Cinosulfuron (Ref: CGA 142464) |
![]() Last updated: 23/12/2020 |
![]() |
(Not known by any other names) |
|
![]() |
|
A triazinylsulfonylurea herbicide used for post-emergence control of many weeds | |
---|---|---|
|
European water plaintain; Annual sedge; Aquatic ferns; Pond weeds; PArrowhead; Duck potato; Water hyacinth | |
|
Tropical & temporal rice crops | |
|
- | |
|
Obsolete | |
|
1990, first launched, Indonesia |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₅H₁₉N₅O₇S | |
|
COCCOC1=CC=CC=C1S(=O)(=O)NC(=O)NC2=NC(=NC(=N2)OC)OC | |
|
No data | |
|
WMLPCIHUFDKWJU-UHFFFAOYSA-N | |
|
InChI=1S/C15H19N5O7S/c1-24-8-9-27-10-6-4-5-7-11(10)28(22,23)20-13(21)16-12-17-14(25-2)19-15(18-12)26-3/h4-7H,8-9H2,1-3H3,(H2,16,17,18,19,20,21) | |
|
Yes |
General status |
|
Herbicide | |
---|---|---|
|
Sulfonylurea | |
|
- | |
|
- | |
|
Synthetic | |
|
Absorbed by shoots and roots, acts by inhibiting growth. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS | |
|
94593-91-6 | |
|
- | |
|
507 | |
|
- | |
|
92420 | |
|
413.4 | |
|
N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)carbamoyl]-2-(2-methoxyethoxy)benzene-1-sulfonamide | |
|
1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[2-(2-methoxyethoxy)phenylsulfonyl]urea | |
|
N-[[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]carbonyl]-2-(2-methoxyethoxy)benzenesulfonamide | |
|
- | |
|
- | |
|
B | |
|
2 | |
|
Not applicable | |
|
Not applicable | |
|
Alisma plantago-aquatica, Cyperus difformis, Limnophila erecta | |
|
Colourless crystalline powder | |
|
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as dry use granules or water dispersible granules. |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
4000 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
36000 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | ||||||||
1900 | L3 L = Pesticide manuals and hard copy reference books / other sources Ethanol3 = Unverified data of known source |
- | |||||||||
540 | L3 L = Pesticide manuals and hard copy reference books / other sources Toluene3 = Unverified data of known source |
- | |||||||||
260 | L3 L = Pesticide manuals and hard copy reference books / other sources n-Octanol3 = Unverified data of known source |
- | |||||||||
|
131 | L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
1.58 X 1000 | Calculated | - | |||||||
|
0.2 | T4 T = UN EPFA database 4 = Verified data |
Low | ||||||||
|
1.47 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
4.72 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
Weak acid | |||||||||||
|
0.01 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
1.00 X 10-06 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
20 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
20 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Paddy fields DT₅₀ typically 3 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable | |||||||
|
Stable pH 7 to pH 10, fast at pH 3 to pH 5 | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Mobile | |||||||
|
20 | ||||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.51 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
3.77 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
> 5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
|
- | L2 L = Pesticide manuals and hard copy reference books / other sources Rat 2 year2 = Unverified data of unknown source |
- | |||||||
|
400 | - | |||||||||
|
- | - | - | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Coturnix japonica3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
100 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
2500 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
4.8 | L3 L = Pesticide manuals and hard copy reference books / other sources Scenedemus subspicatus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
100 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
1000 | L3 L = Pesticide manuals and hard copy reference books / other sources Eisenia foetida3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 5000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
5.0 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Not classified: Obsolete | |||
|
Not classified: Obsolete | |||
|
Not classified: Obsolete | |||
|
U/O (Obsolete substance / Unlikely to present an acute hazard) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
cinosulfuron | ||
|
cinosulfuron | ||
|
Cinosulfuron | ||
|
cinosulfuron | ||
|
cinosulfuron | ||
|
cinosulfuron | ||
|
- | ||
|
cinosulfuron | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 23/12/2020 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |