4-chlorophenol |
![]() Last updated: 05/03/2020 |
![]() |
(Also known as: para-chlorophenol; p-chlorophenol; 4-hydroxychlorobenzene) |
|
![]() |
|
Chemical transformation product | |
---|---|---|
|
- | |
|
- |
UK regulatory status |
|
Not applicable | ||
---|---|---|---|
|
Not applicable | ||
|
Not applicable |
EC Regulation 1107/2009 (repealing 91/414) |
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
Not applicable | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
No | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|
Also used in |
|
- |
---|
Chemical structure |
|
- | |
---|---|---|
|
C₆H₅OCl | |
|
C1=CC(=CC=C1O)Cl | |
|
No data | |
|
WXNZTHHGJRFXKQ-UHFFFAOYSA-N | |
|
InChI=1S/C6H5ClO/c7-5-1-3-6(8)4-2-5/h1-4,8H | |
|
Yes |
|
![]() |
Common Name | Relationship | Link |
---|---|---|
4-chlorophenol | - | ![]() |
General status |
|
Metabolite | |
---|---|---|
|
Soil, Groundwater, Surface water | |
|
Organochlorine | |
|
- | |
|
Literature: phenol <1.0% | |
|
Synthetic | |
|
- | |
|
106-48-9 | |
|
203-402-6 | |
|
- | |
|
- | |
|
- | |
|
128.56 | |
|
4-chlorophenol | |
|
4-chlorophenol | |
|
4-chlorophenol | |
|
Possible groundwater contaminant | |
|
UK Environment Agency non-statutory standard for the protection of freshwater and saltwater aquatic life: 50 µg l⁻¹ as annual average; 250 µg l⁻¹ as max acceptable conc. | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
Not applicable | |
|
- | |
|
Faint yellow liquid |
Can be a metabolite of: |
|
|
|
|
|||||
---|---|---|---|---|---|---|---|---|
2,4-D | Soil | 0.330 | Relevant; Major fraction |
Formulations |
|
|
|||
---|---|---|---|---|
|
- | |||
|
- | |||
|
- |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||
|
50 | Q3 Q = Miscellaneous internet resources Ethanol3 = Unverified data of known source |
- | ||||||||
|
42 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
|
220 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
121 | Q3 Q = Miscellaneous internet resources (closed cup)3 = Unverified data of known source |
- | ||||||||
|
|
2.45 X 1002 | Calculated | - | |||||||
|
2.39 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Low | ||||||||
|
1.306 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
|
9.41 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
- | ||||||||
- | |||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - |
Degradation |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Soil adsorption and mobility |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Moderately mobile | |||||||
|
278 | ||||||||||
|
Literature values Koc range 70-485.6 mL g⁻¹ | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | ||||||||||
|
- | ||||||||||
|
- |
Fate indices |
|
|
|
|
||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
- | - | - | ||||||||||||||||||||||||||
|
|
Cannot be calculated | - | - | |||||||||||||||||||||||||
|
- | ||||||||||||||||||||||||||||
|
- | - | - | ||||||||||||||||||||||||||
|
- | - | - |
|
![]() |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | |||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
5.4 | Q3 Q = Miscellaneous internet resources Cyprinodon variegatus3 = Unverified data of known source |
Moderate | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
280 | Q3 Q = Miscellaneous internet resources 3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
- | - | - | |||||||||
|
38.0 | Q3 Q = Miscellaneous internet resources Pseudokirchneriella subcapitata3 = Unverified data of known source |
Low | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
- | |||||||||||
|
- | - | - | ||||||||
- | |||||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
|
- | - | - | |||||||
|
- | ||||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | - | - | |||||||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - | |||
|
|
- | - | - |
|
- | - | - | |||
|
- | - | - | ||||||||
|
|
- | - | - |
|
- | - | - |
|
![]() |
General |
|
|
|
|
||||||||
---|---|---|---|---|---|---|---|---|---|---|---|
|
High (class III) | - | - | ||||||||
|
- | - | - | ||||||||
|
1500 | Q3 Q = Miscellaneous internet resources Rat3 = Unverified data of known source |
- | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
- | - | - | ||||||||
|
|
- | |||||||||
|
May be absorbed through the skin | ||||||||||
|
|
||||||||||
|
- | - | - | ||||||||
|
- | - | - |
Health issues |
|
|
||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
May affect the respiratory system Highly toxic If ingested may cause abdominal pain and eventually unconsciousness. |
Handling issues |
|
|
|||
---|---|---|---|---|
|
When heated to decomposition it emits toxic fumes of hydrogen chloride Combustible Prevent dispersion of dust - possible explosion risk May react with oxidising substances |
|||
|
- | |||
|
- | |||
|
- | |||
|
NL (Not listed) | |||
|
- | |||
|
- |
|
![]() |
|
|
||
---|---|---|---|
|
4-chlorophenol | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- | ||
|
- |
Record last updated: | 05/03/2020 |
Contact: | aeru@herts.ac.uk |
Please cite as: | Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |