Chlorbenside (Ref: ENT 20696) |

Last updated: 10/09/2023
|
 |
(Also known as: chloracid; chlorbenxide; chlorparaside; HRS 860; RD 2195; chlorbenzide; chlosulphacide) |
Chlorbenside is an obsolete organochlorine insecticide. It has a low aqueous solubility and is non-volatile. Little data is available regarding its environmental fate or ecotoxicology. Chlorbenside has a low mammalian oral toxicity. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
An obsolete compound that was used particularly to control mites |
|
Eggs and larvae of red spidermites and two-spotted spidermites; Ticks |
|
Fruit trees; Ornamentals; Nursery stock |
|
- |
|
Considered obsolete but may be available in some countries |
|
1953, first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₁₃H₁₀Cl₂S |
|
C1=CC(=CC=C1CSC2=CC=C(C=C2)Cl)Cl |
|
- |
|
ZHLKXBJTJHRTTE-UHFFFAOYSA-N |
|
InChI=1S/C13H10Cl2S/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-8H,9H2 |
|
Yes |
|
Acaricide, Miticide, Insecticide |
|
Organochloride insecticide; Bridged diphenyl insecticide; Organosulphur compound |
|
- |
|
- |
|
Synthetic |
|
Undetermined but has ovicidal and larvicidal properties |
|
103-17-3 |
|
203-084-9 |
|
32 |
|
017401 |
|
7639 |
|
No data found |
|
269.19 |
|
1-chloro-4-{[(4-chlorophenyl)methyl]sulfanyl}benzene |
|
4-chlorobenzyl 4-chlorophenyl sulfide |
|
1-chloro-4-[[(4-chlorophenyl)methyl]thio]benzene |
|
Phytotoxic to cucumbers and other cucurbits |
|
- |
|
Not applicable |
|
Not applicable |
|
2A |
|
Not applicable |
|
Panonychus ulmi, Tetranychus kanzawai, Tetranychus urticae |
|
White crystalline solid |
|
|
|
|
|
- Mitox
- Acacide
- Chlorocide
- Chlorparacide
|
|
Supplied as a wettable powder or emulsifiable concentrate |
|
|
|
|
|
0.2 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Low |
|
2900 |
Ethanol |
- |
70000 |
Kerosene |
- |
|
75 |
|
- |
|
83.5 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
3.89 X 1005 |
Calculated |
- |
|
5.59 |
|
High |
|
|
Soluble |
|
- |
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
1.42 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
1.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
Q1 Q = Miscellaneous data from online sources 1 = Estimated data with little or no verification |
Non-mobile |
|
21051 |
|
Estimated |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
Non-toxic |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Non-toxic |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 2000 |
Rat |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
List I; List II |
- |
- |
|
|
- |
|
May be absorbed through the gut and skin |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
?Possibly, status not identified |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Hazardous to the digestive tract Liver and kidney toxicant |
|
|
|
Incompatible with oxidising agents Not expected to auto-ignite; Not highly flammable |
|
Health: H302 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
- |
|
- |
|
- |
|
|
|
chlorbenside |
|
chlorbenside |
|
Chlorbensid |
|
- |
|
- |
|
clorbenside |
|
- |
|
chlorobenzyd |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
10/09/2023 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |