Difenzoquat metilsulfate (Ref: AC 84777) |
![]() Last updated: 13/01/2021 |
![]() |
(Also known as: difenzoquat methyl sulphate; difenzoquat methyl sulfate; CL84777; BAS 450H; difenzoquat metilsulphate) |
|
![]() |
|
A post-emergence quarternary ammonium herbicide for wild oat control | |
---|---|---|
|
Wild oats; Powdery mildew | |
|
Cereals including wheat, barley; Alfalfa; Maize; Clover seed crops | |
|
- | |
|
Current | |
|
1982, USA |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Expired | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Expired | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Yes | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₁₈H₂₀N₂O₄S | |
|
CN1C(=CC(=[N+]1C)C2=CC=CC=C2)C3=CC=CC=C3.COS(=O)(=O)[O-] | |
|
No data | |
|
XQEMNBNCQVQXMO-UHFFFAOYSA-M | |
|
InChI=1S/C17H17N2.CH4O4S/c1-18-16(14-9-5-3-6-10-14)13-17(19(18)2)15-11-7-4-8-12-15;1-5-6(2,3)4/h3-13H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 | |
|
Yes |
General status |
|
Herbicide, Fungicide | |
---|---|---|
|
Pyrazolium | |
|
>96% | |
|
- | |
|
Synthetic | |
|
Selective, absorbed by foliage. Acts via the rapid destruction of cell membranes. | |
|
43222-48-6 | |
|
256-152-5 | |
|
- | |
|
106401 | |
|
39424 | |
|
360.43 | |
|
1,2-dimethyl-3,5-diphenyl-1H-pyrazol-2-ium methyl sulfate | |
|
1,2-dimethyl-3,5-diphenyl-1H-pyrazolium methyl sulfate | |
|
1,2-dimethyl-3,5-diphenylpyrazolium methyl sulfate | |
|
- | |
|
- | |
|
Z | |
|
0 | |
|
Not applicable | |
|
Not known | |
|
- | |
|
Colourless crystals |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as a water miscible liquid or soluble powder |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
765000 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
360000 | L3 L = Pesticide manuals and hard copy reference books / other sources Dichloromethane3 = Unverified data of known source |
- | ||||||||
500000 | L3 L = Pesticide manuals and hard copy reference books / other sources Chloroform3 = Unverified data of known source |
- | |||||||||
558000 | L3 L = Pesticide manuals and hard copy reference books / other sources Methanol3 = Unverified data of known source |
- | |||||||||
9800 | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | |||||||||
|
157 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
82 | L3 L = Pesticide manuals and hard copy reference books / other sources (open cup)3 = Unverified data of known source |
- | ||||||||
|
|
2.45 X 10-01 | Calculated | - | |||||||
|
-0.61 | T4 T = UN EPFA database 4 = Verified data |
Low | ||||||||
|
0.8 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
7 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
Weak acid | |||||||||||
|
0.01 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Low volatility | ||||||||
|
5.70 X 10-11 | H4 H = The US ARS pesticide properties database (click here ) 4 = Verified data |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
90 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent | |||||||
|
100 | DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. MS in preparation 4 = Verified data |
Persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
Other sources: DT₅₀ 3 months (R3) | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
Stable | W4 W = French database provided by ARVALIS-Institut du Végétal 4 = Verified data |
Stable | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-mobile | |||||||
|
30000 | ||||||||||
|
Other sources: Log Koc 4.49-5.80 | ||||||||||
|
|
166 | R3 R = Peer reviewed scientific publications (for difenzoquat)3 = Unverified data of known source |
Non-mobile | |||||||
|
9702 | ||||||||||
|
1.39 | ||||||||||
|
Kf range 29-664 mL g⁻¹; Kfoc range 1740-33200 mL g⁻¹; 1/n range 1.05-1.54; Soils=9 | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
0.03 | Calculated | Low leachability | ||||||||||||||||||||||||||
|
|
5.31 X 10-03 | Calculated | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
High | Calculated | - | ||||||||||||||||||||||||||
|
Non-mobile | Calculated | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
20 | P4 P = Other governments and regulators 4 = Verified data |
Low potential | |||||||
|
Not available | - | |||||||||
|
373 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
|
- | L2 L = Pesticide manuals and hard copy reference books / other sources Rat 2 year2 = Unverified data of unknown source |
- | |||||||
|
500 | - | |||||||||
|
- | - | - | ||||||||
|
> 4640 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus virginianus3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
694 | L3 L = Pesticide manuals and hard copy reference books / other sources Oncorhynchus mykiss3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
2.63 | L3 L = Pesticide manuals and hard copy reference books / other sources Daphnia magna3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
0.54 | F1 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) Unknown species1 = Estimated data with little or no verification |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
36 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
> 400 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
Harmless | AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 Chrysoperla carnea2 = Unverified data of unknown source |
- |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
373 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Moderate | ||||||||
|
3540 | L3 L = Pesticide manuals and hard copy reference books / other sources Rabbit3 = Unverified data of known source |
- | ||||||||
|
0.36 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat 4 hr3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
0.0005 | F3 F = U.S. EPA ECOTOX database / U.S. EPA pesticide fate database / Miscellaneous WHO documents (US EPA Databases Related to Pesticide Risk Assessment ) JMPR 19703 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Moderately toxic May cause irreversible eye damage |
Handling issues |
|
|
|||
---|---|---|---|---|
|
Hygroscopic | |||
|
Health: H302 Environment: H400, H410 |
|||
|
Xn - Harmful: R22 N - Dangerous for the environment: R50, R53 |
|||
|
S2, S60, S61 | |||
|
II (Moderately hazardous) | |||
|
2588 | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
difenzoquat metilsulfate | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 13/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |