Chlozolinate (Ref: M 8164) |
![]() Last updated: 23/12/2020 |
![]() |
(Also known as: dichlozolinate) |
|
![]() |
|
An obsolete, oxazolidin contact fungicide used as a foliar spray | |
---|---|---|
|
Botrytis spp.; Sclerotinia spp. | |
|
Grapes; Pome fruit; Stone fruit; Strawberries; Onamentals | |
|
- | |
|
Obsolete | |
|
1980, first reported |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Greece | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
A chiral molecule existing in the R- and S-forms. | |
---|---|---|
|
C₁₃H₁₁Cl₂NO₅ | |
|
CCOC(=O)C1(C(=O)N(C(=O)O1)C2=CC(=CC(=C2)Cl)Cl)C | |
|
No data | |
|
IGUYEXXAGBDLLX-UHFFFAOYSA-N | |
|
InChI=1S/C13H11Cl2NO5/c1-3-20-11(18)13(2)10(17)16(12(19)21-13)9-5-7(14)4-8(15)6-9/h4-6H,3H2,1-2H3 | |
|
Yes |
General status |
|
Fungicide | |
---|---|---|
|
Oxazolidin | |
|
- | |
|
- | |
|
Synthetic | |
|
Systemic with protective and curative action. Osmotic signal transduction. | |
|
84332-86-5 | |
|
282-714-4 | |
|
491 | |
|
- | |
|
51574 | |
|
332.14 | |
|
rac-ethyl (5R)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-1,3-oxazolidine-5-carboxylate | |
|
ethyl (RS)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-1,3-oxazolidine-5-carboxylate | |
|
ethyl 3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-5-oxazolidinecarboxylate | |
|
Chemical subject to PIC regulations | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
2 | |
|
- | |
|
Colourless solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
No longer available |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
32 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
2.00 X 1003 | Calculated | - | |||||||
|
3.3 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
High | ||||||||
|
1.44 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.013 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Low volatility | ||||||||
|
1.35 X 10-04 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
0.4 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
2 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data | ||||||||||
|
|
7.5 | R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- | |||||||
|
Tomato fruit, undercover, n=1 | ||||||||||
|
|
12.0 | R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- | |||||||
|
Grape berries, n=1 | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | H3 H = The US ARS pesticide properties database (click here ) 3 = Unverified data of known source |
Slightly mobile | |||||||
|
1150 | ||||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
0.28 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
6.58 X 10-04 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Slightly mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
> 4500 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
|
- | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | |||||||
|
200 | - | |||||||||
|
- | - | - | ||||||||
|
4500 | L3 L = Pesticide manuals and hard copy reference books / other sources Anas platyrhynchos3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
27.5 | L3 L = Pesticide manuals and hard copy reference books / other sources Salmonidae3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
1.18 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
30 | L3 L = Pesticide manuals and hard copy reference books / other sources Raphidocelis subcapitata3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
100 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | |||||||
|
> 100 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 4500 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.1 | A5 A = EU regulatory and evaluation data as published by EC, EFSA (RAR, DAR & Conclusion dossiers), EMA (e.g. EU Annex III PIC DGD) (EU - Pesticides database; EFSA Scientific Publications ) 5 = Verified data used for regulatory purposes |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H351 Environment: H411 |
|||
|
Carcinogen category 3: R40 N - Dangerous for the environment: R50, R53 |
|||
|
S2, S36/37, S61 | |||
|
U (Unlikely to present an acute hazard) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
chlozolinate | ||
|
chlozolinate | ||
|
Chlozolinat | ||
|
chlozolinat | ||
|
clozolinate | ||
|
clozolinato | ||
|
chlozolinate | ||
|
chlozolinat | ||
|
- | ||
|
- | ||
|
chlozolinate |
Record last updated: | 23/12/2020 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |