Butenachlor (Ref: KH-218) |
![]() Last updated: 04/01/2021 |
![]() |
(Not known by any other names) |
|
![]() |
|
A selective, soil-applied herbicide used for control of grass and some broad-leaved weeds | |
---|---|---|
|
Barnyardgrass; Crabgrass; Goosegrass; Thistles | |
|
Sorghum; Maize; Rice; Peanuts | |
|
- | |
|
Unknown | |
|
1976, introduced |
UK regulatory status |
|
Not approved | ||
---|---|---|---|
|
Not applicable | ||
|
No UK approval for use |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not approved | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
Isomeric | |
---|---|---|
|
C₁₇H₂₄ClNO₂ | |
|
CCC1=C(C(=CC=C1)CC)N(COCC=CC)C(=O)CCl | |
|
CCC1=C(C(=CC=C1)CC)N(COC/C=C\C)C(=O)CCl | |
|
HZDIJTXDRLNTIS-DAXSKMNVSA-N | |
|
InChI=1S/C17H24ClNO2/c1-4-7-11-21-13-19(16(20)12-18)17-14(5-2)9-8-10-15(17)6-3/h4,7-10H,5-6,11-13H2,1-3H3/b7-4- | |
|
Yes |
General status |
|
Herbicide | |
---|---|---|
|
Chloroacetanilide | |
|
- | |
|
- | |
|
Synthetic | |
|
Inhibits cell division by blocking protein synthesis | |
|
87310-56-3 | |
|
- | |
|
- | |
|
- | |
|
6448437 | |
|
309.83 | |
|
N-{[(2Z)-but-2-en-1-yloxy]methyl}-2-chloro-N-(2,6-diethylphenyl)acetamide | |
|
(Z)-N-but-2-enyloxymethyl-2-chloro-2',6'-diethylacetanilide | |
|
N-(((2Z)-2-butenyloxy)methyl)-2-chloro-N-(2,6-diethylphenyl)acetamide | |
|
- | |
|
- | |
|
K3 | |
|
15 | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Pale yellow liquid |
Formulations |
|
|
|||
---|---|---|---|---|
|
|
|||
|
|
|||
|
Usually supplied as a granular formulation |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
29 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low | ||||||||
|
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Acetone3 = Unverified data of known source |
- | ||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Ethanol3 = Unverified data of known source |
- | |||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Ethyl acetate3 = Unverified data of known source |
- | |||||||||
Miscible | L3 L = Pesticide manuals and hard copy reference books / other sources Hexane3 = Unverified data of known source |
- | |||||||||
|
12.9 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
167 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
3.24 X 1003 | Calculated | - | |||||||
|
3.51 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High | ||||||||
|
1.10 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
0.93 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility | ||||||||
|
1.0 X 10-02 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
3.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | |||||||
|
3.5 | L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
General literature states DT₅₀ range 2-5 days | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
> 2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
> 2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Colinus Virginianus3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
0.48 | L3 L = Pesticide manuals and hard copy reference books / other sources Cyprinus carpio3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
> 2000 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
> 3.34 | L3 L = Pesticide manuals and hard copy reference books / other sources Rat 4 hr3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
- | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
No further information available |
Handling issues |
|
|
|||
---|---|---|---|---|
|
No information available | |||
|
- | |||
|
- | |||
|
- | |||
|
II (Moderately hazardous) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
butenachlor | ||
|
butenachlore | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 04/01/2021 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |