Dimefuron (Ref: RP 23465) |
![]() Last updated: 14/01/2021 |
![]() |
(Not known by any other names) |
|
![]() |
|
A herbicide applied pre- and post-emergence to control annual broad-leaved weeds | |
---|---|---|
|
Chickweed; Scented mayweed; Charlock | |
|
Legumes including peas, beans; Lucerne; Oilseed rape; Cruciferous vegetables | |
|
- | |
|
Unknown | |
|
circa 1975 |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₅H₁₉ClN₄O₃ | |
|
CC(C)(C)C1=NN(C(=O)O1)C2=C(C=C(C=C2)NC(=O)N(C)C)Cl | |
|
No data | |
|
DHWRNDJOGMTCPB-UHFFFAOYSA-N | |
|
InChI=1S/C15H19ClN4O3/c1-15(2,3)12-18-20(14(22)23-12)11-7-6-9(8-10(11)16)17-13(21)19(4)5/h6-8H,1-5H3,(H,17,21) | |
|
Yes |
General status |
|
Herbicide | |
---|---|---|
|
Oxadiazolone/phenylurea | |
|
- | |
|
- | |
|
Synthetic | |
|
Selective, absorbed mainly through the roots. Photosystem II inhibitor. | |
|
34205-21-5 | |
|
251-879-4 | |
|
279 | |
|
- | |
|
91612 | |
|
338.79 | |
|
N'-[4-(5-tert-butyl-2-oxo-1,3,4-oxadiazol-3(2H)-yl)-3-chlorophenyl]-N,N-dimethylurea | |
|
3-[4-(5-tert-butyl-2,3-dihydro-2-oxo-1,3,4-oxadiazol-3-yl)-3-chlorophenyl]-1,1-dimethylurea | |
|
N'-[3-chloro-4-[5-(1,1-dimethylethyl)-2-oxo-1,3,4-oxadiazol-3(2H)-yl]phenyl]-N,N-dimethylurea | |
|
PAN Listed as Highly Hazardous Chemical | |
|
- | |
|
C2 | |
|
7 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Colourless crystals |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
- | |||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
16 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) 5 = Verified data used for regulatory purposes |
Low | ||||||||
|
- | - | - | ||||||||
|
193 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
3.24 X 1002 | Calculated | - | |||||||
|
2.51 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) 5 = Verified data used for regulatory purposes |
Low | ||||||||
|
1.3 | Q2 Q = Miscellaneous internet resources 2 = Unverified data of unknown source |
- | ||||||||
|
Not applicable | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) 5 = Verified data used for regulatory purposes |
- | ||||||||
No dissociation | |||||||||||
|
0.01 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) 5 = Verified data used for regulatory purposes |
Low volatility | ||||||||
|
2.12 X 10-03 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
65 | B4 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) 4 = Verified data |
Moderately persistent | |||||||
|
129 | B4 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) 4 = Verified data |
Persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Lab studies DT₅₀ range 100-203 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
226 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) 5 = Verified data used for regulatory purposes |
Persistent | |||||||
|
- | ||||||||||
|
97 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderately fast | ||||||||
|
82 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Stable |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
2.54 | B4 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) 4 = Verified data |
Moderately mobile | |||||||
|
206 | ||||||||||
|
0.91 | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
3.56 | Calculated | High leachability | ||||||||||||||||||||||||||
|
|
7.07 X 10-01 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
Medium | Calculated | - | ||||||||||||||||||||||||||
|
Moderately mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Low risk | Q3 Q = Miscellaneous internet resources Based on LogP < 33 = Unverified data of known source |
Low risk | |||||||
|
- | - | |||||||||
|
> 2000 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) Rat5 = Verified data used for regulatory purposes |
Low | ||||||||
|
|
15.5 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) Rat5 = Verified data used for regulatory purposes |
High | |||||||
|
250 | - | |||||||||
|
- | - | - | ||||||||
|
3350 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) Colinus virginianus5 = Verified data used for regulatory purposes |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
1000 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) Lepomis macrochirus5 = Verified data used for regulatory purposes |
Low | ||||||||
|
- | - | - | ||||||||
|
575 | K3 K = Research datasets, e.g. Pandora, Demetra Unknown species3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
0.008 | K2 K = Research datasets, e.g. Pandora, Demetra Unknown species2 = Unverified data of unknown source |
High | ||||||||
|
- | - | - | ||||||||
|
|
500 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) 5 = Verified data used for regulatory purposes |
Low | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
300 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 2000 | B5 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) Rat5 = Verified data used for regulatory purposes |
Low | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.07 | B4 B = UK CRD and ACP evaluation documents / and other Defra (UK) documents (click here ) UK ACP 19994 = Verified data |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information avilable |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information avilable | |||
|
Health: H302 | |||
|
Xn - Harmful: R22 | |||
|
- | |||
|
III (Slightly hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
dimefuron | ||
|
diméfuron | ||
|
Dimefuron | ||
|
dimefuron | ||
|
dimefuron | ||
|
dimefuron | ||
|
- | ||
|
dimefuron | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 14/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |