Chloranil (Ref: ENT 3747) |

Last updated: 30/05/2024
|
 |
(Also known as: tetrachloroquinone; alpha-chloranil; p-chloranil; khloranil) |
Chloranil is an obsolete fungicide used as a seed protectant. It has a moderate aqueous solubility and is volatile. It is not persistent in soil systems. Chloranil has a low mammalian toxicity but has a high potential for bioaccumulation. It is a recognised irritant. It is highly toxic to fish but other ecotoxicological data is missing. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A now obsolete seed protectant that was formerly used to control a range of fungal diseases |
|
Downy mildew; Powdery mildew; Damping-off |
|
Vegetables including cabbage, cauliflower, broccoli; Ornamental seedlings |
|
- |
|
Considered obsolete but may be available in some countries |
|
1940, first reported |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
No |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₆Cl₄O₂ |
|
C1(=C(C(=O)C(=C(C1=O)Cl)Cl)Cl)Cl |
|
- |
|
UGNWTBMOAKPKBL-UHFFFAOYSA-N |
|
InChI=1S/C6Cl4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11 |
|
Yes |
Cambridge Crystallographic Data Centre diagrams |
|
|
Common Name |
Relationship |
Link |
chloranil |
- |
 |
|
Fungicide, Semiochemical, Other substance |
|
Bactericide |
|
Quinone fungicide |
|
- |
|
- |
|
Synthetic |
|
Broad spectrum, inhibits electron transport, photophosphorylation and CO2 fixation. |
|
118-75-2 |
|
204-274-4 |
|
243 |
|
079301 |
|
8371 |
|
602-066-00-1 |
|
245.88 |
|
2,3,5,6-tetrachlorocyclohexa-2,5-diene-1,4-dione |
|
tetrachloro-p-benzoquinone |
|
2,3,5,6-tetrachloro-2,5-cyclohexadiene-1,4-dione |
|
- |
|
- |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
Not known |
|
- |
|
Yellow to greenish crystalline powder |
|
|
|
|
|
|
|
Normally supplied as a seed treatment |
|
|
|
|
|
250 |
at 25 °C |
Moderate |
|
330000 |
Acetone |
- |
160000 |
Ether |
- |
13000 |
Benzene |
- |
1.0 |
Carbon tetrachloride |
- |
|
290 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.66 X 1002 |
Calculated |
- |
|
2.22 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.97 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
- |
|
1.0 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low volatility. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
6.67 X 10-04 |
|
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
6 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Best available data |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
- |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
> 4000 |
Rat |
Low |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
> 0.01 |
Pimephales promelas |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
> 4000 |
Rat |
Low |
|
500 |
Rat |
- |
|
2.49 |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
Can be absorbed into the body by inhalation and ingestion |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
No data found |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
Slightly toxic Liver and kidney toxicant |
|
|
|
Prevent generation of dust Releases irritating gases in a fire |
|
Health: H315, H319 Environment: H400, H410 |
|
Not classified: Obsolete (Not classified: Obsolete) |
|
- |
|
- |
|
- |
|
|
|
chloranil |
|
chloranile |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
30/05/2024 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |