Derquantel (Ref: PF-00520904) |
Last updated: 14/01/2024 |
(Also known as: 2-deoxoparaherquamide) |
|
|
A spiroindole anthelminic veterinary drug | |
---|---|---|
|
Current | |
|
- | |
|
Intended for the treatment and control of gastrointestinal parasites in sheep | |
|
Sheep |
Approval status |
|
Approved | |
---|---|---|
|
Approved |
Chemical structure |
|
Isomeric | |
---|---|---|
|
C₂₈H₃₇N₃O₄ | |
|
CC1(C=COC2=C(O1)C=CC3=C2NCC34CC56CN7CCC(C7(CC5C4(C)C)C(=O)N6C)(C)O)C | |
|
C[C@]1(CCN2[C@]13C[C@@H]4[C@](C2)(C[C@]5(C4(C)C)CNC6=C5C=CC7=C6OC=CC(O7)(C)C)N(C3=O)C)O | |
|
DYVLXWPZFQQUIU-WGNDVSEMSA-N | |
|
InChI=1S/C28H37N3O4/c1-23(2)10-12-34-21-18(35-23)8-7-17-20(21)29-15-26(17)14-27-16-31-11-9-25(5,33)28(31,22(32)30(27)6)13-19(27)24(26,3)4/h7-8,10,12,19,29,33H,9,11,13-16H2,1-6H3/t19-,25+,26-,27+,28-/m0/s1 | |
|
Yes |
General status |
|
Anthelmintic, Antiparasitic, Medicinal drug | |
---|---|---|
|
Spiroindole | |
|
- | |
|
- | |
|
Synthetic | |
|
Broad spectrum, acts by blocking cholinergic neuromuscular transmission | |
|
[Cholinergic neuromuscular transmission, Blocker] | |
|
187865-22-1 | |
|
- | |
|
- | |
|
- | |
|
- | |
|
Antiparasitic products, Insecticides and Repellents: Anthelmintics | |
|
QP52 | |
|
No | |
|
Allowed substance (Table 1: Ovine) | |
|
479.61 | |
|
- | |
|
(1'R,5'aS,7'R,8'aS,9'aR)-1'-hydroxy-1',4,4,8',8',11'-hexamethyl-2',3',8'a,9,9',10- hexahydrospiro[4H,8H-[1,4]dioxepino[2,3-g]indole-8,7'(8'H)-[5H,6H- 5a,9a](iminomethano)[1H]cyclopenta[f]indolizin]-10'-one | |
|
(1S,6R,7R,9S,11R)-6-hydroxy-4',4',6,10,10,13-hexamethyl-9',10'-dihydro-4'H- spiro[3,13-diazatetracyclo[5.5.2.01,9.03,7]tetradecane-11,8'-[1,4]dioxepino[2,3-g]indol]- 14-one | |
|
- | |
|
- | |
|
Liquid | |
|
Formulations |
|
|
|
|
|
||||||
---|---|---|---|---|---|---|---|---|---|---|
|
Startect Oral Solution | Zoetis UK Ltd | GB National authorisation | Prescription only medicine to be authorised by suitably qualified person (POM-VPS) | ||||||
|
Usually formulated as an oral solution |
|
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
9.12 X 1002 | Calculated | - | |||||||
|
2.96 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
1.34 | Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Low risk | Q3 Q = Miscellaneous data from online sources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||||||||||||||||||||
|
- | - |
Known metabolites |
None
|
Terrestrial ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
500 | E4 E = Manufacturers safety data sheets Rat as minimum symptomatic dose4 = Verified data |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Aquatic ecotoxicology |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
57.7 | E4 E = Manufacturers safety data sheets Oncorhynchus mykiss4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
21.17 | E4 E = Manufacturers safety data sheets Daphnia magna4 = Verified data |
Moderate | ||||||||
|
0.044 | E4 E = Manufacturers safety data sheets Daphnia magna4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
47.1 | E4 E = Manufacturers safety data sheets Pseudokirchneriella subcapitata4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||
|
500 | E4 E = Manufacturers safety data sheets Rat as minimum symptomatic dose4 = Verified data |
Moderate | ||||||||
|
2000 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
- | ||||||||
|
2.4 | E4 E = Manufacturers safety data sheets Rat as minimum symptomatic dose4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
0.001 | A5 A = EU regulatory and evaluation data as published by EC, EFSA (RAR, DAR & Conclusion dossiers), EMA (e.g. EU Annex III PIC DGD) (EU - Pesticides database; EFSA Scientific Publications ) Dog SF=1005 = Verified data used for regulatory purposes |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
[Pfizer OEL TWA-8 Hr: 10 ug/m3] | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
Extensively metabolised and the majority of the administered dose is eliminated in the faeces, much less in the urine. | A5 A = EU regulatory and evaluation data as published by EC, EFSA (RAR, DAR & Conclusion dossiers), EMA (e.g. EU Annex III PIC DGD) (EU - Pesticides database; EFSA Scientific Publications ) 5 = Verified data used for regulatory purposes |
- |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Possible liver, kidney and thyroid toxicant Clastogenic in vitro |
Handling issues |
|
|
|||
---|---|---|---|---|
|
IMDG Transport Hazard Class 6.1 | |||
|
- | |||
|
Not listed (Not listed) | |||
|
UN2902 | |||
|
Packaging Group III (minor danger) | |||
|
- |
|
|
|
||
---|---|---|---|
|
derquantel | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 14/01/2024 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |