Urea sulphate |

Last updated: 04/06/2025
|
 |
(Also known as: urea sulfate; 1-aminomethanamide dihydrogen tetraoxosulfate; urea dihydrogen sulfate; enquik) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
  |
|
|
|
Plant growth regulator used as a blossom thinner on fruit trees and other crops |
|
Growth - defoiliant and desiccant |
|
Apples; Pears; Grapes; Asparagus; Cotton; Coffee |
|
- |
|
- |
|
Current |
|
- |
|
- |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Greece/Finland |
|
30/04/2039 |
|
No |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
  |
  |
  |
✓ |
  |
  |
  |
  |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
  |
  |
  |
  |
✓ |
  |
  |
  |
  |
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
  |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
None |
|
CH₆N₂O₅S |
|
C(=O)(N)N.OS(=O)(=O)O |
|
No data |
|
SSBRSHIQIANGKS-UHFFFAOYSA-N |
|
InChI=1S/CH4N2O.H2O4S/c2-1(3)4;1-5(2,3)4/h(H4,2,3,4);(H2,1,2,3,4) |
|
Yes |
|
Herbicide; Plant Growth Regulator |
|
Inorganic PGR |
|
- |
|
- |
|
Synthetic (urea itself occurs naturally) |
|
Disrupts cell membrane structures |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
21351-39-3 |
|
244-343-6 |
|
- |
|
128961 |
|
159909 |
|
No data found |
|
158.13 |
|
- |
|
monocarbamide dihydrogen sulphate |
|
uronium hydrogen sulphate |
|
- |
|
- |
|
None allocated |
|
None allocated |
|
Not applicable |
|
Not applicable |
|
- |
|
Variable coloured solid (white, pink, green depedning on purity). Products often a green liquid |
|
|
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
5.6 |
|
- |
|
- |
- |
- |
|
110 |
|
- |
|
200 |
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.52 |
|
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
None
Terrestrial ecotoxicology |
|
|
|
|
|
350 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 5620 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 80 |
Gasterosteus aculeatus |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 10.7 |
Unknown species |
Low |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
350 |
Rat |
Moderate |
|
2000 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
None allocated |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
Chronic exposure may cause pneumoconiosis |
|
|
|
Caustic, highly corrosive |
|
Health: H315, H318, H319 |
|
Not listed (Not listed) |
|
Not regulated |
|
- |
|
- |
|
|
|
urea sulphate |
|
hydrogenosulfate d'uronium |
|
Uroniumhydrogensulfat |
|
- |
|
- |
|
hidrogenosulfato de uronio |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
04/06/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |