Butoxycarboxim (Ref: Co 859) |
![]() Last updated: 03/01/2021 |
![]() |
(Not known by any other names) |
|
![]() |
|
An oxime carbamate insecticide used to control sucking insects | |
---|---|---|
|
Aphids; Thrips; Spidermites | |
|
Ornamentals | |
|
- | |
|
Unknown | |
|
circa 1975 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Cambodia |
---|
Chemical structure |
|
A chiral molecule, butoxycarboxin contains the (E)- and (Z)- isomers in a ratio of approximately 85:15. | |
---|---|---|
|
C₇H₁₄N₂O₄S | |
|
CC(C(=NOC(=O)NC)C)S(=O)(=O)C | |
|
CC(/C(=N/OC(=O)NC)/C)S(=O)(=O)C | |
|
CTJBHIROCMPUKL-UHFFFAOYSA-N | |
|
InChI=1S/C7H14N2O4S/c1-5(6(2)14(4,11)12)9-13-7(10)8-3/h6H,1-4H3,(H,8,10)/b9-5+ | |
|
Yes |
General status |
|
Insecticide, Acaricide | |
---|---|---|
|
Carbamate | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic with contact and stomach action. Acetylcholine esterase inhibitor. | |
|
34681-23-7 | |
|
252-140-9 | |
|
8040 | |
|
113001 | |
|
9571009 | |
|
222.26 | |
|
(5E)-6,7-dimethyl-8,8-dioxo-4-oxa-8?6-thia-2,5-diazanon-5-en-3-one | |
|
(EZ)-3-mesylbutanone O-methylcarbamoyloxime | |
|
3-(methylsulfonyl)-2-butanone O-[(methylamino)carbonyl]oxime | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
1A | |
|
Not applicable | |
|
None identified | |
|
Colourless crystals |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
- | |||
|
Available in ready-to-use formulations |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
209000 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
186000 | L3 L = Pesticide manuals and hard copy reference books / other sources Chloroform3 = Unverified data of known source |
- | ||||||||
172000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | |||||||||
29000 | L3 L = Pesticide manuals and hard copy reference books / other sources Toluene3 = Unverified data of known source |
- | |||||||||
100 | L3 L = Pesticide manuals and hard copy reference books / other sources Heptane3 = Unverified data of known source |
- | |||||||||
|
87 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
Decomposes before boiling | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
100 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
Not expected to self ignite; Not highly flammable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
|
1.55 X 10-01 | Calculated | - | |||||||
|
-0.81 | R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Low | ||||||||
|
1.21 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.266 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
2.83 X 10-07 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
42 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
DT₅₀ 41-44 days at 20 °C | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable | |||||||
|
Stable to UV light | ||||||||||
|
|
18 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
pH sensitive: DT₅₀ 510 days at pH 5, 16 days at pH 9 | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | CA2 CA = Medical and toxicological databases and information systems e.g. TOXNET (click here ) 2 = Unverified data of unknown source |
Very mobile | |||||||
|
10 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
4.87 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
2.58 X 1000 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Very mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
458 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | |||||||
|
300 | - | |||||||||
|
- | - | - | ||||||||
|
367 | L2 L = Pesticide manuals and hard copy reference books / other sources Gallus gallus2 = Unverified data of unknown source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
170 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
0.5 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
458 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
Occupational exposure may occur through inhalation and dermal contact | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Highly toxic |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Not classified: Obsolete | |||
|
Xn - Harmful: R22 | |||
|
None allocated at this time | |||
|
Ib (Highly hazardous / Highly hazardous) | |||
|
2992 | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
butoxycarboxim | ||
|
butoxycarboxime | ||
|
Butoxycarboxim | ||
|
butoxycarboxim | ||
|
butossicarboxim | ||
|
butoxicarboxim | ||
|
- | ||
|
butoksykarboksym | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 03/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |