Indanofan (Ref: MK 243) |
![]() Last updated: 04/01/2021 |
![]() |
(Also known as: NH-502; MX 70906) |
|
![]() |
|
Used to control a variety of grass weeds and some monocotyledonous and dicotyledonous weeds in rice and a few other crops | |
---|---|---|
|
Monocotyledonous and dicotyledonous weeds, Grasses including Echinochloa oryzicola | |
|
Rice; Turf, Cereals | |
|
- | |
|
Unknown | |
|
1999 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Singapore |
---|
Chemical structure |
|
A chiral molecule. The technical material is an isomeric mixture of the S- and R-forms. It is the S-enantiomer that exhibits the strongest herbicidal activity. | |
---|---|---|
|
C₂₀H₁₇ClO₃ | |
|
CCC1(C(=O)C2=CC=CC=C2C1=O)CC3(CO3)C4=CC(=CC=C4)Cl | |
|
No data | |
|
PMAAYIYCDXGUAP-UHFFFAOYSA-N | |
|
InChI=1S/C20H17ClO3/c1-2-19(17(22)15-8-3-4-9-16(15)18(19)23)11-20(12-24-20)13-6-5-7-14(21)10-13/h3-10H,2,11-12H2,1H3 | |
|
Yes |
General status |
|
Herbicide | |
---|---|---|
|
Unclassified | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, systemic, acts by the inhibition of very long chain fatty acid biosynthesis | |
|
133220-30-1 | |
|
- | |
|
None allocated | |
|
- | |
|
11046097 | |
|
340.80 | |
|
rac-2-{[(2R)-2-(3-chlorophenyl)oxiran-2-yl]methyl}-2-ethyl-1H-indene-1,3(2H)-dione | |
|
(RS)-2-[2-(3-chlorophenyl)-2,3-epoxypropyl]-2-ethylindan-1,3-dione | |
|
2-[[2-(3-chlorophenyl)oxiranyl]methyl]-2-ethyl-1H-indene-1,3(2H)-dione | |
|
- | |
|
- | |
|
K3 | |
|
15 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Colourless cyrstals |
Formulations |
|
|
|||
---|---|---|---|---|
|
- | |||
|
|
|||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
17.1 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
10800 | L3 L = Pesticide manuals and hard copy reference books / other sources Hexane3 = Unverified data of known source |
- | ||||||||
120000 | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | |||||||||
500000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | |||||||||
500000 | L3 L = Pesticide manuals and hard copy reference books / other sources Ethyl acetate3 = Unverified data of known source |
- | |||||||||
|
60.6 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
3.89 X 1003 | Calculated | - | |||||||
|
3.59 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
1.24 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.028 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
5.6 X 10-05 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
2 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
9 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature quote DT₅₀ 1-3 days in paddy field soil and 1-17 days in upland soil | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Non-mobile | |||||||
|
9511 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
0.02 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
5.22 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Non-mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
460 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus virginianus3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
5.0 | L3 L = Pesticide manuals and hard copy reference books / other sources Cyprinus carpio3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
7.90 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
0.00152 | L3 L = Pesticide manuals and hard copy reference books / other sources Pseudokirchneriella subcapitata3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
|
100 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
460 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
> 1.57 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.0035 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302, H317, H320, H335, H361, H370, H372, H373 | |||
|
Xn - Harmful: R20, R22 Xi - Irritant: R36,/38 |
|||
|
S36, S37 | |||
|
NL (Not listed) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
indanofan | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
indanofan | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 04/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |