Bistrifluron (Ref: DBI-3204) |
Last updated: 17/05/2024
|
|
(Not known by any other names) |
Bistrifluron is an insecticide used to control chewing pests It is not very soluble in water, volatile and, based on its chemical properties, it is non-mobile with a low potential to leach to groundwater. It is considered to be relatively persistent in soil and aquatic systems. It is not highly toxic to mammals but there is some concern that it may bioaccumulate. It shows a low level of toxicity to birds and moderate to high toxicity for most aquatic species, honeybees and earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A benzoylurea insecticide used for the control of chewing insects |
|
Aphids; Whiteflies; Caterpillars; Termites |
|
Cotton; Fruit including apples; Vegetables including leafy brassicas; Tomatoes |
|
- |
|
- |
|
2013, under development |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₆H₇CIF₈N₂O |
|
C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=CC(=C2Cl)C(F)(F)F)C(F)(F)F)F |
|
- |
|
YNKFZRGTXAPYFD-UHFFFAOYSA-N |
|
InChI=1S/C16H7ClF8N2O2/c17-12-7(16(23,24)25)4-6(15(20,21)22)5-10(12)26-14(29)27-13(28)11-8(18)2-1-3-9(11)19/h1-5H,(H2,26,27,28,29)/f/h26-27H |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
bistrifluron |
- |
|
|
Insecticide, Insect Growth Regulator |
|
Benzoylurea insecticide |
|
- |
|
- |
|
Synthetic |
|
Inhibitor of chitin biosynthesis affecting CHS1 |
|
201593-84-2 |
|
606-446-8 |
|
None allocated |
|
Not listed |
|
10275455 |
|
No data found |
|
446.68 |
|
N-{[2-chloro-3,5-bis(trifluoromethyl)phenyl]carbamoyl}-2,6-difluorobenzamide |
|
N-{[2-chloro-3,5-bis(trifluoromethyl)phenyl]carbamoyl}-2,6-difluorobenzamide |
|
N-[[[2-chloro-3,5-bis(trifluoromethyl)phenyl]amino]carbonyl]-2,6-difluorobenzamide |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
15 |
|
Not applicable |
|
- |
|
White, odourless powder |
|
|
|
- Astra Industrial Complex Co
- Sumitomo Chemicals
- Dongbu Fine Chemicals, China
|
|
|
|
Usually supplied in tablet or pellet form |
|
|
|
|
|
|
|
0.03 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low |
|
33000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
64000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
3500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
171.5 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
5.50 X 1005 |
Calculated |
- |
|
5.74 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.61 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
9.58 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
Weak acid |
|
0.0027 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
0.04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
80.5 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Regulatory document states DT₅₀ range 33-128 days |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
10 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Moderately fast |
|
Estimated to be in the range of 1.7 to 22.4 days |
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
Stable pH 5 to pH 9, 20 °C |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-mobile |
|
37480 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
-1.09 |
Calculated |
Low leachability |
|
|
5.35 X 10-03 |
Calculated |
- |
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
High |
Calculated |
- |
|
Non-mobile |
Calculated |
- |
|
- |
- |
- |
|
|
2414 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Killfish |
Threshold for concern |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 5000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
Low |
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
220 |
- |
|
- |
- |
- |
|
> 2250 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
> 1000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Eisenia foetida |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 100 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Apis mellifera |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinidae spp. |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 1.2 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 5000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
Low |
|
10000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rat |
- |
|
> 4.022 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Rats 4 hr |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk for proposed usage pattern |
|
Low risk for proposed usage pattern |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
Possible liver toxicant |
|
|
|
Not explosive or oxidising Not expected to auto-ignite; Not highly flammable |
|
Environment: H400, H410 |
|
Not listed (Not listed) |
|
- |
|
- |
|
- |
|
|
|
bistrifluron |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
17/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |