Orysastrobin |
![]() Last updated: 27/11/2019 |
![]() |
(Not known by any other names) |
SUMMARY |
Orysastrobin is a rice fungicide without EU regulatory approval for use. It has a moderate aqueous solubility, is volatile and, based on its chemical properties, is mobile and can be expected to leach to groundwater. It is generally moderately persistent in soil systems but will not usually persist in aquatic systems under certain conditions. It is not generally susceptible to hydrolysis. It has a moderate mammalian toxicity and has a high potential to bioaccumulate. It is moderately toxic to most aquatic species, birds and earthworms but relatively non-toxic to honey bees. |
|
![]() |
|
A rice fungicide that is highly effective against rice blast and other fungal pathogens. | |
---|---|---|
|
Magnaporthe oryzae; Pyricularia oryzae; Thanatephorus cucumeris; Rhizoctonia solani | |
|
Rice | |
|
- | |
|
Current | |
|
2006 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Japan, South Korea |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₈H₂₅N₅O₅ | |
|
CC(=NOC)C(=NOC)C(=NOCC1=CC=CC=C1C(=NOC)C(=O)NC)C | |
|
C/C(=N\OC)/C(=N\OC)/C(=N/OCC1=CC=CC=C1/C(=N\OC)/C(=O)NC)/C | |
|
JHIPUJPTQJYEQK-ZLHHXESBSA-N | |
|
InChI=1S/C18H25N5O5/c1-12(20-25-4)16(22-26-5)13(2)21-28-11-14-9-7-8-10-15(14)17(23-27-6)18(24)19-3/h7-10H,11H2,1-6H3,(H,19,24)/b20-12+,21-13+,22-16+,23-17+/f/h19H | |
|
Yes |
General status |
|
Fungicide | |
---|---|---|
|
Strobilurin | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic, broad spectrum with protective and curative properties. Interferes with the respiration process. Respiration inhibitor (QoL fungicide). | |
|
248593-16-0 | |
|
- | |
|
None allocated | |
|
- | |
|
11486133 | |
|
391.43 | |
|
(2E)-2-(methoxyimino)-2-{2-[(3E,5E,6E)-5-(methoxyimino)-4,6-dimethyl-2,8-dioxa-3,7-diazanona-3,6-dien-1-yl]phenyl}-N-methylacetamide | |
|
(2E)-2-(methoxyimino)-2-{2-[(3E,5E,6E)-5-(methoxyimino)-4,6-dimethyl-2,8-dioxa-3,7-diazanona-3,6-dien-1-yl]phenyl}-N-methylacetamide | |
|
(αE)-α-(methoxyimino)-2-[(3E,5E,6E)-5-(methoxyimino)-4,6-dimethyl-2,8-dioxa-3,7-diaza-3,6-nonadienyl]-N-methylbenzeneacetamide | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
11 | |
|
- | |
|
- |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
80.6 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderate | ||||||||
|
206000 | R4 R = Peer reviewed scientific publications Ethyl acetate4 = Verified data |
- | ||||||||
590 | R4 R = Peer reviewed scientific publications n-Heptane4 = Verified data |
- | |||||||||
125000 | R4 R = Peer reviewed scientific publications Toluene4 = Verified data |
- | |||||||||
33900 | R4 R = Peer reviewed scientific publications Propanol4 = Verified data |
- | |||||||||
|
99 | R4 R = Peer reviewed scientific publications 4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
2.29 X 1002 | Calculated | - | |||||||
|
2.36 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
7.0 X 10-04 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
55 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
55 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Manufacturers published information gives DT₅₀ 51-58 days for field studies | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
0.8 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Fast | |||||||
|
- | ||||||||||
|
|
365 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Very persistent | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately mobile | |||||||
|
92 | ||||||||||
|
Manufacturers published information gives Koc range 17.9-146 mL g⁻¹ | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.54 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
6.25 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Moderately mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
> 356 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 2000 | R4 R = Peer reviewed scientific publications Colinus virginianus4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.89 | R4 R = Peer reviewed scientific publications Oncorhynchus mykiss4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
1.3 | R4 R = Peer reviewed scientific publications Daphnia magna4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
7.1 | R4 R = Peer reviewed scientific publications Pseudokirchneriella subcapitata4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
142 | R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
1000 | R4 R = Peer reviewed scientific publications Eisenia foetida4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 356 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
Moderate | ||||||||
|
2000 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
- | ||||||||
|
2.02 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
100 | R3 R = Peer reviewed scientific publications Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Toxic by inhalation |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302, H332, H351 Environment: H410 |
|||
|
Carcinogen category 3: R40 Xn - Harmful: R20/22 N - Dangerous for the environment: R50/53 |
|||
|
S22, S36/37, S46, S61 | |||
|
NL (Not listed) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
orysastrobin | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
orysastrobina | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 27/11/2019 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |