Prodiamine (Ref: SAN 745H) |
![]() Last updated: 02/03/2021 |
![]() |
(Also known as: BRN 2181386; USB 3153) |
|
![]() |
|
Used to control annual grasses and broad-leaved weeds in non-food crops | |
---|---|---|
|
Annual grasses including bermuda grass, buffalo grass, fine fescue; creeping bentgrass, barnyard grass; Borad-leaved weeds including chickweed, carpet weed, knotweed, purslane, shepherd's purse | |
|
Turf; Ornamentals; Nursery stock; Lanscaped areas; Non-cropped areas | |
|
- | |
|
Unknown | |
|
1987 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₃H₁₇F₃N₄O₄ | |
|
CCCN(CCC)C1=C(C=C(C(=C1[N+](=O)[O-])N)C(F)(F)F)[N+](=O)[O-] | |
|
No data | |
|
RSVPPPHXAASNOL-UHFFFAOYSA-N | |
|
InChI=1S/C13H17F3N4O4/c1-3-5-18(6-4-2)11-9(19(21)22)7-8(13(14,15)16)10(17)12(11)20(23)24/h7H,3-6,17H2,1-2H3 | |
|
Yes |
General status |
|
Herbicide | |
---|---|---|
|
Dinitroaniline | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, acts via inhibition of microtubule formation, disrupting cell division and so growth | |
|
29091-21-2 | |
|
249-421-3 | |
|
None allocated | |
|
110201 | |
|
34469 | |
|
350.29 | |
|
2,6-dinitro-N1,N1-dipropyl-4-(trifluoromethyl)benzene-1,3-diamine | |
|
5-dipropylamino-α,α,α-trifluoro-4,6-dinitro-o-toluidine | |
|
2,4-dinitro-N3,N3-dipropyl-6-(trifluoromethyl)-1,3-benzenediamine | |
|
Marine pollutant | |
|
- | |
|
K1 | |
|
3 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Yellow powder | |
|
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as water dispersible granule and flowable concentrates |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
0.013 | F3 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) 3 = Unverified data of known source |
Low | ||||||||
|
226000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | ||||||||
74000 | L3 L = Pesticide manuals and hard copy reference books / other sources Benzene3 = Unverified data of known source |
- | |||||||||
7000 | L3 L = Pesticide manuals and hard copy reference books / other sources Ethanol3 = Unverified data of known source |
- | |||||||||
35400 | L3 L = Pesticide manuals and hard copy reference books / other sources Xylene3 = Unverified data of known source |
- | |||||||||
|
123 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
Decomposes before boiling | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
240 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
Not expected to self ignite; Not highly flammable | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
|
|
1.26 X 1004 | Calculated | - | |||||||
|
4.10 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
1.41 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
11.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
Very weak acid | |||||||||||
|
0.0033 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
8.89 X 10-02 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
120 | F3 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) 3 = Unverified data of known source |
Persistent | |||||||
|
- | - | - | ||||||||
|
69 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature DT₅₀ range 60-80 days; US sources: DT₅₀ 120 days (US3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
4.6 | R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- | |||||||
|
Tall fescue grass, n=1 | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Non-mobile | |||||||
|
12710 | ||||||||||
|
General literature Koc range 19540 (sand), 12860 (sandy loam), 5440 (loam) mL g⁻¹; US sources: 13000 mL g⁻¹ (US3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
-0.19 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
5.35 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW | ||||||||||||||||||||||||||||
|
High | Calculated | - | ||||||||||||||||||||||||||
|
Non-mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
> 5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
|
6.0 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
High | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 2250 | L3 L = Pesticide manuals and hard copy reference books / other sources Coturnix japonica3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.829 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
Moderate | ||||||||
|
0.012 | P3 P = Other governments and regulators Oncorhynchus mykiss growth3 = Unverified data of known source |
Moderate | ||||||||
|
0.658 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
0.023 | P3 P = Other governments and regulators Daphnia magna growth3 = Unverified data of known source |
Moderate | ||||||||
|
2.1 | F3 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) Americamysis bahia3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
0.003 | L2 L = Pesticide manuals and hard copy reference books / other sources Unknown species2 = Unverified data of unknown source |
High | ||||||||
|
- | - | - | ||||||||
|
|
> 100 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
> 1000 | R4 R = Peer reviewed scientific publications Eisenia foetida>4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
0.00026 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List II | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Possible liver and thyroid toxicant; USEPA - probable human carcinogen |
Handling issues |
|
|
|||
---|---|---|---|---|
|
IMDG transport code 9 | |||
|
- | |||
|
Xi - Irritant: R36/38 | |||
|
- | |||
|
U (Unlikely to present an acute hazard) | |||
|
3077 | |||
|
Packaging Group III (minor danger) |
|
![]() |
|
|
||
---|---|---|---|
|
prodiamine | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
prodiamina | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 02/03/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |