Dichlorprop (Ref: RD 406) |
![]() Last updated: 11/01/2021 |
![]() |
(Also known as: 2,4-DP) |
SUMMARY |
Dichlorprop is a post-emergence, selective herbicide that does not have regulatory approval for use in the EU. It has a moderate aqueous solubility and is volatile. Its data suggests it is not persistent in soils but may persist in some water systems. It is moderately toxic to. Dichlorprop has a moderate to low toxicity to most aquatic organisms. |
|
![]() |
|
A herbicide for post-emergence control of annual and perennial broad-leaved weeds and some brush species | |
---|---|---|
|
Canada thistle; Cocklebur; Ragweeds; Pigweed; Shepherd's purse; Stinkweed; Lambsquarter; Goosefoot; Wild mustard | |
|
Cereals including wheat, barley; Non-crop situations including right-of-way, commercial and industrial sites | |
|
- | |
|
Current | |
|
1961 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
Chiral with S- and R- enantiomers | |
---|---|---|
|
C₉H₈Cl₂O₃ | |
|
CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl | |
|
Clc1cc(Cl)ccc1OC(C(=O)O)C | |
|
MZHCENGPTKEIGP-UHFFFAOYSA-N | |
|
InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13) | |
|
Yes |
|
![]() |
Common Name | Relationship | Link |
---|---|---|
dichlorprop | - | ![]() |
General status |
|
Herbicide | |
---|---|---|
|
Aryloxyalkanoic acid | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, systemic, absorbed through leaves and translocates to roots. Synthetic auxin causing stem and leaf malformations leading to death. | |
|
120-36-5 | |
|
7547-66-2 | |
|
204-390-5 | |
|
84 | |
|
031401 | |
|
8427 | |
|
235.06 | |
|
rac-(2R)-2-(2,4-dichlorophenoxy)propanoic acid | |
|
(RS)-2-(2,4-dichlorophenoxy)propionic acid | |
|
2-(2,4-dichlorophenoxy)propanoic acid | |
|
Potential groundwater contaminant | |
|
- | |
|
O | |
|
4 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Colourless crystals |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Often supplied as an emulsifiable concentrate or as an emulsion. |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
350 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Moderate | ||||||||
|
689000 | C4 C = AGRITOX (click here ) Ethyl acetate4 = Verified data |
- | ||||||||
1265000 | C4 C = AGRITOX (click here ) Acetone4 = Verified data |
- | |||||||||
3030 | C4 C = AGRITOX (click here ) Hexane4 = Verified data |
- | |||||||||
61200 | C4 C = AGRITOX (click here ) Toluene4 = Verified data |
- | |||||||||
|
117 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
204 | L3 L = Pesticide manuals and hard copy reference books / other sources (open cup)3 = Unverified data of known source |
- | ||||||||
|
|
1.95 X 1002 | Calculated | - | |||||||
|
2.29 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Low | ||||||||
|
1.42 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
3 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
Strong acid | |||||||||||
|
0.01 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Low volatility | ||||||||
|
8.80 X 10-06 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
10 | W4 W = French database provided by ARVALIS-Institut du Végétal 4 = Verified data |
Non-persistent | |||||||
|
14 | Y4 Y = Germany's Federal Environment Agency (UBA) (click here ) 4 = Verified data |
Non-persistent | ||||||||
|
10 | X3 X = WINPST database (click here ) 3 = Unverified data of known source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Other sources: DT₅₀ 21-25 days (R3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Stable | |||||||
|
- | ||||||||||
|
12 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Fast | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q4 Q = Miscellaneous internet resources 4 = Verified data |
Mobile | |||||||
|
74 | ||||||||||
|
Other sources: 12.0-170 mL g⁻¹ (R3) | ||||||||||
|
|
0.77 | R4 R = Peer reviewed scientific publications 4 = Verified data |
Mobile | |||||||
|
41.2 | ||||||||||
|
0.87 | ||||||||||
|
Kf range 0.67-0.86 mL g⁻¹, Kfoc range 34.4-47.9 mL g⁻¹, 1/n range 0.86-0.88, Soils=2 | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
2.39 | Calculated | Transition state | ||||||||||||||||||||||||||
|
|
5.07 X 10-02 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Low | Calculated | - | ||||||||||||||||||||||||||
|
Mobile | Calculated | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | - | Minor fraction; Relevant |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
6 | Q2 Q = Miscellaneous internet resources Estimated2 = Unverified data of unknown source |
Low potential | |||||||
|
Not available | - | |||||||||
|
825 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | |||||||
|
> 5 | - | |||||||||
|
- | - | - | ||||||||
|
504 | L3 L = Pesticide manuals and hard copy reference books / other sources Coturnix japonica3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
> 0.5 | J4 J = Pesticide Action Network database (click here ) Oncorhynchus mykiss4 = Verified data |
Moderate | ||||||||
|
- | - | - | ||||||||
|
> 100 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
1100 | L2 L = Pesticide manuals and hard copy reference books / other sources Pseudokirchneriella subcapitata2 = Unverified data of unknown source |
Low | ||||||||
|
180 | Q2 Q = Miscellaneous internet resources Unknown species2 = Unverified data of unknown source |
Low | ||||||||
|
|
16 | K4 K = Research datasets, e.g. Pandora, Demetra 4 = Verified data |
Moderate | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
1000 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
825 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
1400 | L3 L = Pesticide manuals and hard copy reference books / other sources Mouse3 = Unverified data of known source |
- | ||||||||
|
0.65 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
List II | - | - | ||||||||
|
|
Low risk to Europeans as no longer approved for use | |||||||||
|
Low risk to Europeans as no longer approved for use | ||||||||||
|
|
||||||||||
|
Non-statutory WHO drinking water guideline 0.1 mg l⁻¹ | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) UK EA QS database 20185 = Verified data used for regulatory purposes |
- | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
Health: H302, H312, H315, H318 | |||
|
Xn - Harmful: R21/22, R41 Xi - Irritant: R38 |
|||
|
S2, S22, S36/37 | |||
|
II (Moderately hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
dichlorprop | ||
|
dichlorprop | ||
|
Dichlorprop | ||
|
dichlorprop | ||
|
diclorprop | ||
|
diclorprop | ||
|
dichlorprop | ||
|
dichlorprop | ||
|
- | ||
|
dichlorprop | ||
|
dichloorprop |
Record last updated: | 11/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |