Flumorph (Ref: SYP L190) |
![]() Last updated: 04/03/2020 |
![]() |
(Also known as: MIKE; flumorf; CC5-NDYC) |
|
![]() |
|
Used mainly to control Oomcyetes in a variety of cropping situations | |
---|---|---|
|
Oomcyetes especially Peronosppraceae and |
|
|
Vines; Potatoes; Vegetables | |
|
- | |
|
Obsolete | |
|
circa 2002 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
China |
---|
Chemical structure |
|
Isomeric | |
---|---|---|
|
C₂₁H₂₂FNO₄ | |
|
COC1=C(C=C(C=C1)C(=CC(=O)N2CCOCC2)C3=CC=C(C=C3)F)OC | |
|
COC1=C(C=C(C=C1)/C(=C/C(=O)N2CCOCC2)/C3=CC=C(C=C3)F)OC | |
|
BKBSMMUEEAWFRX-UHFFFAOYSA-N | |
|
InChI=1S/C21H22FNO4/c1-25-19-8-5-16(13-20(19)26-2)18(15-3-6-17(22)7-4-15)14-21(24)23-9-11-27-12-10-23/h3-8,13-14H,9-12H2,1-2H3 | |
|
Yes |
|
![]() |
Common Name | Relationship | Link |
---|---|---|
flumorph | - | ![]() |
General status |
|
Fungicide | |
---|---|---|
|
Morpholine | |
|
>99.5% | |
|
- | |
|
Synthetic | |
|
Systemic, displays protectant, curative and antisporulant activity, though to disturb the polar deposition of newly synthesized cell wall material | |
|
211867-47-9 | |
|
- | |
|
None allocated | |
|
- | |
|
11057755 | |
|
371.40 | |
|
(2E)-3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-(morpholin-4-yl)prop-2-en-1-one | |
|
(EZ)-4-[3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)acryloyl]morpholine | |
|
4-[3-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)-1-oxo-2-propenyl]morpholine | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
40 | |
|
- | |
|
Colourless crystalline solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
- | |||
|
- | |||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
107.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
556 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
Not expected to self ignite; Not highly flammable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
|
1.58 X 1002 | Calculated | - | |||||||
|
2.2 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
1.21 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Stable | |||||||
|
- | ||||||||||
|
|
Stable | L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Stable | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Slightly mobile | |||||||
|
1299 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
2710 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
|
16.65 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
High | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Coturnix japonica3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
45.12 | L3 L = Pesticide manuals and hard copy reference books / other sources Cyprinus carpio3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
170 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
2710 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
2150 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List II | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
- | |||
|
Reproduction risk category 2: R61 Xn - Harmful: R20/22 Xi - Irritant: R38 N - Dangerous for the environment: R50, R53 |
|||
|
- | |||
|
III (Slightly hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
flumorph | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
flumorf | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 04/03/2020 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |