Methasulfocarb (Ref: NK 191) |
![]() Last updated: 25/05/2018 |
![]() |
(Not known by any other names) |
|
![]() |
|
Soil applied and used to control a range of fungal diseases in rice crops | |
---|---|---|
|
Fusarium, Mucor, Pseudomonas, Pythium and Rhizoctonia spp. | |
|
Rice | |
|
- | |
|
Unknown | |
|
1984, Japan |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₉H₁₁NO₄S₂ | |
|
CNC(=O)SC1=CC=C(C=C1)OS(=O)(=O)C | |
|
No data | |
|
IXJOSTZEBSTPAG-UHFFFAOYSA-N | |
|
InChI=1S/C9H11NO4S2/c1-10-9(11)15-8-5-3-7(4-6-8)14-16(2,12)13/h3-6H,1-2H3,(H,10,11) | |
|
Yes |
General status |
|
Fungicide, Plant growth regulator | |
---|---|---|
|
Thiocarbamate | |
|
- | |
|
- | |
|
Synthetic | |
|
Growth retarding activity | |
|
66952-49-6 | |
|
- | |
|
None allocated | |
|
- | |
|
93362 | |
|
261.32 | |
|
S-[4-(methanesulfonyloxy)phenyl] methylcarbamothioate | |
|
S-4-(mesyloxy)phenyl methyl(thiocarbamate) | |
|
S-[4-[(methylsulfonyl)oxy]phenyl] methylcarbamothioate | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
42 | |
|
- | |
|
Colourless crystalline solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
480 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
138 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
Decomposes before boiling | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
4.79 X 1001 | Calculated | - | |||||||
|
1.68 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
Low | ||||||||
|
1.42 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Stable | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Moderately mobile | |||||||
|
96 | ||||||||||
|
Estimated | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
112 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
1.95 | L3 L = Pesticide manuals and hard copy reference books / other sources Cyprinus carpio3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
112 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
> 0.44 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
IMDG Transport Code is 6.1 | |||
|
- | |||
|
- | |||
|
- | |||
|
II (Moderately hazardous) | |||
|
2771 | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
methasulfocarb | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 25/05/2018 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |