Pyribenzoxim (Ref: LGC 40863 ) |
![]() Last updated: 27/11/2019 |
![]() |
(Also known as: pyanchor) |
SUMMARY |
Pyribenzoxim is a post-emergence herbicide without EU regulatory approval for use. It has a low aqueous solubility and is volatile. Whilst data is sparse it indicates that the chemical is not persistent in soil systems. It has a low mammalian toxicity and is a recognised irritant. It is moderately toxic to birds, fish and honey bees. |
|
![]() |
|
Used post-emergence to control grasses and polygonums in rice and other crops | |
---|---|---|
|
Barnyard grass; Blackgrass; Knotweed | |
|
Rice; Wheat | |
|
- | |
|
Unknown | |
|
1997, Korea |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₃₂H₂₇N₅O₈ | |
|
COC1=CC(=NC(=N1)OC2=C(C(=CC=C2)OC3=NC(=CC(=N3)OC)OC)C(=O)ON=C(C4=CC=CC=C4)C5=CC=CC=C5)OC | |
|
No data | |
|
OVXMBIVWNJDDSM-UHFFFAOYSA-N | |
|
InChI=1S/C32H27N5O8/c1-39-24-18-25(40-2)34-31(33-24)43-22-16-11-17-23(44-32-35-26(41-3)19-27(36-32)42-4)28(22)30(38)45-37-29(20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-19H,1-4H3 | |
|
Yes |
General status |
|
Herbicide | |
---|---|---|
|
Unclassified | |
|
- | |
|
- | |
|
Synthetic | |
|
Broad spectrum, inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS. | |
|
168088-61-7 | |
|
- | |
|
None allocated | |
|
- | |
|
178117 | |
|
609.59 | |
|
N-({2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoyl}oxy)-1,1-diphenylmethanimine | |
|
benzophenone O-[2,6-bis(4,6-dimethoxypyrimidin-2-yloxy)benzoyl]oxime | |
|
diphenylmethanone O-(2,6-bis((4,6-dimethoxy-2-pyrimidinyl)oxy)benzoyl)oxime | |
|
- | |
|
- | |
|
B | |
|
2 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
White to pale yellow coloured solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as an emulsifiable concentrate |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
3.5 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
129 | R4 R = Peer reviewed scientific publications 4 = Verified data |
- | ||||||||
|
811 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
444 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- | ||||||||
|
|
1.10 X 1003 | Calculated | - | |||||||
|
3.04 | R4 R = Peer reviewed scientific publications 4 = Verified data |
High | ||||||||
|
1.3 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.99 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
7 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
5.1 | R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- | |||||||
|
Rice whole pant matrix, n=1 | ||||||||||
|
|
9.2 | R4 R = Peer reviewed scientific publications (distilled water)4 = Verified data |
Moderately fast | |||||||
|
- | ||||||||||
|
|
26.9 | R4 R = Peer reviewed scientific publications (de-aerated distilled water)4 = Verified data |
Non-persistent | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
9979 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-mobile | |||||||
|
534500 | ||||||||||
|
- | ||||||||||
|
Literature data: Kf range 2100 (clay) - 20654 (silt loam) mL g⁻¹, Kfoc values range 85700 (clay) - 2470000 (silt loam) mL g⁻¹ | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
-1.46 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
5.35 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
> 5000 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 100 | R3 R = Peer reviewed scientific publications Orizias ¡atipes3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
> 100 | R4 R = Peer reviewed scientific publications Daphnia magna4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
100 | R3 R = Peer reviewed scientific publications Unknown species3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
> 100 | L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Low | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 5000 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
Low | ||||||||
|
2000 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Harmful via inhalation, ingestion and in contact with skin |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
- | |||
|
Xn - Harmful: R20/21/22 Xi - Irritant: R36/37/38 |
|||
|
S26, S36, S37/39 | |||
|
NL (Not listed) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
pyribenzoxim | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
pirybenzoksym | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 27/11/2019 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |