Scilliroside |

Last updated: 22/08/2025
|
 |
(Also known as: red squill; rodine; silmine) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. These hazard alerts do not take account of usage patterns or exposure, thus do not represent risk.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A plant-derived rodenticide |
|
Most effective against Norway rats but also used to control black rats, house mice, field mice, and field voles |
|
Building; Non-cropped areas |
|
- |
|
- |
|
- |
|
Not approved |
|
Expired |
|
No UK approval for use as a plant protection agent |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
  |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
Scilliroside exhibits stereoisomerism due to its complex chiral structure, which includes multiple stereocentres within its steroidal backbone and sugar moiety. As a bufadienolide glycoside, it contains a steroid nucleus with hydroxyl and acetoxy substituents, as well as a beta-D-glucopyranoside group attached at position 3. The molecule's isomerism arises from the spatial arrangement of these groups around its chiral centres, leading to distinct stereoisomers that differ in biological activity and toxicity. |
|
C₃₂H₄₄O₁₂ |
|
CC(=O)OC1CC2(C(CCC3(C2(CCC3C4=COC(=O)C=C4)O)C)C5(C1=CC(CC5)OC6C(C(C(C(O6)CO)O)O)O)C)O |
|
CC(=O)O[C@@H]1C[C@@]2([C@H](CC[C@]3([C@@]2(CC[C@@H]3C4=COC(=O)C=C4)O)C)[C@@]5(C1=C[C@H](CC5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)O |
|
LSMIOFMZNVEEBR-ICLSSMQGSA-N |
|
InChI=1S/C32H44O12/c1-16(34)42-21-13-31(39)23(8-10-30(3)19(7-11-32(30,31)40)17-4-5-24(35)41-15-17)29(2)9-6-18(12-20(21)29)43-28-27(38)26(37)25(36)22(14-33)44-28/h4-5,12,15,18-19,21-23,25-28,33,36-40H,6-11,13-14H2,1-3H3 |
|
Yes |
|
Rodenticide |
|
Plant-derived substance |
|
- |
|
- |
|
Natural |
|
Toxin with stomach action, causes emesis and affects the rodents cardiovascular and central nervous system |
|
Extracted from the red squill plant (Drimia maritima) found in southern Europe, western Asia, and northern Africa. |
|
Rodenticide |
|
Most effective against Norway rats but also used to control black rats, house mice, field mice, and field voles |
|
Building; Non-cropped areas |
|
- |
|
507-60-8 |
|
208-077-4 |
|
259 |
|
070801 |
|
- |
|
620.28 |
|
- |
|
3β-(β-D-glucopyranosyloxy)-17β-(2-oxo-2H-pyran-5-yl)-14β-androst-4-ene-6β,8,14-triol 6-acetate |
|
(3β,6β)-6-(acetyloxy)-3-(β-D-glucopyranosyloxy)-8,14-dihydroxybufa-4,20,22-trienolide |
|
- |
|
Chemical subject to PIC regulations |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
- |
|
Yellow crystalline solid |
|
|
|
Considered obsolete but may be available in some countries |
|
Circa 1945, introduced |
|
- May & Baker Ltd
- Rhone-Poulen
- Sanofi
|
|
|
|
Scilliroside was commercially formulated both as ready-to-use bait and as granules |
|
Commercially, it can be produced in a variety of techniques, including solvent extraction and liquid-liquid extraction. The process usually involves the use of polar organic solvents, followed by various purification stages to isolate the compound. |
|
There is currently no specific data available on the greenhouse gas (GHG) emissions associated with the production of scilliroside. Because scilliroside is considered obsolete and not widely manufactured today, its environmental footprint, including GHG emissions, has not been comprehensively assessed or reported in public databases. |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
169 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.05 X 10-01 |
Calculated |
- |
|
-0.98 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.45 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Very mobile |
|
12 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
0.43 |
Rat |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
400 |
Gallus domesticus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
0.43 |
Rat |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
No data found |
No data found |
  |
|
|
Cardiac glycosides - may cause convulsions or seizures Highly toxic |
|
|
|
IMDG Transport Hazard Class 6.1(a) |
|
Health: H300 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
UN2810 |
|
Packaging Group I (great danger) |
|
- |
|
|
|
scilliroside |
|
scilliroside |
|
Scillirosid |
|
scilliroside |
|
scilliroside |
|
scilliroside |
|
- |
|
scilliroside |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
22/08/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |