| D-limonene |

Last updated: 19/10/2025
|
 |
(Also known as: dipentene; d-limonene; alpha-limonene; dipenol; orange oil; citrus extract) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
An insect repellant with a strong citrus smell used alone or in combination with other insecticides mainly used for public health |
|
|
Fleas; Ticks; Mosquito larvae |
|
|
Animals; Humans |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved in this pure form but approved as part of some plant oils |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved in this pure form but approved as part of some plant oils |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
✓ |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
✓ |
  |
  |
  |
  |
✓ |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
✓ |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
d-limonene is one of two optical isomers of limonene, due to a chiral centre at the carbon adjacent to the double bond in its ring structure. This chirality gives rise to enantiomeric isomerism forming d-limonene (R-limonene) and l-limonene (S-limonene). These enantiomers vary in biological activity, with d-limonene more commonly used in pest control |
|
|
C₁₀H₁₆ |
|
|
CC1=CCC(CC1)C(=C)C |
|
|
CC1=CC[C@@H](CC1)C(=C)C |
|
|
XMGQYMWWDOXHJM-JTQLQIEISA-N |
|
|
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3 |
|
|
Yes |
|
|
Insecticide; Repellent; Veterinary substance; Metabolite; Other substance |
|
|
Groundwater; Soil; Surface water |
|
|
Biocide; Slimicide |
|
|
Plant-derived substance; Aliphatic hydrocarbon |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Odourous repellent |
|
|
A compound found in high quantities in citrus fruits especially oranges |
|
|
Public health applications |
|
|
Fleas; Ticks; Mosquito larvae |
|
|
Animals; Humans |
|
|
Not normally used in agriculture production |
|
|
5989-27-5 |
|
|
227-813-5 |
|
|
None allocated |
|
|
- |
|
|
- |
|
|
136.23 |
|
|
- |
|
|
(R)-4-isopropenyl-1-methylcyclohexene |
|
|
(4R)-1-methyl-4-(1-methylethenyl)cyclohexene |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
FEMA=2633; FLAVIS=01.045; Marine pollutant |
|
|
Not applicable |
|
|
Not applicable |
|
|
UNM |
|
|
Not applicable |
|
|
- |
|
|
Colourless to pale yellow liquid with citrus odour |
|
|
|
|
|
|
|
|
Current |
|
|
1958, registered USA |
|
|
- Bma Inc, USA
- Orange Guard Inc
- BASF Speciality Chemicals
|
|
|
- Natural Mosquito and Bug Repellant
- Orange Guard
- MotherEarth ProCitra-DL
|
|
|
Usually suppled as ready-to-use formulations such as sprays and as emulsifiable concentrates, granules and impregnated collars |
|
|
d-Limonene is primarily produced commercially through the extraction from citrus fruit peels, especially oranges. The peels of citrus fruits are subjected to a process called cold pressing or steam distillation to extract the essential oils, which contain d-limonene. The essential oil is then separated from the water and other components, typically using centrifugation or decantation. The crude d-limonene is further purified to remove any impurities. This can involve additional distillation or filtration steps to achieve the desired purity level. Alternatively, a process using supercritical carbon dioxide can be used to extract the essential oil from citrus peel. There is also growing interest in microbial production of d-limonene which involves using genetically engineered microorganisms, such as Escherichia coli or Saccharomyces cerevisiae, to produce d-limonene through fermentation processes. |
|
|
According to a published LCA the production of d-limonene from citrus waste emits approximately 0.3 to 0.5 tonnes of CO₂e per tonne of d-limonene produced. This is significantly lower than petroleum-derived solvents like acetone or toluene, which can emit 2–5 tonnes CO₂e per tonne. |
|
|
|
|
|
|
|
|
|
|
13.8 |
at 25 °C |
Moderate |
|
|
- |
- |
- |
|
|
-73.5 |
|
- |
|
|
175 |
|
- |
|
|
- |
- |
- |
|
|
45 |
|
- |
|
|
|
1.70 X 1004 |
Calculated |
- |
|
|
4.23 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
160000 |
|
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
1580 |
|
Volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
28.5 |
|
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1405 |
Colinus virginianus |
- |
|
|
- |
- |
- |
|
|
999.7 |
as product corr |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
> 100 |
as product |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
~ 96 |
Aphidius rhopalosiphi |
Moderate |
|
|
~ 175 |
Typhlodromus pyri |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
0.702 |
Pimephales promelas |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.421 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
4.08 |
Desmodesmus subspicatus |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) used to calculate Total Applied Toxicity (TAT) |
|
|
|
|
|
|
|
500 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
199.94 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
2 |
Worst case of contact and oral honeybees |
|
|
48 |
Worst case of parasitic wasps and predatory mites |
|
|
0.00702 |
Worst case of temperate acute and chronic fish |
|
|
0.00421 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.408 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Low (class I) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
None allocated |
|
- |
|
|
85 |
|
- |
|
|
- |
- |
- |
|
|
|
Acceptable for proposed uses |
|
|
Acceptable for proposed uses |
|
|
Rapidly excreted (2-3 days) majority in urine & less than 10% in faeces |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
No further information available |
|
|
|
|
|
Flammable Not explosive or oxidising |
|
|
Health: H317 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
d-limonene |
|
|
D-limonene |
|
|
D-Limonen |
|
|
D-limonen |
|
|
D-limonene |
|
|
D-limonene |
|
|
- |
|
|
D-limonen |
|
|
- |
|
|
- |
|
|
dipenteen |
|
|
- |
| Record last updated: |
19/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.