Polyoxin B |

Last updated: 26/08/2025
|
 |
(Also known as: polyoxim AL) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. These hazard alerts do not take account of usage patterns or exposure, thus do not represent risk.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A microbial fungicide used lawns, top fruit and rice to control various pathogenic fungi |
|
Various plant pathogenic fungi including including Alternaria spp. and Botrytis spp. such as powdery mildews |
|
Top fruit; Vegetables; Ornamentals |
|
- |
|
- |
|
- |
|
Not approved |
|
Expired |
|
No UK approval for use as a plant protection agent |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Spain |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Polyoxin B exhibits stereoisomerism due to multiple chiral centres in its molecular structure, which contribute to its complex three-dimensional configuration and biological specificity. The molecule contains several asymmetric carbon atoms, particularly within its sugar and peptide-like moieties, allowing for distinct stereoisomers that can influence its fungicidal activity. |
|
C₁₇H₂₅N₅O₁₃ |
|
C1=C(C(=O)NC(=O)N1C2C(C(C(O2)C(C(=O)O)NC(=O)C(C(C(COC(=O)N)O)O)N)O)O)CO |
|
- |
|
YFZNSPMAOIVQRP-YVKGXWRCSA-N |
|
InChI=1S/C17H25N5O13/c18-6(8(25)5(24)3-34-16(19)32)13(29)20-7(15(30)31)11-9(26)10(27)14(35-11)22-1-4(2-23)12(28)21-17(22)33/h1,5-11,14,23-27H,2-3,18H2,(H2,19,32)(H,20,29)(H,30,31)(H,21,28,33)/t5-,6-,7-,8+,9-,10+,11+,14+/m0/s1 |
|
Yes |
|
Fungicide |
|
Micro-organism derived substance |
|
- |
|
- |
|
Natural |
|
Systemic with protective action, inhibits cell wall biosynthesis |
|
Isolated from the soil bacterium Streptomyces cacaoi var asoensis |
|
Crop protection |
|
Various plant pathogenic fungi including including Alternaria spp. and Botrytis spp. such as powdery mildews |
|
Top fruit; Vegetables; Ornamentals |
|
- |
|
19396-06-6 |
|
243-024-9 |
|
- |
|
- |
|
- |
|
507.41 |
|
- |
|
(2S)-2-[[(2S,3S,4S)-2-amino-5-carbamoyloxy-3,4-dihydroxypentanoyl]amino]-2-[(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-(hydroxymethyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]acetic acid |
|
C1=C(C(=O)NC(=O)N1[Cat H]2[Cat at H]([Cat at H]([Cat H](O2)[Cat at H](C(=O)O)NC(=O)[Cat H]([Cat at H]([Cat H](COC(=O)N)O)O)N)O)O)CO |
|
- |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
19 |
|
- |
|
Brown powder with musty odour |
|
|
|
Current |
|
1965, first isolated |
|
- Kumiai Chemical Industry Co., Ltd.
|
|
|
|
Usually supplied as a wettable powder, emulsifiable concentrate or soluble granules |
|
Polyoxin B is produced commercially through a fermentation process involving the bacterium Streptomyces cacaoi var. asoensis. The bacterium is cultivated in a suitable culture medium using large scale fermenters under controlled conditions. During fermentation, the bacterium produces a complex mixture of polyoxins, including polyoxin B. The complex is extracted from the culture medium and purified to isolate polyoxin B. This step may involve various chromatographic techniques to achieve the desired purity |
|
There are no precise, published data on the GHG emissions associated with the production of polyoxin B. However, it can be estimates from data for similar substances and this suggests emissions are in the range of 1.5–5.0 kg CO₂e per kg of product. |
|
|
|
|
|
|
|
2470 |
|
High |
|
13.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
2250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
0.65 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
0.65 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
|
188 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Decomposes |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
6.17 X 10-02 |
Calculated |
- |
|
-1.21 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.84 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
pKa(2) 6.9, pKa(3) 9.4 |
|
1.33 X 1005 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Upland conditions, 2 soil types |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
15 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Slow |
|
- |
|
|
Stable |
|
Stable |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 21000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 yr |
- |
|
48000 |
- |
|
- |
- |
- |
|
2150 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
28.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinidae spp. |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
4.08 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Unknown species |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 21000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
750 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
> 2.17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
No further information available |
|
|
|
No information available |
|
- |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
polyoxin B |
|
polyoxin B |
|
Polyoxin |
|
polyoxin |
|
polioxin |
|
polioxina |
|
- |
|
polioksyna |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
26/08/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |