Tributyltin oxide (Ref: ENT 24979) |

Last updated: 13/02/2025
|
 |
(Also known as: TBT; bis(tributylstannyl)oxide ; bis(tributyltin)oxide) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
Environmental fate |
Ecotoxicity |
Human health |
|
|
|
|
Used mainly as an antifouling agent for use in marine applications or industrial sites |
|
Barnacles; Bacteria; Tubeworms; Mussels; Algae |
|
Paints; Industrial water systems; Packaging surfaces |
|
- |
|
Considered obsolete but may be available in some countries |
|
2003, withdrawn UK |
|
Not approved |
|
Not applicable |
|
No UK approval for use as a pesticide |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved |
|
Not applicable |
|
Not applicable |
|
- |
|
Yes |
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
C₂₄H₅₄OSn₂ |
|
CCCC[Sn](CCCC)(CCCC)O[Sn](CCCC)(CCCC)CCCC |
|
- |
|
APQHKWPGGHMYKJ-UHFFFAOYSA-N |
|
InChI=1S/6C4H9.O.2Sn/c6*1-3-4-2;;;/h6*1,3-4H2,2H3;;; |
|
Yes |
|
Fungicide, Molluscicide, Other substance |
|
Antifouling agent, Wood preservative, Biocide |
|
Organometal fungicide; Organotin fungicide |
|
- |
|
- |
|
Synthetic |
|
Broad spectrum, non-systemic, phytotoxic; A metabolic inhibitor with contact and stomach action. |
|
56-35-9 |
|
200-268-0 |
|
- |
|
083001 |
|
16682746 |
|
No data found |
|
596.15 |
|
hexabutyldistannoxane |
|
bis(tributyltin) oxide |
|
hexabutyldistannoxane |
|
WFD priority substance; Marine pollutant; Chemical subject to PIC regulations; PAN listed Highly Hazardous Chemical |
|
EU Directive 2008/105/EC EQS surface waters: annual average 0.0002 µg l⁻¹; max measured 0.0015 µg l⁻¹ UK statutory standard for the protection of surface water quality: annual average 0.0002 µg l⁻¹; max measured 0.0015 µg l⁻¹ |
|
Not applicable |
|
Not applicable |
|
Not applicable |
|
30 |
|
- |
|
Pale yellow liquid |
|
|
|
- |
|
- Obsolete - not thought to be commercially available for crop protection applications
|
|
- |
|
|
|
|
|
100 |
at 25 °C |
Moderate |
|
Miscible |
Acetone |
- |
Miscible |
Methanol |
- |
Miscible |
Ethyl acetate |
- |
|
53 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
180 |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
1.55 X 1003 |
Calculated |
- |
|
3.19 |
|
High |
|
|
- |
- |
- |
|
- |
- |
- |
|
1.17 |
|
- |
|
- |
- |
- |
- |
|
0.000001 |
|
Low volatility |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
- |
Soil adsorption and mobility |
|
|
|
|
|
|
- |
- |
- |
|
|
Cannot be calculated |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
7000 |
(Wide range of values reported between 4.5 and 7000) |
High potential |
|
Not available |
- |
None
Terrestrial ecotoxicology |
|
|
|
|
|
55 |
Mouse |
High |
|
|
- |
- |
- |
|
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
2.5 |
Eisenia andrei |
High |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
- |
- |
- |
|
|
1.0 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderate |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
- |
|
- |
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
|
|
- |
- |
- |
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
|
|
|
0.0076 |
Lepomis macrochirus |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.0014 |
Daphnia magna |
High |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
0.000016 |
Scenedesmus quadricauda |
High |
|
- |
- |
- |
|
|
- |
- |
- |
|
- |
- |
- |
|
0.015 |
Crassostrea gigas |
- |
HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
55 |
Mouse |
High |
|
11700 |
Rat |
- |
|
- |
- |
- |
|
Intravenous LD₅₀ = 6.0 mg kg⁻¹ |
Mouse |
- |
Intraperitoneal LD₅₀ = 7.2 mg kg⁻¹ |
Rat |
- |
|
- |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
[TLV (as tin): 0.1 mg/m3 A4, STEL 0.2 mg/m3 A4 (skin) (ACGIH)] |
- |
- |
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
|
PPE/PPC required - absorbed through the skin |
|
|
EU MRL pesticide database |
|
|
|
|
|
- |
|
- |
- |
- |
|
- |
- |
- |
|
Very little is absorbed and most excreted in the faeces |
|
- |
|
Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
✓Yes, known to cause a problem |
Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
✓Yes, known to cause a problem |
Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
Highly toxic Absorbed through the skin Inhalation may interfere with breathing and cause headache, weakness, tremors and incoordination |
|
|
|
Mild oxidising agent Not explosive Combustible IMDG Transport Hazard Class 6.1 May emit toxic fumes when heated |
|
Health: H301, H372, H312, H315, H319 Environment: H400, H410 |
|
II (Moderately hazardous) |
|
UN2788 |
|
Packaging Group II (moderate danger) |
|
- |
|
|
|
tributyltin oxide |
|
- |
|
Bis(tri-n-butylzinn)-oxyd |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
|
- |
Record last updated: |
13/02/2025 |
Contact: |
aeru@herts.ac.uk |
Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |