Medetomidine |
![]() Last updated: 09/02/2024 |
![]() |
(Not known by any other names) |
|
![]() |
|
Medetomidine is a veterinary sedative analgesic often used in combination with opioids and used as the hydrochloride salt. | |
---|---|---|
|
Current | |
|
- | |
|
Used as both a surgical anesthetic and an analgesic | |
|
Deer; Cats; Dogs |
Approval status |
|
Approved | |
---|---|---|
|
Approved |
Chemical structure |
|
Isomeric. The biologically active dextroisomer of medetomidine is known as dexmedetomide | |
---|---|---|
|
C₁₃H₁₆N₂ | |
|
CC1=C(C(=CC=C1)C(C)C2=CN=CN2)C | |
|
- | |
|
CUHVIMMYOGQXCV-UHFFFAOYSA-N | |
|
InChI=1S/C13H16N2/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13/h4-8,11H,1-3H3,(H,14,15) | |
|
Yes |
|
![]() |
Common Name | Relationship | Link |
---|---|---|
medetomidine hydrochloride | Variant | ![]() |
General status |
|
Sedative, Analgesic | |
---|---|---|
|
Biocide | |
|
Unclassified substance | |
|
>99% | |
|
- | |
|
Synthetic | |
|
A non-narcotic alpha2-adrenoreceptor agonist | |
|
[Alpha2-adrenergic, Agonist] | |
|
86347-14-0 | |
|
811-718-6 | |
|
None allocated | |
|
- | |
|
69602 | |
|
No data found | |
|
Nervous system: Psycholeptics | |
|
QN05CM91 | |
|
No | |
|
- | |
|
200.28 | |
|
- | |
|
(RS)-4-[1-(2,3-dimethylphenyl)ethyl]-3H-imidazole | |
|
- | |
|
- | |
|
- | |
|
White crystalline, odourless powder | |
|
Formulations |
|
|
|
|
|
||||||
---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | - | ||||||
|
Usually formulated, using the hydrochloride salt, as a solution for injection |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
19800 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
High | ||||||||
|
3300 | E3 E = Manufacturers safety data sheets p-Xylene3 = Unverified data of known source |
- | ||||||||
65000 | E3 E = Manufacturers safety data sheets Acetone3 = Unverified data of known source |
- | |||||||||
|
116 | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- | ||||||||
|
382 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
191.3 | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- | ||||||||
|
|
7.94 X 1002 | Calculated | - | |||||||
|
2.9 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
3.5 X 10-03 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
100 | E2 E = Manufacturers safety data sheets 2 = Unverified data of unknown source |
Persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Literature: Slow degradation | ||||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
110 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Slow | ||||||||
|
- | - | - | ||||||||
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Slightly mobile | |||||||
|
2460 | ||||||||||
|
Literature data range Koc 1215 to 3705 g/mL | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
1.22 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
- | - | - | |||||||||||||||||||||||||
|
- | - |
Known metabolites |
None
|
![]() |
Terrestrial ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
> 31.25 | E3 E = Manufacturers safety data sheets Rat3 = Unverified data of known source |
High | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Aquatic ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
30.0 | E3 E = Manufacturers safety data sheets Danio rerio3 = Unverified data of known source |
Moderate | ||||||||
|
4.5 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.005 | E3 E = Manufacturers safety data sheets Americamysis bahia as 28 day NOEC3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.34 | E3 E = Manufacturers safety data sheets Scenedesmus subspicatus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 31.25 | E3 E = Manufacturers safety data sheets Rat3 = Unverified data of known source |
High | ||||||||
|
2000 | E3 E = Manufacturers safety data sheets Rat3 = Unverified data of known source |
- | ||||||||
|
0.14 | E3 E = Manufacturers safety data sheets Rat 4 hr3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
Metabolised and excreted via the kidneys in the urine. | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Possible lungs, liver and kidney toxicant May cause hypersensitivity reactions Harmful if swallowed Has a strong sedative effect |
Handling issues |
|
|
|||
---|---|---|---|---|
|
Emits a variety of toxic fumes on combustion Corrosive Not explosive or oxidising |
|||
|
Health: H300, H310 Environment: H400, H410 |
|||
|
Not listed (Not listed) | |||
|
Not regulated | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
medetomidine | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
medetomidina | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 09/02/2024 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |