC=C12 |
|
|
- |
|
|
QPUYECUOLPXSFR-UHFFFAOYSA-N |
|
|
InChI=1S/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| naphthalene |
Parent |
 |
|
|
Semiochemical; Other substance |
|
|
Adjuvant; Solvent; Penetration enhancer |
|
|
Plant-derived substance; Substituted naphthalene |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Repellent action caused by strong odour, DNA damage response |
|
|
A natural substance that occurs naturally in fossil fuels such as petroleum and coal. It is also found in some plants including black walnut(Juglans nigra), Japanese star swertia (Swertia japonica) and cotton (Gossypium hirsutum) |
|
|
Deterrent of damaging moths |
|
|
- |
|
|
90-12-0 |
|
|
1321-94-4; 78900-94-4 |
|
|
201-966-8 |
|
|
- |
|
|
- |
|
|
7002 |
|
|
142.20 |
|
|
1-methyl naphthalene |
|
|
1-methyl naphthalene |
|
|
1-methyl naphthalene |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
EU Directive 2008/105/EC EQS Inland surface waters: 2.4 ug naphthalene/L; other surface waters 1.2 ug naphthalene/L as annual average |
|
|
- |
|
|
|
- |
|
|
Yes [ R02 Rule 2: Pesticide active ingredients that meet the criteria of carcinogenicity Categories 1A and 1B of the Globally Harmonized System on Classification and Labelling of Chemicals (GHS) (those with a CLP classification of H350) ] |
|
|
FEMA=3193; FLAVIS=1.014 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
A bluish-brown oil or a clear yellow liquid with distinctive odour |
|
|
|
|
|
|
|
|
Considered obsolete but may be available in some countries |
|
|
1948, parent substance, naphthalene, first registered as a pestcide USA; 2008, prohibited EU |
|
|
- |
|
|
- |
|
|
Was usually supplied as pellets, granules or flakes and applied by hand |
|
|
Commercial production of 1-methylnaphthalene typically relies on fractionation and catalytic upgrading of coal tar distillates. Coal tar contains a mixed naphthalene cut in which 1-methylnaphthalene appears alongside 2-methylnaphthalene and other alkylated aromatics. Producers first isolate the heavy naphthalene fraction by distillation, then enrich the 1-methyl isomer through selective crystallisation, solvent extraction, or catalytic isomer separation. In some operations, methylation of naphthalene over acidic catalysts (e.g., zeolites) is used to adjust isomer ratios, but this is generally a secondary step rather than the primary source. The final product is purified by repeated distillation to meet specification for downstream uses. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
-22 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
240 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
200 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Exposure may occur via inhalation, skin absorption, ingestion, skin and/or eye contact |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Blood toxicant at high doses Liver toxicant May cause hemolytic anemia IARC Group 2B carcinogen; CLP data - suspected carcinogen |
|
|
|
|
|
No information available |
|
|
Health: H302, H351 Environment: H400, H410 |
|
|
Not classified: Obsolete |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
1-methylnaphthalene |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
17/08/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Tzilivakis, J., Lewis, K.A., Green, A. and Warner, D.J. (2026) A decade of growth and impact of the Pesticide Properties Database (PPDB). Human and Ecological Risk Assessment: An International Journal, 1–26. DOI: 10.1080/10807039.2026.2702066
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242
|
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database Conditions of use.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.