Desmetryn (Ref: G 34360) |

Last updated: 23/01/2025
|
 |
(Also known as: desmetryne; semeron) |
Desmetryn is a selective herbicide. It has a moderate aqueous solubility and is volatile. Based on its chemical properties it is not expected to leach to groundwater. It is not usually persistent in soils but may persist in water under some conditions. Desmetryn is moderately toxic to mammals. It is moderately toxic to birds, most aquatic organisms and earthworms. It is relatively non-toxic to honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
A methylthiotriazine herbicide used to control annual broad-leaved weeds and some grasses |
|
Fathen; Lambsquarter; Nettleweed; Nightshade; Pigweed |
|
Brassicas; Onions and leeks; Fodder rape |
|
- |
|
Considered obsolete but may be available in some countries |
|
1962, frist reported |
|
Not approved |
|
Expired |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Expired |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₈H₁₅N₅S |
|
CC(C)NC1=NC(=NC(=N1)NC)SC |
|
No data |
|
HCRWJJJUKUVORR-UHFFFAOYSA-N |
|
InChI=1S/C8H15N5S/c1-5(2)10-7-11-6(9-3)12-8(13-7)14-4/h5H,1-4H3,(H2,9,10,11,12,13) |
|
Yes |
|
Herbicide |
|
Methylthiotriazine herbicie; Triazine herbicide |
|
>95% |
|
- |
|
Synthetic |
|
Selective, absorbed by leaves and roots, photosynthetic electron transport inhibitor |
|
1014-69-3 |
|
213-800-1 |
|
147 |
|
080810 |
|
13904 |
|
613-007-00-4 |
|
213.30 |
|
N2-methyl-6-(methylsulfanyl)-N4-(propan-2-yl)-1,3,5-triazine-2,4-diamine |
|
N2-isopropyl-N4-methyl-6-methylthio-1,3,5-triazine-2,4-diamine |
|
N-methyl-N'-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
|
- |
|
- |
|
C1 |
|
5 |
|
Not applicable |
|
Not applicable |
|
- |
|
White crystalline powder |
|
|
|
- Syngenta
- Novartis
- Ciba-Geigy
|
|
|
|
Usually supplied as a wettable powder |
|
|
|
|
|
|
|
580 |
|
Moderate |
|
300000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
230000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
2600 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Hexane |
- |
|
84 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
339 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
2.40 X 1002 |
Calculated |
- |
|
2.38 |
|
Low |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.18 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
4 |
|
- |
Weak base |
|
1.30 X 10-01 |
|
Low volatility. If applied directly to plants, drift is a concern & mitigation is advisable |
|
4.89 X 10-05 |
|
Non-volatile |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
9 |
|
Non-persistent |
|
9 |
|
Non-persistent |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Other literature quotes DT₅₀ soil 50 days (L3) |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
Stable |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Stable |
|
- |
|
34 |
|
Moderately fast |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
|
- |
|
Moderately mobile |
|
150 |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
|
- |
|
- |
|
|
|
|
|
1.74 |
Calculated |
Low leachability |
|
|
2.37 X 10-02 |
Calculated |
- |
|
- |
|
Low |
Calculated |
- |
|
Moderately mobile |
Calculated |
- |
|
- |
- |
- |
|
|
21 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
1390 |
Rat |
Moderate |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
> 10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
160 |
Eisenia foetida |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
> 101 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
> 197 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
Harmless |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
2.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
45 |
Daphnia magna |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.025 |
Ankistrodesmus falcatus |
Moderate |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
1390 |
Rat |
Moderate |
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
- |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
No data found |
XNo, known not to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
No further information available |
|
|
|
No information available |
|
Health: H302, H312 Environment: H400, H410 |
|
III (Slightly hazardous) |
|
- |
|
- |
|
- |
|
|
|
desmetryn |
|
desmétryne |
|
Desmetryn |
|
desmetryn |
|
desmetrina |
|
desmetrina |
|
desmetryn |
|
desmetryna |
|
- |
|
- |
|
desmetryn |
|
- |
Record last updated: |
23/01/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |