P,P'-DDT |

Last updated: 14/11/2024
|
 |
(Also known as: clofenotane) |
DDT is an organochlorine insecticide. It has a low aqueous solubility, is relatively volatile and has a low potential to leach to groundwater. It is highly persistent in soil and non-mobile. It is moderately toxic by the oral route in humans and other mammals but is a carcinogen and endocrine disrupter. It shows a high to moderate level of toxicity to most animals and insects although it is relatively non-toxic to birds. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A major isomer of the obsolete and banned insecticide that was used to control insect vectors of disease, especially malaria |
|
Mosquitoes; Houseflies; Body lice; Colarado beetles; Gypsy moths |
|
Agricultural crops; Domestic houses; Offices, commercial and industrial situations; Non-cropped sites including roads, rights-of-way; parkland |
|
Not applicable |
|
Considered obsolete but may be available in some countries; Banned in many countries |
|
1944, introduced |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes as DDT |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
A major isomer of DDT which is normally around 75-85% of the DDT isomeric mix. |
|
C₁₄H₉Cl₅ |
|
C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)C(Cl)(Cl)Cl)Cl |
|
- |
|
YVGGHNCTFXOJCH-UHFFFAOYSA-N |
|
InChI=1S/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
DDT |
Unstated isomer |
 |
O,P'-DDT |
Related isomer |
 |
|
Insecticide |
|
Organochloride insecticide; Organochloride acaricide; Bridged diphenyl insecticide; Bridged diphenyl acaricide |
|
- |
|
- |
|
Synthetic |
|
Central nervous system stimulant. GABA-gated chloride channel antagonist. Sodium channel modulator. |
|
50-29-3 |
|
200-024-3 |
|
3 |
|
- |
|
3036 |
|
602-045-00-7 |
|
354.49 |
|
1,1'-(2,2,2-trichloroethane-1,1-diyl)bis(4-chlorobenzene) |
|
1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane |
|
1,1'-(2,2,2-trichloroethylidene)bis(4-chlorobenzene) |
|
WFD priority substance; POP - regulated by Stockholm Convention; LRTAP Annex I; PAN Dirty Dozen; OSPAR soc; Marine Pollutant; Rotterdam Convention (Class II) - subject to PIC regulations |
|
EU Directive 2008/105/EC EQS for total DDT surface waters: annual average 0.025 µg l⁻¹ UK statutory standard for protection of aquatic life for inland, coastal & territorial surface waters: 0.025 µg l⁻¹ as annual mean conc |
|
Not applicable |
|
Not applicable |
|
3B |
|
Not applicable |
|
Wide variety of insects are resistant |
|
Colourless crystalline powder |
|
|
|
|
|
|
|
- Genitox
- Anofex;Detoxan
- Neocid
|
|
- |
|
|
|
|
|
0.025 |
R4 R = Peer reviewed scientific publications 4 = Verified data at 25 °C |
Low |
|
58000 |
Acetone |
- |
78000 |
Benzene |
- |
42000 |
benzyl benzoate |
- |
|
109 |
|
- |
|
Decomposes before boiling |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
- |
- |
- |
|
162 |
(open cup) |
- |
|
|
8.13 X 1006 |
Calculated |
- |
|
6.91 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
6200 |
as DDT |
Very persistent |
|
2000 |
as DDT |
Very persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data as DDT, PIC DGD; DT₅₀; Other sources: DT₅₀ 3 months in tropical regions, 4-30 years temperate regions. |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Non-mobile |
|
151000 |
|
As DDT |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-3.89 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
High |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
|
|
|
|
|
Relevancy unknown |
- |
- |
|
Relevancy unknown |
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
250 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 2240 |
Anas platyrhynchos as DDT |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
8.8 |
Apis mellifera |
Moderate |
|
5.1 |
Apis mellifera |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 2.5 |
Oncorhynchus mykiss as DDT |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 0.005 |
Daphnia magna as DDT |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
> 0.0046 |
Crassostrea gigas |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
250 |
Rat |
Moderate |
|
2510 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat as DDT |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I, II |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
Non-statutory WHO drinking water guideline 0.001 mg l⁻¹ |
UK EA QS database 2018 |
- |
|
- |
- |
- |
|
Mainly excreted in the urine but some also occurs by way of faeces (via biliary excretion) |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
?Possibly, status not identified |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
No data found |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Toxic by ingestion, inhalation and via skin absorption Xenoestrogen agent Mutagenic Endocrine issues - Competitive binding to androgen receptors CLP data - suspected carcinogen; US NTP - known carcinogen; US EPA - probable human carcinogen |
|
|
|
When heated to decomposition it emits toxic fumes. IMDG Transport Hazard Class 6.1 |
|
Health: H301, H311, H330, H351, H372, H373 Environment: H400, H410 |
|
Not listed (Not listed) |
|
UN2761 |
|
- |
|
- |
|
|
|
P,P'-DDT |
|
p,p'-DDT |
|
p,p'-DDT |
|
p,p'-DDT |
|
p,p'-DDT |
|
p,p'-DDT |
|
p,p'-DDT |
|
p,p'-DDT |
|
p,p'-DDT |
|
p,p'-DDT |
|
p,p'-DDT |
|
- |
Record last updated: |
14/11/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |