Ametryn (Ref: G 34162 ) |
Last updated: 29/08/2024
|
|
(Also known as: ametryne; ametrex) |
Ametyn is a triazine herbicide. It is moderately soluble in water but much more so in organic solvents. It is quite volatile and not expected to leach to groundwater. It is moderately persistent in soils and can persist for a long time in water under certain conditions. It is moderately toxic to mammals and a recognised irritant. Ametryn is moderately toxic to most aquatic organisms, honeybees and earthworms but less so to birds. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A triazine herbicide used to control most annual and broad-leaved weeds |
|
Burmuda grass, wiregrass, goosegrass, crabgrass and other grass weeds; Broad-leaved weeds including dallisgrass, thistle, purslane, pigweed, cocklebur, lambsquarters, morning glory and foxtail |
|
Fruit including citrus, bananas; Corn; Potatoes; Sugarbeet |
|
- |
|
Current |
|
1964, first registered USA |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
- |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₉H₁₇N₅S |
|
CCNC1=NC(=NC(=N1)SC)NC(C)C |
|
No data |
|
RQVYBGPQFYCBGX-UHFFFAOYSA-N |
|
InChI=1S/C9H17N5S/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)15-4/h6H,5H2,1-4H3,(H2,10,11,12,13,14) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
ametryn monohydrate |
Variant |
|
ametryn |
- |
|
|
Herbicide |
|
Triazine herbicide |
|
96% |
|
- |
|
Synthetic |
|
Selective, systemic absorbed through foliage and roots. Inhibits photosynthesis (photosystem II). |
|
834-12-8 |
|
212-634-7 |
|
133 |
|
080801 |
|
13263 |
|
613-010-00-0 |
|
227.12 |
|
N2-ethyl-6-(methylsulfanyl)-N4-(propan-2-yl)-1,3,5-triazine-2,4-diamine |
|
N2-ethyl-N4-isopropyl-6-methylthio-1,3,5-triazine-2,4-diamine |
|
N-ethyl-N'-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
|
Chemical subject to PIC regulations |
|
- |
|
C1 |
|
5 |
|
Not applicable |
|
Not applicable |
|
- |
|
White powder |
|
|
|
- Syngenta Crop Protection
- FCC
- King Tech Corp
- Ciba-Geigy
- Makhteshim-Agan
|
|
- Ametrex
- Evik
- Gesapax
- Almulex
- Duroplant
- Acetotrene Herbicide
|
|
Available in a range of formulations including emulsifiable concentrates, flowable concentrates and wettable powders. |
|
|
|
|
|
|
|
200 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderate |
|
56900 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Acetone |
- |
1400 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source n-Hexane |
- |
4600 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Toluene |
- |
|
86.7 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
337 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
4.27 X 1002 |
Calculated |
- |
|
2.63 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.18 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
10.07 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
Very weak acid |
|
0.365 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility. If applied directly to plants, drift is a concern & mitigation is advisable |
|
4.10 X 10-04 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
37 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
60 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately persistent |
|
37 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Other sources: DT₅₀ 70-120 days (R3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
- |
|
Slow degradation in UV light |
|
|
Stable |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Stable |
|
Stable to hydrolysis except at extreme pH values e.g. pH 0-1 and pH 13-14. |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Moderately mobile |
|
316 |
|
General literature Koc range 170-390 mL g⁻¹ |
|
|
76.81 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-mobile |
|
5115 |
|
0.86 |
|
Kf range 1.35-194.6 mL g⁻¹, Kfoc range 38.6-14969 mL g⁻¹, 1/n range 0.60-1.22, Soils=3 |
|
- |
|
|
|
|
|
0.46 |
Calculated |
Low leachability |
|
|
9.47 X 10-03 |
Calculated |
- |
|
- |
|
Medium |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
- |
- |
- |
|
|
33 |
|
Low potential |
|
Not available |
- |
Known groundwater metabolites |
|
None
|
|
|
|
2-methylthio-4-amino-6-isopropylamino-s-triazine (Ref: GS-11354) |
- |
Plant |
- |
2-methylthio-4,6-diamino-s-triazine (Ref: GS-26831) |
- |
Plant |
- |
2-methylthio-4-amino-6-ethylamino-s-triazine (Ref: GS-11355) |
- |
Plant |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
110 |
Rat |
Moderate |
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat |
- |
|
50 |
- |
|
- |
- |
- |
|
> 5620 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
166 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
0.70 |
Pimephales promelas 35 day |
Moderate |
|
- |
- |
- |
|
28 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
0.32 |
Daphnia magna LOEC |
Moderate |
|
- |
- |
- |
|
1.7 |
Americamysis bahia |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.01 |
Lemna perpusilla 7 day |
Moderate |
|
0.0036 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
High |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
110 |
Rat |
Moderate |
|
2020 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rabbit |
- |
|
> 5.03 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Slightly toxic |
|
|
|
Not expected to auto-ignite; Not highly flammable |
|
Health: H302 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
- |
|
- |
|
- |
|
|
|
ametryn |
|
ametryne |
|
Ametryn |
|
ametryn |
|
ametrina |
|
ametrina |
|
ametryn |
|
ametryna |
|
- |
|
- |
|
ametryn |
|
- |
Record last updated: |
29/08/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |