Chlorphonium chloride |
![]() Last updated: 04/01/2021 |
![]() |
(Also known as: phosfon; CBBP) |
|
![]() |
|
An obsolete plant growth retardant used to reduce the internodal length in ornamental plants | |
---|---|---|
|
Growth (height) | |
|
Ornamentals including chrystanthemums, geraniums, petunias, salvias, azaleas | |
|
- | |
|
Obsolete | |
|
- |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₉H₃₂Cl₃P | |
|
CCCC[P+](CCCC)(CCCC)CC1=C(C=C(C=C1)Cl)Cl.[Cl-] | |
|
No data | |
|
IVHVNMLJNASKHW-UHFFFAOYSA-M | |
|
InChI=1S/C19H32Cl2P.ClH/c1-4-7-12-22(13-8-5-2,14-9-6-3)16-17-10-11-18(20)15-19(17)21;/h10-11,15H,4-9,12-14,16H2,1-3H3;1H/q+1;/p-1/fC19H32Cl2P.Cl/h;1h/qm;-1 | |
|
Yes |
General status |
|
Herbicide, Plant growth regulator | |
---|---|---|
|
Organophosphate | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic | |
|
115-78-6 | |
|
204-105-4 | |
|
- | |
|
080901 | |
|
8286 | |
|
397.80 | |
|
tributyl[(2,4-dichlorophenyl)methyl]phosphanium chloride | |
|
tributyl(2,4-dichlorobenzyl)phosphonium chloride | |
|
tributyl[(2,4-dichlorophenyl)methyl]phosphonium chloride | |
|
- | |
|
- | |
|
Not known | |
|
Not known | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Colourless crystalline solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as granules or as a soluble liquid. |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
960000 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
1030000 | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | ||||||||
200000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | |||||||||
|
114 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.26 X 1003 | Calculated | - | |||||||
|
3.1 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) 3 = Unverified data of known source |
High | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.0933 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
3.52 X 10-08 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
850 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Very persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature states DT₅₀ around 28 months | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
178 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
178 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) Rat3 = Unverified data of known source |
Moderate | ||||||||
|
750 | L3 L = Pesticide manuals and hard copy reference books / other sources Rabbit3 = Unverified data of known source |
- | ||||||||
|
1.75 | Q3 Q = Miscellaneous internet resources Rat 4 hr3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List I | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
IMDG Transport Code is 6.1 | |||
|
Health: H301, H312, H315, H319 | |||
|
T - Toxic: R25, Xn - Harmful: R21 Xi - Irritant: R36/38 |
|||
|
S36, S37, S39, S45 | |||
|
II (Moderately hazardous) | |||
|
2811 | |||
|
Packaging Group III (minor danger) |
|
![]() |
|
|
||
---|---|---|---|
|
chlorphonium chloride | ||
|
chlorfonium chlorid | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 04/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |