Alanycarb |
![]() Last updated: 18/12/2020 |
![]() |
(Also known as: alanycarbe; alanicarb) |
SUMMARY |
Alanycarb is an obsolete broad-range carbamate insecticide that is not longer used within the EU. It has a low aqueous solubility and is relatively volatile. It tends not to be presistent in soil systems but may persist in water. It has a moderate mammalian toxicity and there is slight concern regarding possible bioaccumulation. It is an acetyl cholinesterase inhibitor. Alanycarb is moderately toxic to fish and aquatic invertebrates, highly toxic to honeybees but is relatively non-toxic to birds.. |
|
![]() |
|
A broad range oxime carbamate insecticide and nematicide | |
---|---|---|
|
Aphids; Lacebugs; Mealybugs; Whiteflies; Springtails | |
|
Fruit including apples, pears, grapes and citrus; Vegetables including brassicas; Tobacco; Cotton; Beets | |
|
- | |
|
Unknown | |
|
1984, first reported; 1991, Introduced Japan |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
France | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
Vietnam |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₇H₂₅N₃O₄S₂ | |
|
CCOC(=O)CCN(CC1=CC=CC=C1)SN(C)C(=O)ON=C(C)SC | |
|
CCOC(=O)CCN(CC1=CC=CC=C1)SN(C)C(=O)O/N=C(/C)\SC | |
|
GMAUQNJOSOMMHI-JXAWBTAJSA-N | |
|
InChI=1S/C17H25N3O4S2/c1-5-23-16(21)11-12-20(13-15-9-7-6-8-10-15)26-19(3)17(22)24-18-14(2)25-4/h6-10H,5,11-13H2,1-4H3/b18-14- | |
|
Yes |
General status |
|
Insecticide | |
---|---|---|
|
Carbamate | |
|
- | |
|
- | |
|
Synthetic | |
|
Contact and stomach action. Acetylcholinesterase (AChE) inhibitor. | |
|
83130-01-2 | |
|
- | |
|
576 | |
|
- | |
|
9576091 | |
|
399.53 | |
|
ethyl (3Z)-9-benzyl-3,7-dimethyl-6-oxo-5-oxa-2,8-dithia-4,7,9-triazadodec-3-en-12-oate | |
|
ethyl (Z)-N-benzyl-N-[[methyl(1-methylthioethylideneaminooxycarbonyl)amino]thio]-β-alaninate | |
|
ethyl (3Z)-3,7-dimethyl-6-oxo-9-(phenylmethyl)-5-oxa-2,8-dithia-4,7,9-triazadodec-3-en-12-oate | |
|
PAN Listed as Highly Hazardous Chemical | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
1A | |
|
Not applicable | |
|
None identified | |
|
Pale yellow solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Available as emulsifiable concentrates and wettable powders for foliar, soil or seed treatments |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
20 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
950000 | Q3 Q = Miscellaneous internet resources Toluene3 = Unverified data of known source |
- | ||||||||
950000 | Q3 Q = Miscellaneous internet resources Acetone3 = Unverified data of known source |
- | |||||||||
950000 | Q3 Q = Miscellaneous internet resources Ethyl acetate3 = Unverified data of known source |
- | |||||||||
|
46.8 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
2.69 X 1003 | Calculated | - | |||||||
|
3.43 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
1.21 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.0047 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
1.74 X 10-08 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
1.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Best available data | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | - | - | |||||
|
Soil | - | - |
Other known metabolites |
|
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|---|
acetonitrile | - | Soil; Plant; Animal | - | - | |||||
acetic acid | - | Soil; Plant; Animal | - | - | |||||
ethyl N-benzyl-beta-alaninate | - | Soil; Plant | - | - | |||||
N-benzyl-beta-alaninate | - | Soil; Animal | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
164 | Q2 Q = Miscellaneous internet resources Estimated2 = Unverified data of unknown source |
Threshold for concern | |||||||
|
Not available | - | |||||||||
|
330 | F4 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) Rat4 = Verified data |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
3553 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus virginianus3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
1 | L3 L = Pesticide manuals and hard copy reference books / other sources Cyprinidae3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
9.4 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
0.8 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
330 | F4 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) Rat4 = Verified data |
Moderate | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
0.205 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
Low risk to Europeans as no longer approved for use | |||||||||
|
Low risk to Europeans as no longer approved for use | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Moderately toxic |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302, H330 Environment: H400 |
|||
|
T+ - Very toxic: R26 Xn - Harmful: R22 N - Dangerous for the environment: R50 |
|||
|
S28, S36/37, S45, S61 | |||
|
II (Moderately hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
alanycarb | ||
|
alanycarbe | ||
|
Alanycarb | ||
|
alanycarb | ||
|
alanycarb | ||
|
alanycarb | ||
|
- | ||
|
alanykarb | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 18/12/2020 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |