Noviflumuron |
![]() Last updated: 24/02/2021 |
![]() |
(Also known as: XDE-007) |
|
![]() |
|
A novel insect growth regulator insecticide that is a structural analog of hexaflumuron and is used to control a wide range of pest management ISSUES | |
---|---|---|
|
Termites; Ants; Cockroaches; Fleas; Flies | |
|
- | |
|
- | |
|
Current | |
|
2003, USA |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
USA |
---|
Chemical structure |
|
A chiral molecule. The technical material is an isomeric mixture. | |
---|---|---|
|
C₁₇H₇Cl₂F₉N₂O₃ | |
|
C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=C(C(=C2F)Cl)OC(C(C(F)(F)F)F)(F)F)Cl)F | |
|
No data | |
|
YTYGAJLZOJPJGH-UHFFFAOYSA-N | |
|
InChI=1S/C17H7Cl2F9N2O3/c18-5-4-8(29-15(32)30-13(31)9-6(20)2-1-3-7(9)21)11(22)10(19)12(5)33-17(27,28)14(23)16(24,25)26/h1-4,14H,(H2,29,30,31,32) | |
|
Yes |
General status |
|
Insecticide | |
---|---|---|
|
Benzoylurea | |
|
- | |
|
- | |
|
Synthetic | |
|
A chitin synthesis inhibitor | |
|
121451-02-3 | |
|
- | |
|
- | |
|
118204 | |
|
9828359 | |
|
529.15 | |
|
rac-N-({3,5-dichloro-2-fluoro-4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl}carbamoyl)-2,6-difluorobenzamide | |
|
(RS)-1-[3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-(2,6-difluorobenzoyl)urea | |
|
N-[ [ [3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy) phenyl] amino] carbonyl]-2,6-difluorobenzamide | |
|
Marine pollutant | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
Not known | |
|
- | |
|
White powder |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
0.194 | E4 E = Manufacturers safety data sheets 4 = Verified data |
Low | ||||||||
|
425000 | E4 E = Manufacturers safety data sheets Acetone4 = Verified data |
- | ||||||||
290000 | E4 E = Manufacturers safety data sheets Ethyl acetate4 = Verified data |
- | |||||||||
48900 | E4 E = Manufacturers safety data sheets Methanol4 = Verified data |
- | |||||||||
68 | E4 E = Manufacturers safety data sheets Heptane4 = Verified data |
- | |||||||||
|
156.2 | E4 E = Manufacturers safety data sheets 4 = Verified data |
- | ||||||||
|
Decomposes before boiling | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
250 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
Not expected to self ignite; Not highly flammable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
|
8.71 X 1004 | Calculated | - | |||||||
|
4.94 | E4 E = Manufacturers safety data sheets 4 = Verified data |
High | ||||||||
|
1.88 | E4 E = Manufacturers safety data sheets 4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
2.2 X 10-07 | E4 E = Manufacturers safety data sheets 4 = Verified data |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
250 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
DT₅₀ in aerobic soils is 200-300 days at 25 °C | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | E4 E = Manufacturers safety data sheets 4 = Verified data |
Stable | |||||||
|
pH sensitive: Stable in acid and neutral media, DT₅₀ 19 days at pH 9 | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | F4 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) 4 = Verified data |
Non-mobile | |||||||
|
250000 | ||||||||||
|
Koc values range 32,000-470000 mL g⁻¹ | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
-3.35 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
5.35 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW | ||||||||||||||||||||||||||||
|
High | Calculated | - | ||||||||||||||||||||||||||
|
Non-mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
> 5000 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 2000 | E4 E = Manufacturers safety data sheets Colinus virginianus4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
1.8 | E4 E = Manufacturers safety data sheets Oncorhynchus mykiss4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
3.11 | E4 E = Manufacturers safety data sheets Daphnia magna4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
> 100 | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
> 10000 | E3 E = Manufacturers safety data sheets Eisenia foetida3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 5000 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
Low | ||||||||
|
5000 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
- | ||||||||
|
5.24 | E4 E = Manufacturers safety data sheets Rat4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
Low risk of exposure due to delivery system | |||||||||
|
Low risk of exposure due to delivery system | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
IMDG Transport class 9 | |||
|
- | |||
|
Xi - Irritant: R36 N - Dangerous to the environment: R50/53 |
|||
|
- | |||
|
U (Unlikely to present an acute hazard) | |||
|
3077 | |||
|
Packaging Group III (minor danger) |
|
![]() |
|
|
||
---|---|---|---|
|
noviflumuron | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 24/02/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |