| Tartaric acid |

Last updated: 25/08/2025
|
 |
(Also known as: threaric acid; racemic acid) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
A naturally occurring substance that has biocidal activity and often used in cleaning and disinfectant products. Tartaric acid is also used as a food additive and has numerous industrial and pharmaceutical applications. |
|
|
Micro-organisms |
|
|
Cleaning and disinfecting; Stabiliser in wine industry |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Racemic. The naturally occurring form of tartaric acid is dextro tartaric acid or L-(+)-tartaric acid |
|
|
C₄H₆O₆ |
|
|
[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
|
|
- |
|
|
FEWJPZIEWOKRBE-JCYAYHJZSA-N |
|
|
InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
|
|
Yes |
|
|
Other substance |
|
|
Biocide; Food additive; Acidity stabiliser |
|
|
Plant-derived substance; Organic acid; Carboxylic acid substance |
|
|
>= 99.5% |
|
|
- |
|
|
Natural |
|
|
Inactivates micro-organisms; Inhibits micriobial growth |
|
|
An organic acid that occurs widely in many fruits including grapes, bananas and avocados. Develops naturally in the process of fermentation. |
|
|
Biocidal |
|
|
Micro-organisms |
|
|
Cleaning and disinfecting; Stabiliser in wine industry |
|
|
Not applicable |
|
|
87-69-4 |
|
|
201-766-0 |
|
|
- |
|
|
- |
|
|
444305 |
|
|
150.09 |
|
|
2,3-dihydroxybutanedioic acid |
|
|
(2R,3R)-2,3-dihydroxybutanedioic acid |
|
|
(+)-tartaric acid |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
E334; FEMA=2966; FLAVIS=08.015; Approved under GB Biocides Products Regulations - Simplified Active Substance; Registered under REACH |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White crystalline powder |
|
|
|
|
|
Current |
|
|
1769, extraction process developed; 1832, chemistry investigated |
|
|
- |
|
|
- |
|
|
- |
|
|
There are two main methods for producing tartaric acid commercially. A natural method involves extracting tartaric acid from the by-products of wine production. During wine fermentation, potassium bitartrate (also known as cream of tartar) precipitates out of the wine. This precipitate is collected and purified to produce tartaric acid. Alternatively, tartaric acid can be synthesised chemically. One common method involves the reaction of maleic anhydride with hydrogen peroxide, which produces a racemic mixture of tartaric acid (DL-tartaric acid). |
|
|
- |
|
|
|
|
|
|
|
|
|
|
1330000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
|
169 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
170 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
210 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
|
1.23 X 10-02 |
Calculated |
- |
|
|
-1.91 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.74 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
2.89 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
| PKa2=4.40 |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
Readily biodegradable |
|
|
|
0.4 |
|
Non-persistent |
|
|
0.4 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
ECHA dossier states degradation rapid. DT₅₀ = 9.6 hrs |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
| carbon dioxide |
- |
Humans |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 100 |
Unknown species |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
93.3 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 100 |
Unknown species |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) used to calculate Total Applied Toxicity (TAT) |
|
|
|
|
|
|
|
0.933 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
10 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for acute and chronic birds |
|
|
1 |
Worst case of temperate acute and chronic fish |
|
|
200 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
> 2000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Potentially toxic to canines May cause serious eye damage |
|
|
|
|
|
Corrosive Combustible Not expected to auto-ignite; Not highly flammable Not oxidising; Not explosive Incompatible with strong oxidisng agents, strong alkalies, fluorine and hydrogen peroxide |
|
|
Health: H318 |
|
|
- |
|
|
Not regulated |
|
|
- |
|
|
The material is stable under normal ambient and anticipated storage and handling conditions of temperature and pressure |
|
|
|
|
|
tartaric acid |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
25/08/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |