Dicamba diglycolamine |

Last updated: 05/02/2025
|
 |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A herbicide for control of annual and perennial broad-leaved weeds and brush species |
|
Bedstraw; Buttercup; Carpetwed; Cocklebur; Lambsquarters; Mallow; Goosefoot; Pigweed; Sowthistle; Velvetleaf; Knapweed; Teasel; Plantains; Bindweed; Thistles |
|
Cotton; Sugarcane; Soybeans; Sorghum; Asparagus; Grass seed crops; Non-cropland; Cereals including wheat, triticale, oats, maize, rye |
|
Shown to be efficiatious via field trials and extensive global use. |
|
Current |
|
circa 1963, introduced |
|
Approved |
|
31/12/2029 |
|
Check label - may vary with formulation |
EC Regulation 1107/2009 (repealing 91/414) |
|
Approved |
|
Denmark/Romania |
|
31/03/2027 |
|
No |
|
Yes - as dicamba |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
|
|
|
|
None |
|
C₁₂H₁₇Cl₂NO₅ |
|
COC1=C(C=CC(=C1C(=O)O)Cl)Cl.C(COCCO)N |
|
- |
|
QURLONWWPWCPIC-UHFFFAOYSA-N |
|
InChI=1S/C8H6Cl2O3.C4H11NO2/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;5-1-3-7-4-2-6/h2-3H,1H3,(H,11,12);6H,1-5H2 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
Dicamba |
Parent |
 |
|
Herbicide, Plant Growth Regulator |
|
Benzoic acid herbicide; Benzoic acid PGR |
|
- |
|
EU dossier - None declared |
|
Synthetic |
|
Selective, systemic, absorbed through leaves and translocates throughout plant. Synthetic auxin. |
|
104040-79-1 |
|
No data found |
|
85 |
|
- |
|
18772449 |
|
607-043-00-X |
|
326.17 |
|
3,6-dichloro-2-methoxybenzoic acid—2-(2-aminoethoxy)ethan-1-ol (1/1) |
|
3,6-dichloro-o-anisic acid - 2-(2-aminoethoxy)ethanol (1:1) |
|
3,6-dichloro-2-methoxybenzoic acid compound with 2-(2-aminoethoxy)ethanol (1:1) |
|
Potential groundwater contaminant |
|
- |
|
O |
|
4 |
|
Not applicable |
|
Not applicable |
|
- |
|
- |
|
|
|
|
|
- |
|
- |
|
Often supplied as a soluble concentrate that is mixed with water and applied as a spray |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
Not readily biodegradable |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
Known groundwater metabolites |
|
None
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 3500 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 89.5 |
Apis mellifera as dicamba |
Moderate |
|
> 89.5 |
Apis mellifera as dicamba |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 3500 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.3 |
as dicamba |
- |
|
0.3 |
as dicamba |
- |
|
0.3 |
as dicamba |
- |
|
0.3 |
as dicamba |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Negligible risk to bystanders |
|
No unacceptable risks to operators or other farm workers identified |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
0.1 |
EU Dir 89/778/EC limit as dicamba |
- |
|
Rapid and extensive elimination mainly via the urine |
|
- |
|
Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B3 B = DNA damage/repair (EFSA database) 3 = Negative ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
?Possibly, status not identified |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
|
|
|
Harmful if swallowed Possible liver toxicant May cause serious eye damage Evidence of thyroid parafollicular (C-cell) carcinoma in male rats; Published studies suggest weak associations between dicamba and colon/lung cance May cause body weight effects |
|
|
|
Corrosive Not explosive or oxidising IMDG Transport Hazard Class 9 Not expected to auto-ignite; Not highly flammable |
|
Health: H302, H318 Environment: H412 |
|
II (Moderately hazardous) |
|
UN3077 |
|
Packaging Group III (minor danger) |
|
- |
|
|
|
dicamba diglycolamine |
|
dicamba diglycoamine |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
05/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |