| Lactic acid |

Last updated: 15/12/2025
|
 |
(Also known as: L-lactic acid; sarcolactic acid ; L(+)-lactic Acid ) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
A compound that acts as a plant growth regulator, biocide (disinfectant/preservative) and fungicide. It also has some insect repellency. |
|
|
Growth; Vigour; Stress; Varroa destructor mite; Fusarium species; Rhizoctonia solani; Grey mould; Potato scab; Soft rot; Blackleg; Mosquitoes (Aedes albopictus) |
|
|
Apples; Corn; Vegetables including cabbage, cauliflower, broccoli, beans; Potatoes; Sugarcane; Honeybee colonies |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Lactic acid has chiral centers existing as L-lactic acid, D-lactic acid, and a racemic mixture (DL-lactic acid). |
|
|
C₃H₆O₃ |
|
|
CC(C(=O)O)O |
|
|
- |
|
|
JVTAAEKCZFNVCJ-UHFFFAOYSA-N |
|
|
InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| lactic acid |
- |
 |
|
|
Fungicide; Insecticide; Other substance |
|
|
Biocide; Disinfectant; Biostimulant - improved abiotic stress resiliance; growth enhancement & improved nutrient use efficiency |
|
|
Alpha-hydroxy acid; Biostimulant |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Inhibits the growth of microbial pathogens by creating an acidic environment and producing antimicrobial compounds. Attractant for mosquitoes |
|
|
Produced by living organisms (e.g. humans during exercise) as a product of the anaerobic phase of glucose metabolism (glycolysis) plant and animal cells use for energy. Also found in many foods, especially fermented ones like yogurt, cheese, and sauerkraut, as well as fruits and vegetables. |
|
|
Crop protection |
|
|
Growth; Vigour; Stress; Varroa destructor mite; Fusarium species; Rhizoctonia solani; Grey mould; Potato scab; Soft rot; Blackleg; Mosquitoes (Aedes albopictus) |
|
|
Apples; Corn; Vegetables including cabbage, cauliflower, broccoli, beans; Potatoes; Sugarcane; Honeybee colonies |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
50-21-5 |
|
|
209-954-4 |
|
|
- |
|
|
128929 |
|
|
612 |
|
|
90.08 |
|
|
2-hydroxypropanoic acid |
|
|
2-hydroxypropanoic acid |
|
|
propanoic acid, 2-hydroxy-, (S)- |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
FEMA=2611; Approved in the EU as a biocide for hygiene and product preservation |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
A colourless to yellow odourless syrupy liquid. |
|
|
|
|
|
Current |
|
|
1780, first isolated in Sweden; 1988, registered USEPA as PGR; 2009, re-registered USEPA |
|
|
- Cargill
- Galactic
- NatureWorks
- Biological Preparations
|
|
|
- Purac
- Purasolv
- Masomint
- Lactic acid 80%
- NOsquito Stinger 2-in-1 Power Bait
- Lurex
|
|
|
Typically supplied as a liquid concentrate for crop use and as bait in traps for mosquitoes |
|
|
Commercial lactic acid is mainly produced through microbial fermentation of carbohydrates such as corn, sugarcane, or beet sugars, using lactic acid bacteria (e.g., Lactobacillus species). In this process, sugars are converted into lactic acid under controlled conditions, followed by purification steps like filtration, precipitation, and crystallization to remove impurities. Although chemical synthesis from petrochemical precursors (like acetaldehyde) exists, fermentation is preferred because it uses renewable feedstocks, is more sustainable, and yields optically pure lactic acid. |
|
|
- |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
122 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
133 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
|
2.88 X 10-01 |
Calculated |
- |
|
|
-0.54 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
70.7 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
|
|
|
|
|
Biodegradable |
|
|
|
7 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Rapidly broken down through microbial respiration into carbon dioxide and water, often via intermediate organic acids. |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
3543 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
>= 2250 |
Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 100.4 |
Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
130 |
Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
> 257.73 |
Oreochromis mossambicus |
Low |
|
|
> 250 |
Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
3543 |
Rat |
Low |
|
|
> 2000 |
Rat |
- |
|
|
> 5.0 |
Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
No data found |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Low toxicity - normal metabolic product in humans |
|
|
|
|
|
Corrosive If heated vapours may form explosive mixtures with air Not compatible with strong oxidisers and strong alkalis |
|
|
Health: H315, H318 |
|
|
- |
|
|
UN3265 |
|
|
- |
|
|
Substance is stable under normal ambient conditions |
|
|
|
|
|
lactic acid |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
15/12/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |