Naptalam (Ref: ACP 322) |

Last updated: 13/12/2024
|
 |
(Also known as: alanap; naptalam-sodium; naphthalam) |
Naptalam is a broad-spectrum herbicide. It is usually used as the sodium salt as this is more soluble. Whilst naptalam is not particularly toxic to humans its major metabolite 1-naphthylamine is a carcinogen. Its environmental fate is pH sensitive. It may pose a threat to groundwaters. Virtually non-toxic to mammals, birds, honeybees and most aquatic species. No data for earthworms has been identified. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A pre-emergence herbicide used for the control of a wide range of weeds and grasses in food and non-food crops |
|
Annual broad-leaved weeds; Grasses |
|
Soybean; Peanuts; Cucumbers; Melons; Curcubits; Cranberries; Woody ornamentals |
|
- |
|
Current |
|
1955, introduced |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₈H₁₃NO₃ |
|
C1=CC=C2C(=C1)C=CC=C2NC(=O)C3=CC=CC=C3C(=O)O |
|
No data |
|
JXTHEWSKYLZVJC-UHFFFAOYSA-N |
|
InChI=1S/C18H13NO3/c20-17(14-9-3-4-10-15(14)18(21)22)19-16-11-5-7-12-6-1-2-8-13(12)16/h1-11H,(H,19,20)(H,21,22) |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
naptalam |
- |
 |
|
Herbicide |
|
Phthalamate compound; Amide herbicide |
|
- |
|
- |
|
Synthetic |
|
Selective, absorbed by roots and to a lesser extent foliage. Inhibits indolylacetic acid transport. |
|
132-66-1 |
|
625-029-1 |
|
None allocated |
|
030702 |
|
8594 |
|
No data found |
|
291.30 |
|
- |
|
N-1-naphthylphthalamic acid |
|
2-[(1-naphthalenylamino)carbonyl]benzoic acid |
|
Potential groundwater contaminant |
|
- |
|
P |
|
19 |
|
Not applicable |
|
Not applicable |
|
- |
|
Crytalline solid |
|
|
|
|
|
|
|
- Ancrack
- Klean Krop
- Rescue
- Alanap
- Grelutin
|
|
Available as liquids for dilution and in granular formulations. |
|
|
|
|
|
|
|
200 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Moderate |
|
5900 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
20900 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Methanol |
- |
400 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Xylene |
- |
Insoluble |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Hexane |
- |
|
185 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.63 X 1005 |
Calculated |
- |
|
5.42 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.36 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
4.6 |
|
- |
Weak acid |
|
0.133 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility. If applied directly to plants, drift is a concern & mitigation is advisable |
|
1.94 X 1002 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
36.7 |
|
Moderately persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data US EPA; Other sources: DT₅₀ 36.7 days (DW2) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
6.2 |
|
Moderately fast |
|
- |
|
|
2.9 |
|
Non-persistent |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Mobile |
|
20 |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
4.22 |
Calculated |
High leachability |
|
|
1.24 X 1000 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Mobile |
Calculated |
- |
|
- |
- |
- |
|
|
157 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
Not available |
- |
Known soil and groundwater metabolites |
|
None
|
|
|
|
1-naphthylamine Note: Carcinogenic |
- |
- |
- |
Terrestrial ecotoxicology |
|
|
|
|
|
1770 |
Rat |
Moderate |
|
|
30 |
L1 L = Pesticide manuals and hard copy reference books / other sources 1 = Estimated data with little or no verification Rat |
High |
|
- |
- |
|
- |
- |
- |
|
> 4640 |
Anas platyrhynchos |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 113.2 |
|
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 76.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
> 118.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
> 1.0 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pseudokirchneriella subcapitata |
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
1770 |
Rat |
Moderate |
|
2000 |
Rabbit |
- |
|
> 2.07 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Possible liver toxicant |
|
|
|
No information available |
|
Health: H302 Environment: H412 |
|
U (Unlikely to present an acute hazard) |
|
- |
|
- |
|
- |
|
|
|
naptalam |
|
naptalame |
|
Naptalam |
|
naptalam |
|
naptalam |
|
naptalam |
|
- |
|
naptalam |
|
- |
|
naptalam |
|
- |
|
- |
Record last updated: |
13/12/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |