Iminoctadine tris(albesilate) (Ref: DF-250) |
![]() Last updated: 12/02/2021 |
![]() |
(Also known as: Iminoctadine albesilate; iminoctadine trialbesilate) |
|
![]() |
|
An aliphatic nitrogen fungicide widely used in some countries to control a variety of fungal pathogens | |
---|---|---|
|
Alternaria, Gloeodes | |
|
Fruit including citrus; Ornamental and fruit trees; Lawns and turf | |
|
- | |
|
Current | |
|
1995; first reported; 1994, first registered Japan |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
China, Japan, Korea, Taiwan |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₇₂H₁₃₁N₇O₉S₃ | |
|
CCCCCCCCCCCCC1=CC=CC=C1S(=O)(=O)O.CCCCCCCCCCCCC1=CC=CC=C1S(=O)(=O)O.CCCCCCCCCCCCC1=CC=CC=C1S(=O)(=O)O.C(CCCCN=C(N)N)CCCNCCCCCCCCN=C(N)N | |
|
No data | |
|
XAYMVFWOJIOUTA-UHFFFAOYSA-N | |
|
InChI=1S/C18H41N7.3C18H30O3S/c19-17(20)24-15-11-7-3-1-5-9-13-23-14-10-6-2-4-8-12-16-25-18(21)22;3*1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)22(19,20)21/h23H,1-16H2,(H4,19,20,24)(H4,21,22,25);3*12-13,15-16H,2-11,14H2,1H3,(H,19,20,21) | |
|
Yes |
General status |
|
Fungicide | |
---|---|---|
|
Guanidine | |
|
- | |
|
- | |
|
Synthetic | |
|
Protectant. Multi-site activity. | |
|
99257-43-9 | |
|
- | |
|
- | |
|
- | |
|
24834756 | |
|
1335.05 | |
|
1,1'-iminodi(octamethylene)diguanidinium tris(alkylbenzenesulfonate) | |
|
1,1'-iminodi(octamethylene)diguanidinium tris(alkylbenzenesulfonate) | |
|
N,N'''-(iminodi-8,1-octanediyl)bisguanidinium tris(dodecylbenzenesulfonate) | |
|
- | |
|
- | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
M7 | |
|
- | |
|
Light brown waxy solid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Available in arange of formulations including wettable powders and seed dressings |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
6000 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
High | ||||||||
|
5660000 | Q3 Q = Miscellaneous internet resources Methanol3 = Unverified data of known source |
- | ||||||||
3280000 | Q3 Q = Miscellaneous internet resources Ethanol3 = Unverified data of known source |
- | |||||||||
550 | Q3 Q = Miscellaneous internet resources Acetone3 = Unverified data of known source |
- | |||||||||
|
94 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
1.6 X 10-01 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Low volatility | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
105 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Persistent | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Literature data DT₅₀ range 90 to 122 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Non-mobile | |||||||
|
214453 | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
-2.69 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
5.35 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW | ||||||||||||||||||||||||||||
|
High | Calculated | - | ||||||||||||||||||||||||||
|
Non-mobile | Calculated | - |
Key metabolites |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
|
Soil | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
> 1400 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 1827 | Q3 Q = Miscellaneous internet resources Coturnix quail3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
4.5 | Q3 Q = Miscellaneous internet resources Oncorhymchus mykiss3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
> 100 | Q3 Q = Miscellaneous internet resources Daphnia carinata3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
> 1000 | Q3 Q = Miscellaneous internet resources Eisenia foetida3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 1400 | V3 V = ChemID online databases / IPCS INCHEM (ChemID; IPCS INCHEM ) Rat3 = Unverified data of known source |
Moderate | ||||||||
|
2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
- | ||||||||
|
1.0 | E3 E = Manufacturers safety data sheets Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
|
|||||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Highly |
Handling issues |
|
|
|||
---|---|---|---|---|
|
IMDG Transport Code is usually 6.1a | |||
|
- | |||
|
T+ - Very toxic: R26 Xn - Harmful: R21/22, R41 Xi - Irritant: R37/38 N - Dangerous for the environment: R50, R53 |
|||
|
S1/2, S26, S28, S36/37/39, S38, S45, S46, S60, S61, S63 | |||
|
III (Slightly hazardous) | |||
|
- | |||
|
Packaging Group II (medium danger) |
|
![]() |
|
|
||
---|---|---|---|
|
iminoctadine tris(albesilate) | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 12/02/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |