Apramycin |
![]() Last updated: 07/04/2021 |
![]() |
(Also known as: nebramycin II) |
|
![]() |
|
An antibiotic and antibacterial compound used in veterinary medicine including the treatment of colibacillosis and salmonella in calves and bacterial enteritis in pigs and lambs | |
---|---|---|
|
- | |
|
- | |
|
Pigs, Lambs, Cattle, Chickens |
Chemical structure |
|
Isomeric | |
---|---|---|
|
C₂₁H₄₁N₅O₁₁ | |
|
CNC1C(C2C(CC(C(O2)OC3C(CC(C(C3O)O)N)N)N)OC1OC4C(C(C(C(O4)CO)N)O)O)O | |
|
CN[C@H]1[C@H]([C@@H]2[C@H](C[C@H]([C@H](O2)O[C@@H]3[C@H](C[C@H]([C@@H]([C@H]3O)O)N)N)N)O[C@@H]1O[C@@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)N)O)O)O | |
|
XZNUGFQTQHRASN-XQENGBIVSA-N | |
|
InChI=1S/C21H41N5O11/c1-26-11-14(30)18-8(33-20(11)37-21-16(32)13(29)10(25)9(4-27)34-21)3-7(24)19(36-18)35-17-6(23)2-5(22)12(28)15(17)31/h5-21,26-32H,2-4,22-25H2,1H3/t5-,6+,7-,8+,9-,10-,11+,12+,13+,14-,15-,16-,17-,18+,19?,20-,21-/m1/s1 | |
|
Yes |
General status |
|
Antibiotic, Antimicrobial, Antibacterial | |
---|---|---|
|
Aminoglycoside | |
|
- | |
|
- | |
|
Synthetic | |
|
Inhibitor of protein synthesis in bacteria both in vivo and in vitro | |
|
[16S rRNA] | |
|
37321-09-8 | |
|
253-460-1 | |
|
- | |
|
- | |
|
- | |
|
QJ51GB90; QA07AA92; QJ01GB90 | |
|
Antiinfectants for systemic use: Antibacterials for intramammary use; Alimentary tract & metabolism: Intestinal antiinfectants; Antiinfectants for systemic use: Antibacterials for systemic use | |
|
No | |
|
Allowed substance (Table 1: Bovine, Ovine, Pocine, Chicken, Rabbit) | |
|
539.58 | |
|
- | |
|
(2R,3R,4S,5S,6S)-2-[[(2R,3S,4R,4aR,6S,7R,8aS)-7-amino-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxy-4-hydroxy-3-(methylamino)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]oxy]-5-amino-6-(hydroxymethyl)oxane-3,4-diol | |
|
D-Streptamine,O-4-amino-4-deoxy-a-D-glucopyranosyl-(1®8)-O-(8R)-2-amino-2,3,7-trideoxy-7-(methylamino)-D-glycero-a-D-allo-octodialdo-1,5:8,4-dipyranosyl-(1®4)-2-deoxy- | |
|
- | |
|
- | |
|
Colourless, needle-shaped crystals |
Formulations |
|
|
|
|
|
||||||
---|---|---|---|---|---|---|---|---|---|---|
|
Apralan Soluble Powder for Oral Solution | Eli Lilly Company | UK National authorisation | Prescription only medicine to be authorised by a veterinarian (POM-V) | ||||||
Apralan G200 Premix medicated feeding stuff | Eli Lilly Company | UK National authorisation (IC) | Prescription only medicine to be authorised by a veterinarian (POM-V) | |||||||
|
Often supplied as a powder which is added to livestock's drinking water. Also available as premix and pour-on formulations |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
300000 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
189 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
- | ||||||||
|
823 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
451.6 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
|
|
5.01 X 10-04 | Calculated | - | |||||||
|
-3.3 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
1.56 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
|
8.5 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
- | ||||||||
- | |||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Non-mobile | |||||||
|
500755 | ||||||||||
|
Literature values Koc range 341900 - 659609 mL g⁻¹ | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
- | - | - | |||||||||||||||||||||||||
|
- | - |
|
![]() |
Terrestrial ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
> 4160 | P3 P = Other governments and regulators Rat as the sulphate3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
1669 | E3 E = Manufacturers safety data sheets Colinus virginianus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 100 | R4 R = Peer reviewed scientific publications Eisenia foetida4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Aquatic ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
300 | E3 E = Manufacturers safety data sheets Oncorhynchus mykiss3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
101.6 | E3 E = Manufacturers safety data sheets Daphnia magna3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 4160 | P3 P = Other governments and regulators Rat as the sulphate3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Intravenous LD₅₀ = 280 mg kg⁻¹ | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) Mouse3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
Apramycin is rapidly absorbed when administered orally and is excreted via the kidneys without metabolisation | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Possible kidney toxicant |
Handling issues |
|
|
|||
---|---|---|---|---|
|
When heated to decomposition it emits acrid smoke and irritating fumes Corrosive |
|||
|
- | |||
|
None - not a ppp | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
apramycin | ||
|
apramycine | ||
|
- | ||
|
- | ||
|
- | ||
|
apramicina | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 07/04/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |