Ethiprole (Ref: RPA 107382) |
![]() Last updated: 05/01/2021 |
![]() |
(Not known by any other names) |
|
![]() |
|
Used to control chewing and sucking insects in rice, fruit and vegetable crops | |
---|---|---|
|
Thrips, Aphids, Leaf miners | |
|
Rice; Fruit; Vegetable crops; Cotton | |
|
- | |
|
Unknown | |
|
1994, discovered |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
Ethiprole is a chiral molecule. The technical material is an isomeric mixture of the S- and R-enantiomers | |
---|---|---|
|
C₁₃H₉Cl₂F₃N₄OS | |
|
CCS(=O)C1=C(N(N=C1C#N)C2=C(C=C(C=C2Cl)C(F)(F)F)Cl)N | |
|
No data | |
|
FNELVJVBIYMIMC-UHFFFAOYSA-N | |
|
InChI=1S/C13H9Cl2F3N4OS/c1-2-24(23)11-9(5-19)21-22(12(11)20)10-7(14)3-6(4-8(10)15)13(16,17)18/h3-4H,2,20H2,1H3 | |
|
Yes |
General status |
|
Insecticide | |
---|---|---|
|
Phenylpyrazole | |
|
- | |
|
- | |
|
Synthetic | |
|
Acts as a blocker to the GABA-regulated chloride channel | |
|
181587-01-9 | |
|
- | |
|
None allocated | |
|
005550 | |
|
9930667 | |
|
397.20 | |
|
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(ethanesulfinyl)-1H-pyrazole-3-carbonitrile | |
|
5-amino-1-(2,6-dichloro-α,α,α-trifluoro-p-tolyl)-4-ethylsulfinylpyrazole-3-carbonitrile | |
|
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(ethylsulfinyl)-1H-pyrazole-3-carbonitrile | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
2B | |
|
Not applicable | |
|
None identified | |
|
- |
Formulations |
|
|
|||
---|---|---|---|---|
|
- | |||
|
|
|||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
9.77 X 1001 | Calculated | - | |||||||
|
1.99 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Low | ||||||||
|
1.69 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
50 | P3 P = Other governments and regulators 3 = Unverified data of known source |
Moderately persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Data for flooded soils: DT₅₀ 5 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
1.3 | P3 P = Other governments and regulators 3 = Unverified data of known source |
Moderately fast | |||||||
|
- | ||||||||||
|
|
Stable | P3 P = Other governments and regulators 3 = Unverified data of known source |
Stable | |||||||
|
Stable pH 4 to pH 7, DT₅₀ 121 days at pH 9 | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
3.7 | P3 P = Other governments and regulators 3 = Unverified data of known source |
Moderately mobile | |||||||
|
107 | ||||||||||
|
- | ||||||||||
|
Kf range 1.48-5.93 mL g⁻¹, Kfoc range 50.5 to 163 mL g⁻¹ | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.35 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
4.75 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
7080 | P3 P = Other governments and regulators Rat3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
7080 | P3 P = Other governments and regulators Rat3 = Unverified data of known source |
Low | ||||||||
|
2000 | P3 P = Other governments and regulators Rat3 = Unverified data of known source |
- | ||||||||
|
5.2 | P3 P = Other governments and regulators Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.005 | P3 P = Other governments and regulators Rabbit SF=1003 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List II | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
USEPA - some evidence to suggest possible human carcinogen |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
- | |||
|
Xn - Harmful: R22, R48 N - Dangerous for the environment: R50/53 |
|||
|
- | |||
|
NL (Not listed) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
ethiprole | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
etiprol | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 05/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |