Isotianil (Ref: BYF1047) |
![]() Last updated: 15/02/2021 |
![]() |
(Also known as: S-2310) |
|
![]() |
|
A novel fungicide to control rice blast | |
---|---|---|
|
Rice blast | |
|
Rice | |
|
- | |
|
Current | |
|
2007 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Japan; Korea |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₁H₅Cl₂N₃OS | |
|
C1=CC=C(C(=C1)C#N)NC(=O)C2=C(C(=NS2)Cl)Cl | |
|
No data | |
|
WLPCAERCXQSYLQ-UHFFFAOYSA-N | |
|
InChI=1S/C11H5Cl2N3OS/c12-8-9(18-16-10(8)13)11(17)15-7-4-2-1-3-6(7)5-14/h1-4H,(H,15,17)/f/h15H | |
|
Yes |
General status |
|
Fungicide | |
---|---|---|
|
Thiazole | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic Activated Resistance (SAR). Induces host plant defence. | |
|
224049-04-1 | |
|
- | |
|
- | |
|
- | |
|
9796266 | |
|
298.15 | |
|
3,4-dichloro-N-(2-cyanophenyl)-1,2-thiazole-5-carboxamide | |
|
3,4-dichloro-2'-cyano-1,2-thiazole-5-carboxanilide | |
|
3,4-dichloro-N-(2-cyanophenyl)-5-isothiazolecarboxamide | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
P3 | |
|
- | |
|
White powder |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
0.5 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
9.12 X 1002 | Calculated | - | |||||||
|
2.96 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
2.36 X 10-04 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
75.0 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent | |||||||
|
75.0 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent | ||||||||
|
7.0 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Lab DT₅₀ in aqueous soil layer 0.3-3.3 days, in soil layer 69.3-92.4 days and whole soil system 61.9-73.7 days; Field studies DT₅₀ 0.5 to 13 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
8 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately fast | |||||||
|
- | ||||||||||
|
|
60.8 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent | |||||||
|
Stable at pH 4; DT₅₀ = 71.4 days at pH 9 | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
- | R4 R = Peer reviewed scientific publications 4 = Verified data |
Slightly mobile | |||||||
|
1046 | ||||||||||
|
- | ||||||||||
|
Literature Kfoc range 497-1596 mL g⁻¹ | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
0.83 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
7.75 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
High | Calculated | - | ||||||||||||||||||||||||||
|
Slightly mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
> 2000 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 2250 | R4 R = Peer reviewed scientific publications Colinus virginianus4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 1.0 | R4 R = Peer reviewed scientific publications Cyprinus carpio4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
> 1.0 | R4 R = Peer reviewed scientific publications Daphnia magna4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 1.0 | R4 R = Peer reviewed scientific publications Pseudokirchneriella subcapitata4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 2000 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
Low | ||||||||
|
2000 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
- | ||||||||
|
> 4.75 | R4 R = Peer reviewed scientific publications Rat4 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
None allocated at this time | |||
|
None allocated at this time | |||
|
- | |||
|
NL (Not listed) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
isotianil | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 15/02/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |