Thifluzamide (Ref: MON 24000) |
![]() Last updated: 25/05/2018 |
![]() |
(Also known as: RH 130753; RH 0753) |
|
![]() |
|
A carboximide systemic fungicide used for rice and other crops | |
---|---|---|
|
Basidomycetes spp.; Sheath blight; Limb rot; Blacl scurf | |
|
Rice; Potatoes; Maize; Peanuts; Cotton; Coffee | |
|
- | |
|
Current | |
|
1997 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Brazil, Mexico, Colombia, Venezuela, Japan, Korea, China, Vietnam |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₃H₆Br₂F₆N₂O₂S | |
|
CC1=NC(=C(S1)C(=O)NC2=C(C=C(C=C2Br)OC(F)(F)F)Br)C(F)(F)F | |
|
No data | |
|
WOSNCVAPUOFXEH-UHFFFAOYSA-N | |
|
InChI=1S/C13H6Br2F6N2O2S/c1-4-22-10(12(16,17)18)9(26-4)11(24)23-8-6(14)2-5(3-7(8)15)25-13(19,20)21/h2-3H,1H3,(H,23,24) | |
|
Yes |
General status |
|
Fungicide | |
---|---|---|
|
Carboxamide | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic, absorbed by roots and translocated, inhibits succinate dehydrogenase in the tricarboxylic acid cycle | |
|
130000-40-7 | |
|
- | |
|
None allocated | |
|
- | |
|
86389 | |
|
528.06 | |
|
N-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide | |
|
2',6'-dibromo-2-methyl-4'-trifluoromethoxy-4-trifluoromethyl-1,3-thiazole-5-carboxanilide | |
|
N-(2,6-dibromo-4-(trifluoromethoxy)phenyl)-2-methyl-4-(trifluoromethyl)-5-thiazolecarboxamide | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
7 | |
|
- | |
|
Off-white powder |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
7.6 | E4 E = Manufacturers safety data sheets 4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
178 | E4 E = Manufacturers safety data sheets 4 = Verified data |
- | ||||||||
|
Decomposes before boiling | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
177 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
|
1.45 X 1004 | Calculated | - | |||||||
|
4.16 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
2.0 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
11.0 | E4 E = Manufacturers safety data sheets 4 = Verified data |
- | ||||||||
Very weak acid | |||||||||||
|
1.01 X 10-06 | E4 E = Manufacturers safety data sheets 4 = Verified data |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
1145 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Very persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature DT₅₀ range 992-1298 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
10.2 | R4 R = Peer reviewed scientific publications 4 = Verified data |
- | |||||||
|
Published literature RL₅₀ range 9.1-11.3 days, seedlings & grains of rice, n=2 | ||||||||||
|
|
3.7 | E4 E = Manufacturers safety data sheets 4 = Verified data |
Moderately fast | |||||||
|
- | ||||||||||
|
|
Stable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | E4 E = Manufacturers safety data sheets 4 = Verified data |
Slightly mobile | |||||||
|
734 | ||||||||||
|
Manufacturers published Koc 472-996 mL g⁻¹ (E4) General literature koc range 400-1000 mL g⁻¹ (L3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.47 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
6.59 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Slightly mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
> 6500 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
Low | ||||||||
|
|
1.4 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
High | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
2250 | E4 E = Manufacturers safety data sheets Colinus virginianus4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
1.3 | E4 E = Manufacturers safety data sheets Lepomis macrochirus4 = Verified data |
Moderate | ||||||||
|
0.31 | E4 E = Manufacturers safety data sheets Oncorhynchus mykiss4 = Verified data |
Moderate | ||||||||
|
1.4 | E4 E = Manufacturers safety data sheets Daphnia magna4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
1.3 | L3 L = Pesticide manuals and hard copy reference books / other sources Pseudokirchneriella subcapitata3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
> 100 | E4 E = Manufacturers safety data sheets 4 = Verified data |
Low | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
> 1250 | E4 E = Manufacturers safety data sheets Eisenia foetida4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 6500 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
Low | ||||||||
|
5000 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
- | ||||||||
|
5.0 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
0.014 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List II | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
Not compatible with oxidising agents | |||
|
- | |||
|
Xi - Irritant: R36/37/38 | |||
|
S26, S36 | |||
|
U (Unlikely to present an acute hazard) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
thifluzamide | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
tifluzamid | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 25/05/2018 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |